From da967da9c7aa0d88f478d476e8bb059ba79ca818 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Lars=20N=C3=A6sbye=20Christensen?= Date: Thu, 11 Jan 2024 11:32:15 +0100 Subject: Rename OS X to macOS, mostly in comments We only support 10.13+ now, and it's been called macOS since 10.12. References in code to older versions are unchanged. --- indra/llcommon/llsys.cpp | 6 +++--- 1 file changed, 3 insertions(+), 3 deletions(-) (limited to 'indra/llcommon/llsys.cpp') diff --git a/indra/llcommon/llsys.cpp b/indra/llcommon/llsys.cpp index 938685bae6..d3f99a413d 100644 --- a/indra/llcommon/llsys.cpp +++ b/indra/llcommon/llsys.cpp @@ -269,9 +269,9 @@ LLOSInfo::LLOSInfo() : #elif LL_DARWIN // Initialize mOSStringSimple to something like: - // "Mac OS X 10.6.7" + // "macOS 10.13.1" { - const char * DARWIN_PRODUCT_NAME = "Mac OS X"; + const char * DARWIN_PRODUCT_NAME = "macOS"; int64_t major_version, minor_version, bugfix_version = 0; @@ -294,7 +294,7 @@ LLOSInfo::LLOSInfo() : } // Initialize mOSString to something like: - // "Mac OS X 10.6.7 Darwin Kernel Version 10.7.0: Sat Jan 29 15:17:16 PST 2011; root:xnu-1504.9.37~1/RELEASE_I386 i386" + // "macOS 10.13.1 Darwin Kernel Version 10.7.0: Sat Jan 29 15:17:16 PST 2011; root:xnu-1504.9.37~1/RELEASE_I386 i386" struct utsname un; if(uname(&un) != -1) { -- cgit v1.2.3 From ba4e7b989b6c20a49da0eeb450bd2f945b3eefc6 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Lars=20N=C3=A6sbye=20Christensen?= Date: Thu, 8 Feb 2024 02:51:51 +0100 Subject: llcommon: BOOL (int) to real bool/LSTATUS --- indra/llcommon/llsys.cpp | 16 ++++++++-------- 1 file changed, 8 insertions(+), 8 deletions(-) (limited to 'indra/llcommon/llsys.cpp') diff --git a/indra/llcommon/llsys.cpp b/indra/llcommon/llsys.cpp index d3f99a413d..8c5f78b3a7 100644 --- a/indra/llcommon/llsys.cpp +++ b/indra/llcommon/llsys.cpp @@ -214,7 +214,7 @@ LLOSInfo::LLOSInfo() : DWORD cbData(sizeof(DWORD)); DWORD data(0); HKEY key; - BOOL ret_code = RegOpenKeyExW(HKEY_LOCAL_MACHINE, TEXT("SOFTWARE\\Microsoft\\Windows NT\\CurrentVersion"), 0, KEY_READ, &key); + LSTATUS ret_code = RegOpenKeyExW(HKEY_LOCAL_MACHINE, TEXT("SOFTWARE\\Microsoft\\Windows NT\\CurrentVersion"), 0, KEY_READ, &key); if (ERROR_SUCCESS == ret_code) { ret_code = RegQueryValueExW(key, L"UBR", 0, NULL, reinterpret_cast(&data), &cbData); @@ -571,7 +571,7 @@ bool LLOSInfo::is64Bit() return true; #elif defined(_WIN32) // 32-bit viewer may be run on both 32-bit and 64-bit Windows, need to elaborate - BOOL f64 = FALSE; + bool f64 = false; return IsWow64Process(GetCurrentProcess(), &f64) && f64; #else return false; @@ -1321,11 +1321,11 @@ private: // Need an instance of FrameWatcher before it does any good static FrameWatcher sFrameWatcher; -BOOL gunzip_file(const std::string& srcfile, const std::string& dstfile) +bool gunzip_file(const std::string& srcfile, const std::string& dstfile) { std::string tmpfile; const S32 UNCOMPRESS_BUFFER_SIZE = 32768; - BOOL retval = FALSE; + bool retval = false; gzFile src = NULL; U8 buffer[UNCOMPRESS_BUFFER_SIZE]; LLFILE *dst = NULL; @@ -1353,18 +1353,18 @@ BOOL gunzip_file(const std::string& srcfile, const std::string& dstfile) fclose(dst); dst = NULL; if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */ - retval = TRUE; + retval = true; err: if (src != NULL) gzclose(src); if (dst != NULL) fclose(dst); return retval; } -BOOL gzip_file(const std::string& srcfile, const std::string& dstfile) +bool gzip_file(const std::string& srcfile, const std::string& dstfile) { const S32 COMPRESS_BUFFER_SIZE = 32768; std::string tmpfile; - BOOL retval = FALSE; + bool retval = false; U8 buffer[COMPRESS_BUFFER_SIZE]; gzFile dst = NULL; LLFILE *src = NULL; @@ -1404,7 +1404,7 @@ BOOL gzip_file(const std::string& srcfile, const std::string& dstfile) LLFile::remove(dstfile); #endif if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */ - retval = TRUE; + retval = true; err: if (src != NULL) fclose(src); if (dst != NULL) gzclose(dst); -- cgit v1.2.3 From e2e37cced861b98de8c1a7c9c0d3a50d2d90e433 Mon Sep 17 00:00:00 2001 From: Ansariel Date: Wed, 22 May 2024 21:25:21 +0200 Subject: Fix line endlings --- indra/llcommon/llsys.cpp | 2828 +++++++++++++++++++++++----------------------- 1 file changed, 1414 insertions(+), 1414 deletions(-) (limited to 'indra/llcommon/llsys.cpp') diff --git a/indra/llcommon/llsys.cpp b/indra/llcommon/llsys.cpp index 02fd0733e5..496ec0d869 100644 --- a/indra/llcommon/llsys.cpp +++ b/indra/llcommon/llsys.cpp @@ -1,1414 +1,1414 @@ -/** - * @file llsys.cpp - * @brief Implementation of the basic system query functions. - * - * $LicenseInfo:firstyear=2002&license=viewerlgpl$ - * Second Life Viewer Source Code - * Copyright (C) 2010, Linden Research, Inc. - * - * This library is free software; you can redistribute it and/or - * modify it under the terms of the GNU Lesser General Public - * License as published by the Free Software Foundation; - * version 2.1 of the License only. - * - * This library is distributed in the hope that it will be useful, - * but WITHOUT ANY WARRANTY; without even the implied warranty of - * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU - * Lesser General Public License for more details. - * - * You should have received a copy of the GNU Lesser General Public - * License along with this library; if not, write to the Free Software - * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA - * - * Linden Research, Inc., 945 Battery Street, San Francisco, CA 94111 USA - * $/LicenseInfo$ - */ - -#if LL_WINDOWS -#pragma warning (disable : 4355) // 'this' used in initializer list: yes, intentionally -#endif - -#include "linden_common.h" - -#include "llsys.h" - -#include -#ifdef LL_USESYSTEMLIBS -# include -#else -# include "zlib-ng/zlib.h" -#endif - -#include "llprocessor.h" -#include "llerrorcontrol.h" -#include "llevents.h" -#include "llformat.h" -#include "llregex.h" -#include "lltimer.h" -#include "llsdserialize.h" -#include "llsdutil.h" -#include -#include -#include -#include -#include -#include -#include -#include "llfasttimer.h" - -using namespace llsd; - -#if LL_WINDOWS -# include "llwin32headerslean.h" -# include // GetPerformanceInfo() et al. -# include -#elif LL_DARWIN -# include "llsys_objc.h" -# include -# include -# include -# include -# include -# include -# include -# include -# include -# include -#elif LL_LINUX -# include -# include -# include -# include -# include -const char MEMINFO_FILE[] = "/proc/meminfo"; -# include -#endif - -LLCPUInfo gSysCPU; - -// Don't log memory info any more often than this. It also serves as our -// framerate sample size. -static const F32 MEM_INFO_THROTTLE = 20; -// Sliding window of samples. We intentionally limit the length of time we -// remember "the slowest" framerate because framerate is very slow at login. -// If we only triggered FrameWatcher logging when the session framerate -// dropped below the login framerate, we'd have very little additional data. -static const F32 MEM_INFO_WINDOW = 10*60; - -LLOSInfo::LLOSInfo() : - mMajorVer(0), mMinorVer(0), mBuild(0), mOSVersionString("") -{ - -#if LL_WINDOWS - - if (IsWindows10OrGreater()) - { - mMajorVer = 10; - mMinorVer = 0; - mOSStringSimple = "Microsoft Windows 10 "; - } - else if (IsWindows8Point1OrGreater()) - { - mMajorVer = 6; - mMinorVer = 3; - if (IsWindowsServer()) - { - mOSStringSimple = "Windows Server 2012 R2 "; - } - else - { - mOSStringSimple = "Microsoft Windows 8.1 "; - } - } - else if (IsWindows8OrGreater()) - { - mMajorVer = 6; - mMinorVer = 2; - if (IsWindowsServer()) - { - mOSStringSimple = "Windows Server 2012 "; - } - else - { - mOSStringSimple = "Microsoft Windows 8 "; - } - } - else if (IsWindows7SP1OrGreater()) - { - mMajorVer = 6; - mMinorVer = 1; - if (IsWindowsServer()) - { - mOSStringSimple = "Windows Server 2008 R2 SP1 "; - } - else - { - mOSStringSimple = "Microsoft Windows 7 SP1 "; - } - } - else if (IsWindows7OrGreater()) - { - mMajorVer = 6; - mMinorVer = 1; - if (IsWindowsServer()) - { - mOSStringSimple = "Windows Server 2008 R2 "; - } - else - { - mOSStringSimple = "Microsoft Windows 7 "; - } - } - else if (IsWindowsVistaSP2OrGreater()) - { - mMajorVer = 6; - mMinorVer = 0; - if (IsWindowsServer()) - { - mOSStringSimple = "Windows Server 2008 SP2 "; - } - else - { - mOSStringSimple = "Microsoft Windows Vista SP2 "; - } - } - else - { - mOSStringSimple = "Unsupported Windows version "; - } - - ///get native system info if available.. - typedef void (WINAPI *PGNSI)(LPSYSTEM_INFO); ///function pointer for loading GetNativeSystemInfo - SYSTEM_INFO si; //System Info object file contains architecture info - PGNSI pGNSI; //pointer object - ZeroMemory(&si, sizeof(SYSTEM_INFO)); //zero out the memory in information - pGNSI = (PGNSI)GetProcAddress(GetModuleHandle(TEXT("kernel32.dll")), "GetNativeSystemInfo"); //load kernel32 get function - if (NULL != pGNSI) //check if it has failed - pGNSI(&si); //success - else - GetSystemInfo(&si); //if it fails get regular system info - //(Warning: If GetSystemInfo it may result in incorrect information in a WOW64 machine, if the kernel fails to load) - - // Try calling GetVersionEx using the OSVERSIONINFOEX structure. - OSVERSIONINFOEX osvi; - ZeroMemory(&osvi, sizeof(OSVERSIONINFOEX)); - osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFOEX); - if (GetVersionEx((OSVERSIONINFO *)&osvi)) - { - mBuild = osvi.dwBuildNumber & 0xffff; - } - else - { - // If OSVERSIONINFOEX doesn't work, try OSVERSIONINFO. - osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFO); - if (GetVersionEx((OSVERSIONINFO *)&osvi)) - { - mBuild = osvi.dwBuildNumber & 0xffff; - } - } - - S32 ubr = 0; // Windows 10 Update Build Revision, can be retrieved from a registry - if (mMajorVer == 10) - { - DWORD cbData(sizeof(DWORD)); - DWORD data(0); - HKEY key; - LSTATUS ret_code = RegOpenKeyExW(HKEY_LOCAL_MACHINE, TEXT("SOFTWARE\\Microsoft\\Windows NT\\CurrentVersion"), 0, KEY_READ, &key); - if (ERROR_SUCCESS == ret_code) - { - ret_code = RegQueryValueExW(key, L"UBR", 0, NULL, reinterpret_cast(&data), &cbData); - if (ERROR_SUCCESS == ret_code) - { - ubr = data; - } - } - - if (mBuild >= 22000) - { - // At release Windows 11 version was 10.0.22000.194 - // Windows 10 version was 10.0.19043.1266 - // There is no warranty that Win10 build won't increase, - // so until better solution is found or Microsoft updates - // SDK with IsWindows11OrGreater(), indicate "10/11" - // - // Current alternatives: - // Query WMI's Win32_OperatingSystem for OS string. Slow - // and likely to return 'compatibility' string. - // Check presence of dlls/libs or may be their version. - mOSStringSimple = "Microsoft Windows 10/11 "; - } - } - - //msdn microsoft finds 32 bit and 64 bit flavors this way.. - //http://msdn.microsoft.com/en-us/library/ms724429(VS.85).aspx (example code that contains quite a few more flavors - //of windows than this code does (in case it is needed for the future) - if (si.wProcessorArchitecture == PROCESSOR_ARCHITECTURE_AMD64) //check for 64 bit - { - mOSStringSimple += "64-bit "; - } - else if (si.wProcessorArchitecture == PROCESSOR_ARCHITECTURE_INTEL) - { - mOSStringSimple += "32-bit "; - } - - mOSString = mOSStringSimple; - if (mBuild > 0) - { - mOSString += llformat("(Build %d", mBuild); - if (ubr > 0) - { - mOSString += llformat(".%d", ubr); - } - mOSString += ")"; - } - - LLStringUtil::trim(mOSStringSimple); - LLStringUtil::trim(mOSString); - -#elif LL_DARWIN - - // Initialize mOSStringSimple to something like: - // "macOS 10.13.1" - { - const char * DARWIN_PRODUCT_NAME = "macOS"; - - int64_t major_version, minor_version, bugfix_version = 0; - - if (LLGetDarwinOSInfo(major_version, minor_version, bugfix_version)) - { - mMajorVer = major_version; - mMinorVer = minor_version; - mBuild = bugfix_version; - - std::stringstream os_version_string; - os_version_string << DARWIN_PRODUCT_NAME << " " << mMajorVer << "." << mMinorVer << "." << mBuild; - - // Put it in the OS string we are compiling - mOSStringSimple.append(os_version_string.str()); - } - else - { - mOSStringSimple.append("Unable to collect OS info"); - } - } - - // Initialize mOSString to something like: - // "macOS 10.13.1 Darwin Kernel Version 10.7.0: Sat Jan 29 15:17:16 PST 2011; root:xnu-1504.9.37~1/RELEASE_I386 i386" - struct utsname un; - if(uname(&un) != -1) - { - mOSString = mOSStringSimple; - mOSString.append(" "); - mOSString.append(un.sysname); - mOSString.append(" "); - mOSString.append(un.release); - mOSString.append(" "); - mOSString.append(un.version); - mOSString.append(" "); - mOSString.append(un.machine); - } - else - { - mOSString = mOSStringSimple; - } - -#elif LL_LINUX - - struct utsname un; - if(uname(&un) != -1) - { - mOSStringSimple.append(un.sysname); - mOSStringSimple.append(" "); - mOSStringSimple.append(un.release); - - mOSString = mOSStringSimple; - mOSString.append(" "); - mOSString.append(un.version); - mOSString.append(" "); - mOSString.append(un.machine); - - // Simplify 'Simple' - std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0)); - if (ostype == "Linux") - { - // Only care about major and minor Linux versions, truncate at second '.' - std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0); - std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos; - std::string simple = mOSStringSimple.substr(0, idx2); - if (simple.length() > 0) - mOSStringSimple = simple; - } - } - else - { - mOSStringSimple.append("Unable to collect OS info"); - mOSString = mOSStringSimple; - } - - const char OS_VERSION_MATCH_EXPRESSION[] = "([0-9]+)\\.([0-9]+)(\\.([0-9]+))?"; - boost::regex os_version_parse(OS_VERSION_MATCH_EXPRESSION); - boost::smatch matched; - - std::string glibc_version(gnu_get_libc_version()); - if ( ll_regex_match(glibc_version, matched, os_version_parse) ) - { - LL_INFOS("AppInit") << "Using glibc version '" << glibc_version << "' as OS version" << LL_ENDL; - - std::string version_value; - - if ( matched[1].matched ) // Major version - { - version_value.assign(matched[1].first, matched[1].second); - if (sscanf(version_value.c_str(), "%d", &mMajorVer) != 1) - { - LL_WARNS("AppInit") << "failed to parse major version '" << version_value << "' as a number" << LL_ENDL; - } - } - else - { - LL_ERRS("AppInit") - << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION - << "' returned true, but major version [1] did not match" - << LL_ENDL; - } - - if ( matched[2].matched ) // Minor version - { - version_value.assign(matched[2].first, matched[2].second); - if (sscanf(version_value.c_str(), "%d", &mMinorVer) != 1) - { - LL_ERRS("AppInit") << "failed to parse minor version '" << version_value << "' as a number" << LL_ENDL; - } - } - else - { - LL_ERRS("AppInit") - << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION - << "' returned true, but minor version [1] did not match" - << LL_ENDL; - } - - if ( matched[4].matched ) // Build version (optional) - note that [3] includes the '.' - { - version_value.assign(matched[4].first, matched[4].second); - if (sscanf(version_value.c_str(), "%d", &mBuild) != 1) - { - LL_ERRS("AppInit") << "failed to parse build version '" << version_value << "' as a number" << LL_ENDL; - } - } - else - { - LL_INFOS("AppInit") - << "OS build version not provided; using zero" - << LL_ENDL; - } - } - else - { - LL_WARNS("AppInit") << "glibc version '" << glibc_version << "' cannot be parsed to three numbers; using all zeros" << LL_ENDL; - } - -#else - - struct utsname un; - if(uname(&un) != -1) - { - mOSStringSimple.append(un.sysname); - mOSStringSimple.append(" "); - mOSStringSimple.append(un.release); - - mOSString = mOSStringSimple; - mOSString.append(" "); - mOSString.append(un.version); - mOSString.append(" "); - mOSString.append(un.machine); - - // Simplify 'Simple' - std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0)); - if (ostype == "Linux") - { - // Only care about major and minor Linux versions, truncate at second '.' - std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0); - std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos; - std::string simple = mOSStringSimple.substr(0, idx2); - if (simple.length() > 0) - mOSStringSimple = simple; - } - } - else - { - mOSStringSimple.append("Unable to collect OS info"); - mOSString = mOSStringSimple; - } - -#endif - - std::stringstream dotted_version_string; - dotted_version_string << mMajorVer << "." << mMinorVer << "." << mBuild; - mOSVersionString.append(dotted_version_string.str()); - - mOSBitness = is64Bit() ? 64 : 32; - LL_INFOS("LLOSInfo") << "OS bitness: " << mOSBitness << LL_ENDL; -} - -#ifndef LL_WINDOWS -// static -long LLOSInfo::getMaxOpenFiles() -{ - const long OPEN_MAX_GUESS = 256; - -#ifdef OPEN_MAX - static long open_max = OPEN_MAX; -#else - static long open_max = 0; -#endif - - if (0 == open_max) - { - // First time through. - errno = 0; - if ( (open_max = sysconf(_SC_OPEN_MAX)) < 0) - { - if (0 == errno) - { - // Indeterminate. - open_max = OPEN_MAX_GUESS; - } - else - { - LL_ERRS() << "LLOSInfo::getMaxOpenFiles: sysconf error for _SC_OPEN_MAX" << LL_ENDL; - } - } - } - return open_max; -} -#endif - -void LLOSInfo::stream(std::ostream& s) const -{ - s << mOSString; -} - -const std::string& LLOSInfo::getOSString() const -{ - return mOSString; -} - -const std::string& LLOSInfo::getOSStringSimple() const -{ - return mOSStringSimple; -} - -const std::string& LLOSInfo::getOSVersionString() const -{ - return mOSVersionString; -} - -const S32 LLOSInfo::getOSBitness() const -{ - return mOSBitness; -} - -//static -U32 LLOSInfo::getProcessVirtualSizeKB() -{ - U32 virtual_size = 0; -#if LL_LINUX -# define STATUS_SIZE 2048 - LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb"); - if (status_filep) - { - S32 numRead = 0; - char buff[STATUS_SIZE]; /* Flawfinder: ignore */ - - size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep); - buff[nbytes] = '\0'; - - // All these guys return numbers in KB - char *memp = strstr(buff, "VmSize:"); - if (memp) - { - numRead += sscanf(memp, "%*s %u", &virtual_size); - } - fclose(status_filep); - } -#endif - return virtual_size; -} - -//static -U32 LLOSInfo::getProcessResidentSizeKB() -{ - U32 resident_size = 0; -#if LL_LINUX - LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb"); - if (status_filep != NULL) - { - S32 numRead = 0; - char buff[STATUS_SIZE]; /* Flawfinder: ignore */ - - size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep); - buff[nbytes] = '\0'; - - // All these guys return numbers in KB - char *memp = strstr(buff, "VmRSS:"); - if (memp) - { - numRead += sscanf(memp, "%*s %u", &resident_size); - } - fclose(status_filep); - } -#endif - return resident_size; -} - -//static -bool LLOSInfo::is64Bit() -{ -#if LL_WINDOWS -#if defined(_WIN64) - return true; -#elif defined(_WIN32) - // 32-bit viewer may be run on both 32-bit and 64-bit Windows, need to elaborate - bool f64 = false; - return IsWow64Process(GetCurrentProcess(), &f64) && f64; -#else - return false; -#endif -#else // ! LL_WINDOWS - // we only build a 64-bit mac viewer and currently we don't build for linux at all - return true; -#endif -} - -LLCPUInfo::LLCPUInfo() -{ - std::ostringstream out; - LLProcessorInfo proc; - // proc.WriteInfoTextFile("procInfo.txt"); - mHasSSE = proc.hasSSE(); - mHasSSE2 = proc.hasSSE2(); - mHasSSE3 = proc.hasSSE3(); - mHasSSE3S = proc.hasSSE3S(); - mHasSSE41 = proc.hasSSE41(); - mHasSSE42 = proc.hasSSE42(); - mHasSSE4a = proc.hasSSE4a(); - mHasAltivec = proc.hasAltivec(); - mCPUMHz = (F64)proc.getCPUFrequency(); - mFamily = proc.getCPUFamilyName(); - mCPUString = "Unknown"; - - out << proc.getCPUBrandName(); - if (200 < mCPUMHz && mCPUMHz < 10000) // *NOTE: cpu speed is often way wrong, do a sanity check - { - out << " (" << mCPUMHz << " MHz)"; - } - mCPUString = out.str(); - LLStringUtil::trim(mCPUString); - - if (mHasSSE) - { - mSSEVersions.append("1"); - } - if (mHasSSE2) - { - mSSEVersions.append("2"); - } - if (mHasSSE3) - { - mSSEVersions.append("3"); - } - if (mHasSSE3S) - { - mSSEVersions.append("3S"); - } - if (mHasSSE41) - { - mSSEVersions.append("4.1"); - } - if (mHasSSE42) - { - mSSEVersions.append("4.2"); - } - if (mHasSSE4a) - { - mSSEVersions.append("4a"); - } -} - -bool LLCPUInfo::hasAltivec() const -{ - return mHasAltivec; -} - -bool LLCPUInfo::hasSSE() const -{ - return mHasSSE; -} - -bool LLCPUInfo::hasSSE2() const -{ - return mHasSSE2; -} - -bool LLCPUInfo::hasSSE3() const -{ - return mHasSSE3; -} - -bool LLCPUInfo::hasSSE3S() const -{ - return mHasSSE3S; -} - -bool LLCPUInfo::hasSSE41() const -{ - return mHasSSE41; -} - -bool LLCPUInfo::hasSSE42() const -{ - return mHasSSE42; -} - -bool LLCPUInfo::hasSSE4a() const -{ - return mHasSSE4a; -} - -F64 LLCPUInfo::getMHz() const -{ - return mCPUMHz; -} - -std::string LLCPUInfo::getCPUString() const -{ - return mCPUString; -} - -const LLSD& LLCPUInfo::getSSEVersions() const -{ - return mSSEVersions; -} - -void LLCPUInfo::stream(std::ostream& s) const -{ - // gather machine information. - s << LLProcessorInfo().getCPUFeatureDescription(); - - // These are interesting as they reflect our internal view of the - // CPU's attributes regardless of platform - s << "->mHasSSE: " << (U32)mHasSSE << std::endl; - s << "->mHasSSE2: " << (U32)mHasSSE2 << std::endl; - s << "->mHasSSE3: " << (U32)mHasSSE3 << std::endl; - s << "->mHasSSE3S: " << (U32)mHasSSE3S << std::endl; - s << "->mHasSSE41: " << (U32)mHasSSE41 << std::endl; - s << "->mHasSSE42: " << (U32)mHasSSE42 << std::endl; - s << "->mHasSSE4a: " << (U32)mHasSSE4a << std::endl; - s << "->mHasAltivec: " << (U32)mHasAltivec << std::endl; - s << "->mCPUMHz: " << mCPUMHz << std::endl; - s << "->mCPUString: " << mCPUString << std::endl; -} - -// Helper class for LLMemoryInfo: accumulate stats in the form we store for -// LLMemoryInfo::getStatsMap(). -class Stats -{ -public: - Stats(): - mStats(LLSD::emptyMap()) - {} - - // Store every integer type as LLSD::Integer. - template - void add(const LLSD::String& name, const T& value, - typename boost::enable_if >::type* = 0) - { - mStats[name] = LLSD::Integer(value); - } - - // Store every floating-point type as LLSD::Real. - template - void add(const LLSD::String& name, const T& value, - typename boost::enable_if >::type* = 0) - { - mStats[name] = LLSD::Real(value); - } - - // Hope that LLSD::Date values are sufficiently unambiguous. - void add(const LLSD::String& name, const LLSD::Date& value) - { - mStats[name] = value; - } - - LLSD get() const { return mStats; } - -private: - LLSD mStats; -}; - -LLMemoryInfo::LLMemoryInfo() -{ - refresh(); -} - -#if LL_WINDOWS -static U32Kilobytes LLMemoryAdjustKBResult(U32Kilobytes inKB) -{ - // Moved this here from llfloaterabout.cpp - - //! \bug - // For some reason, the reported amount of memory is always wrong. - // The original adjustment assumes it's always off by one meg, however - // errors of as much as 2520 KB have been observed in the value - // returned from the GetMemoryStatusEx function. Here we keep the - // original adjustment from llfoaterabout.cpp until this can be - // fixed somehow. - inKB += U32Megabytes(1); - - return inKB; -} -#endif - -#if LL_DARWIN -// static -U32Kilobytes LLMemoryInfo::getHardwareMemSize() -{ - // This might work on Linux as well. Someone check... - uint64_t phys = 0; - int mib[2] = { CTL_HW, HW_MEMSIZE }; - - size_t len = sizeof(phys); - sysctl(mib, 2, &phys, &len, NULL, 0); - - return U64Bytes(phys); -} -#endif - -U32Kilobytes LLMemoryInfo::getPhysicalMemoryKB() const -{ -#if LL_WINDOWS - return LLMemoryAdjustKBResult(U32Kilobytes(mStatsMap["Total Physical KB"].asInteger())); - -#elif LL_DARWIN - return getHardwareMemSize(); - -#elif LL_LINUX - U64 phys = 0; - phys = (U64)(getpagesize()) * (U64)(get_phys_pages()); - return U64Bytes(phys); - -#else - return 0; - -#endif -} - -//static -void LLMemoryInfo::getAvailableMemoryKB(U32Kilobytes& avail_physical_mem_kb, U32Kilobytes& avail_virtual_mem_kb) -{ -#if LL_WINDOWS - // Sigh, this shouldn't be a static method, then we wouldn't have to - // reload this data separately from refresh() - LLSD statsMap(loadStatsMap()); - - avail_physical_mem_kb = (U32Kilobytes)statsMap["Avail Physical KB"].asInteger(); - avail_virtual_mem_kb = (U32Kilobytes)statsMap["Avail Virtual KB"].asInteger(); - -#elif LL_DARWIN - // mStatsMap is derived from vm_stat, look for (e.g.) "kb free": - // $ vm_stat - // Mach Virtual Memory Statistics: (page size of 4096 bytes) - // Pages free: 462078. - // Pages active: 142010. - // Pages inactive: 220007. - // Pages wired down: 159552. - // "Translation faults": 220825184. - // Pages copy-on-write: 2104153. - // Pages zero filled: 167034876. - // Pages reactivated: 65153. - // Pageins: 2097212. - // Pageouts: 41759. - // Object cache: 841598 hits of 7629869 lookups (11% hit rate) - avail_physical_mem_kb = (U32Kilobytes)-1 ; - avail_virtual_mem_kb = (U32Kilobytes)-1 ; - -#elif LL_LINUX - // mStatsMap is derived from MEMINFO_FILE: - // $ cat /proc/meminfo - // MemTotal: 4108424 kB - // MemFree: 1244064 kB - // Buffers: 85164 kB - // Cached: 1990264 kB - // SwapCached: 0 kB - // Active: 1176648 kB - // Inactive: 1427532 kB - // Active(anon): 529152 kB - // Inactive(anon): 15924 kB - // Active(file): 647496 kB - // Inactive(file): 1411608 kB - // Unevictable: 16 kB - // Mlocked: 16 kB - // HighTotal: 3266316 kB - // HighFree: 721308 kB - // LowTotal: 842108 kB - // LowFree: 522756 kB - // SwapTotal: 6384632 kB - // SwapFree: 6384632 kB - // Dirty: 28 kB - // Writeback: 0 kB - // AnonPages: 528820 kB - // Mapped: 89472 kB - // Shmem: 16324 kB - // Slab: 159624 kB - // SReclaimable: 145168 kB - // SUnreclaim: 14456 kB - // KernelStack: 2560 kB - // PageTables: 5560 kB - // NFS_Unstable: 0 kB - // Bounce: 0 kB - // WritebackTmp: 0 kB - // CommitLimit: 8438844 kB - // Committed_AS: 1271596 kB - // VmallocTotal: 122880 kB - // VmallocUsed: 65252 kB - // VmallocChunk: 52356 kB - // HardwareCorrupted: 0 kB - // HugePages_Total: 0 - // HugePages_Free: 0 - // HugePages_Rsvd: 0 - // HugePages_Surp: 0 - // Hugepagesize: 2048 kB - // DirectMap4k: 434168 kB - // DirectMap2M: 477184 kB - // (could also run 'free', but easier to read a file than run a program) - avail_physical_mem_kb = (U32Kilobytes)-1 ; - avail_virtual_mem_kb = (U32Kilobytes)-1 ; - -#else - //do not know how to collect available memory info for other systems. - //leave it blank here for now. - - avail_physical_mem_kb = (U32Kilobytes)-1 ; - avail_virtual_mem_kb = (U32Kilobytes)-1 ; -#endif -} - -void LLMemoryInfo::stream(std::ostream& s) const -{ - // We want these memory stats to be easy to grep from the log, along with - // the timestamp. So preface each line with the timestamp and a - // distinctive marker. Without that, we'd have to search the log for the - // introducer line, then read subsequent lines, etc... - std::string pfx(LLError::utcTime() + " "); - - // Max key length - size_t key_width(0); - for (const auto& [key, value] : inMap(mStatsMap)) - { - size_t len(key.length()); - if (len > key_width) - { - key_width = len; - } - } - - // Now stream stats - for (const auto& [key, value] : inMap(mStatsMap)) - { - s << pfx << std::setw(narrow(key_width+1)) << (key + ':') << ' '; - if (value.isInteger()) - s << std::setw(12) << value.asInteger(); - else if (value.isReal()) - s << std::fixed << std::setprecision(1) << value.asReal(); - else if (value.isDate()) - value.asDate().toStream(s); - else - s << value; // just use default LLSD formatting - s << std::endl; - } -} - -LLSD LLMemoryInfo::getStatsMap() const -{ - return mStatsMap; -} - -LLMemoryInfo& LLMemoryInfo::refresh() -{ - LL_PROFILE_ZONE_SCOPED - mStatsMap = loadStatsMap(); - - LL_DEBUGS("LLMemoryInfo") << "Populated mStatsMap:\n"; - LLSDSerialize::toPrettyXML(mStatsMap, LL_CONT); - LL_ENDL; - - return *this; -} - -LLSD LLMemoryInfo::loadStatsMap() -{ - LL_PROFILE_ZONE_SCOPED; - - // This implementation is derived from stream() code (as of 2011-06-29). - Stats stats; - - // associate timestamp for analysis over time - stats.add("timestamp", LLDate::now()); - -#if LL_WINDOWS - MEMORYSTATUSEX state; - state.dwLength = sizeof(state); - GlobalMemoryStatusEx(&state); - - DWORDLONG div = 1024; - - stats.add("Percent Memory use", state.dwMemoryLoad/div); - stats.add("Total Physical KB", state.ullTotalPhys/div); - stats.add("Avail Physical KB", state.ullAvailPhys/div); - stats.add("Total page KB", state.ullTotalPageFile/div); - stats.add("Avail page KB", state.ullAvailPageFile/div); - stats.add("Total Virtual KB", state.ullTotalVirtual/div); - stats.add("Avail Virtual KB", state.ullAvailVirtual/div); - - // SL-12122 - Call to GetPerformanceInfo() was removed here. Took - // on order of 10 ms, causing unacceptable frame time spike every - // second, and results were never used. If this is needed in the - // future, must find a way to avoid frame time impact (e.g. move - // to another thread, call much less often). - - PROCESS_MEMORY_COUNTERS_EX pmem; - pmem.cb = sizeof(pmem); - // GetProcessMemoryInfo() is documented to accept either - // PROCESS_MEMORY_COUNTERS* or PROCESS_MEMORY_COUNTERS_EX*, presumably - // using the redundant size info to distinguish. But its prototype - // specifically accepts PROCESS_MEMORY_COUNTERS*, and since this is a - // classic-C API, PROCESS_MEMORY_COUNTERS_EX isn't a subclass. Cast the - // pointer. - GetProcessMemoryInfo(GetCurrentProcess(), PPROCESS_MEMORY_COUNTERS(&pmem), sizeof(pmem)); - - stats.add("Page Fault Count", pmem.PageFaultCount); - stats.add("PeakWorkingSetSize KB", pmem.PeakWorkingSetSize/div); - stats.add("WorkingSetSize KB", pmem.WorkingSetSize/div); - stats.add("QutaPeakPagedPoolUsage KB", pmem.QuotaPeakPagedPoolUsage/div); - stats.add("QuotaPagedPoolUsage KB", pmem.QuotaPagedPoolUsage/div); - stats.add("QuotaPeakNonPagedPoolUsage KB", pmem.QuotaPeakNonPagedPoolUsage/div); - stats.add("QuotaNonPagedPoolUsage KB", pmem.QuotaNonPagedPoolUsage/div); - stats.add("PagefileUsage KB", pmem.PagefileUsage/div); - stats.add("PeakPagefileUsage KB", pmem.PeakPagefileUsage/div); - stats.add("PrivateUsage KB", pmem.PrivateUsage/div); - -#elif LL_DARWIN - - const vm_size_t pagekb(vm_page_size / 1024); - - // - // Collect the vm_stat's - // - - { - vm_statistics64_data_t vmstat; - mach_msg_type_number_t vmstatCount = HOST_VM_INFO64_COUNT; - - if (host_statistics64(mach_host_self(), HOST_VM_INFO64, (host_info64_t) &vmstat, &vmstatCount) != KERN_SUCCESS) - { - LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL; - } - else - { - stats.add("Pages free KB", pagekb * vmstat.free_count); - stats.add("Pages active KB", pagekb * vmstat.active_count); - stats.add("Pages inactive KB", pagekb * vmstat.inactive_count); - stats.add("Pages wired KB", pagekb * vmstat.wire_count); - - stats.add("Pages zero fill", vmstat.zero_fill_count); - stats.add("Page reactivations", vmstat.reactivations); - stats.add("Page-ins", vmstat.pageins); - stats.add("Page-outs", vmstat.pageouts); - - stats.add("Faults", vmstat.faults); - stats.add("Faults copy-on-write", vmstat.cow_faults); - - stats.add("Cache lookups", vmstat.lookups); - stats.add("Cache hits", vmstat.hits); - - stats.add("Page purgeable count", vmstat.purgeable_count); - stats.add("Page purges", vmstat.purges); - - stats.add("Page speculative reads", vmstat.speculative_count); - } - } - - // - // Collect the misc task info - // - - { - task_events_info_data_t taskinfo; - unsigned taskinfoSize = sizeof(taskinfo); - - if (task_info(mach_task_self(), TASK_EVENTS_INFO, (task_info_t) &taskinfo, &taskinfoSize) != KERN_SUCCESS) - { - LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL; - } - else - { - stats.add("Task page-ins", taskinfo.pageins); - stats.add("Task copy-on-write faults", taskinfo.cow_faults); - stats.add("Task messages sent", taskinfo.messages_sent); - stats.add("Task messages received", taskinfo.messages_received); - stats.add("Task mach system call count", taskinfo.syscalls_mach); - stats.add("Task unix system call count", taskinfo.syscalls_unix); - stats.add("Task context switch count", taskinfo.csw); - } - } - - // - // Collect the basic task info - // - - { - mach_task_basic_info_data_t taskinfo; - mach_msg_type_number_t task_count = MACH_TASK_BASIC_INFO_COUNT; - if (task_info(mach_task_self(), MACH_TASK_BASIC_INFO, (task_info_t) &taskinfo, &task_count) != KERN_SUCCESS) - { - LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL; - } - else - { - stats.add("Basic virtual memory KB", taskinfo.virtual_size / 1024); - stats.add("Basic resident memory KB", taskinfo.resident_size / 1024); - stats.add("Basic max resident memory KB", taskinfo.resident_size_max / 1024); - stats.add("Basic new thread policy", taskinfo.policy); - stats.add("Basic suspend count", taskinfo.suspend_count); - } - } - -#elif LL_LINUX - std::ifstream meminfo(MEMINFO_FILE); - if (meminfo.is_open()) - { - // MemTotal: 4108424 kB - // MemFree: 1244064 kB - // Buffers: 85164 kB - // Cached: 1990264 kB - // SwapCached: 0 kB - // Active: 1176648 kB - // Inactive: 1427532 kB - // ... - // VmallocTotal: 122880 kB - // VmallocUsed: 65252 kB - // VmallocChunk: 52356 kB - // HardwareCorrupted: 0 kB - // HugePages_Total: 0 - // HugePages_Free: 0 - // HugePages_Rsvd: 0 - // HugePages_Surp: 0 - // Hugepagesize: 2048 kB - // DirectMap4k: 434168 kB - // DirectMap2M: 477184 kB - - // Intentionally don't pass the boost::no_except flag. This - // boost::regex object is constructed with a string literal, so it - // should be valid every time. If it becomes invalid, we WANT an - // exception, hopefully even before the dev checks in. - boost::regex stat_rx("(.+): +([0-9]+)( kB)?"); - boost::smatch matched; - - std::string line; - while (std::getline(meminfo, line)) - { - LL_DEBUGS("LLMemoryInfo") << line << LL_ENDL; - if (ll_regex_match(line, matched, stat_rx)) - { - // e.g. "MemTotal: 4108424 kB" - LLSD::String key(matched[1].first, matched[1].second); - LLSD::String value_str(matched[2].first, matched[2].second); - LLSD::Integer value(0); - try - { - value = boost::lexical_cast(value_str); - } - catch (const boost::bad_lexical_cast&) - { - LL_WARNS("LLMemoryInfo") << "couldn't parse '" << value_str - << "' in " << MEMINFO_FILE << " line: " - << line << LL_ENDL; - continue; - } - // Store this statistic. - stats.add(key, value); - } - else - { - LL_WARNS("LLMemoryInfo") << "unrecognized " << MEMINFO_FILE << " line: " - << line << LL_ENDL; - } - } - } - else - { - LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL; - } - -#else - LL_WARNS("LLMemoryInfo") << "Unknown system; unable to collect memory information" << LL_ENDL; - -#endif - - return stats.get(); -} - -std::ostream& operator<<(std::ostream& s, const LLOSInfo& info) -{ - info.stream(s); - return s; -} - -std::ostream& operator<<(std::ostream& s, const LLCPUInfo& info) -{ - info.stream(s); - return s; -} - -std::ostream& operator<<(std::ostream& s, const LLMemoryInfo& info) -{ - info.stream(s); - return s; -} - -class FrameWatcher -{ -public: - FrameWatcher(): - // Hooking onto the "mainloop" event pump gets us one call per frame. - mConnection(LLEventPumps::instance() - .obtain("mainloop") - .listen("FrameWatcher", boost::bind(&FrameWatcher::tick, this, _1))), - // Initializing mSampleStart to an invalid timestamp alerts us to skip - // trying to compute framerate on the first call. - mSampleStart(-1), - // Initializing mSampleEnd to 0 ensures that we treat the first call - // as the completion of a sample window. - mSampleEnd(0), - mFrames(0), - // Both MEM_INFO_WINDOW and MEM_INFO_THROTTLE are in seconds. We need - // the number of integer MEM_INFO_THROTTLE sample slots that will fit - // in MEM_INFO_WINDOW. Round up. - mSamples(int((MEM_INFO_WINDOW / MEM_INFO_THROTTLE) + 0.7)), - // Initializing to F32_MAX means that the first real frame will become - // the slowest ever, which sounds like a good idea. - mSlowest(F32_MAX) - {} - - bool tick(const LLSD&) - { - F32 timestamp(mTimer.getElapsedTimeF32()); - - // Count this frame in the interval just completed. - ++mFrames; - - // Have we finished a sample window yet? - if (timestamp < mSampleEnd) - { - // no, just keep waiting - return false; - } - - // Set up for next sample window. Capture values for previous frame in - // local variables and reset data members. - U32 frames(mFrames); - F32 sampleStart(mSampleStart); - // No frames yet in next window - mFrames = 0; - // which starts right now - mSampleStart = timestamp; - // and ends MEM_INFO_THROTTLE seconds in the future - mSampleEnd = mSampleStart + MEM_INFO_THROTTLE; - - // On the very first call, that's all we can do, no framerate - // computation is possible. - if (sampleStart < 0) - { - return false; - } - - // How long did this actually take? As framerate slows, the duration - // of the frame we just finished could push us WELL beyond our desired - // sample window size. - F32 elapsed(timestamp - sampleStart); - F32 framerate(frames/elapsed); - - // Remember previous slowest framerate because we're just about to - // update it. - F32 slowest(mSlowest); - // Remember previous number of samples. - boost::circular_buffer::size_type prevSize(mSamples.size()); - - // Capture new framerate in our samples buffer. Once the buffer is - // full (after MEM_INFO_WINDOW seconds), this will displace the oldest - // sample. ("So they all rolled over, and one fell out...") - mSamples.push_back(framerate); - - // Calculate the new minimum framerate. I know of no way to update a - // rolling minimum without ever rescanning the buffer. But since there - // are only a few tens of items in this buffer, rescanning it is - // probably cheaper (and certainly easier to reason about) than - // attempting to optimize away some of the scans. - mSlowest = framerate; // pick an arbitrary entry to start - for (boost::circular_buffer::const_iterator si(mSamples.begin()), send(mSamples.end()); - si != send; ++si) - { - if (*si < mSlowest) - { - mSlowest = *si; - } - } - - // We're especially interested in memory as framerate drops. Only log - // when framerate drops below the slowest framerate we remember. - // (Should always be true for the end of the very first sample - // window.) - if (framerate >= slowest) - { - return false; - } - // Congratulations, we've hit a new low. :-P - - LL_INFOS("FrameWatcher") << ' '; - if (! prevSize) - { - LL_CONT << "initial framerate "; - } - else - { - LL_CONT << "slowest framerate for last " << int(prevSize * MEM_INFO_THROTTLE) - << " seconds "; - } - - auto precision = LL_CONT.precision(); - - LL_CONT << std::fixed << std::setprecision(1) << framerate << '\n' - << LLMemoryInfo(); - - LL_CONT.precision(precision); - LL_CONT << LL_ENDL; - return false; - } - -private: - // Storing the connection in an LLTempBoundListener ensures it will be - // disconnected when we're destroyed. - LLTempBoundListener mConnection; - // Track elapsed time - LLTimer mTimer; - // Some of what you see here is in fact redundant with functionality you - // can get from LLTimer. Unfortunately the LLTimer API is missing the - // feature we need: has at least the stated interval elapsed, and if so, - // exactly how long has passed? So we have to do it by hand, sigh. - // Time at start, end of sample window - F32 mSampleStart, mSampleEnd; - // Frames this sample window - U32 mFrames; - // Sliding window of framerate samples - boost::circular_buffer mSamples; - // Slowest framerate in mSamples - F32 mSlowest; -}; - -// Need an instance of FrameWatcher before it does any good -static FrameWatcher sFrameWatcher; - -bool gunzip_file(const std::string& srcfile, const std::string& dstfile) -{ - std::string tmpfile; - const S32 UNCOMPRESS_BUFFER_SIZE = 32768; - bool retval = false; - gzFile src = NULL; - U8 buffer[UNCOMPRESS_BUFFER_SIZE]; - LLFILE *dst = NULL; - S32 bytes = 0; - tmpfile = dstfile + ".t"; -#ifdef LL_WINDOWS - llutf16string utf16filename = utf8str_to_utf16str(srcfile); - src = gzopen_w(utf16filename.c_str(), "rb"); -#else - src = gzopen(srcfile.c_str(), "rb"); -#endif - if (! src) goto err; - dst = LLFile::fopen(tmpfile, "wb"); /* Flawfinder: ignore */ - if (! dst) goto err; - do - { - bytes = gzread(src, buffer, UNCOMPRESS_BUFFER_SIZE); - size_t nwrit = fwrite(buffer, sizeof(U8), bytes, dst); - if (nwrit < (size_t) bytes) - { - LL_WARNS() << "Short write on " << tmpfile << ": Wrote " << nwrit << " of " << bytes << " bytes." << LL_ENDL; - goto err; - } - } while(gzeof(src) == 0); - fclose(dst); - dst = NULL; -#if LL_WINDOWS - // Rename in windows needs the dstfile to not exist. - LLFile::remove(dstfile, ENOENT); -#endif - if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */ - retval = true; -err: - if (src != NULL) gzclose(src); - if (dst != NULL) fclose(dst); - return retval; -} - -bool gzip_file(const std::string& srcfile, const std::string& dstfile) -{ - const S32 COMPRESS_BUFFER_SIZE = 32768; - std::string tmpfile; - bool retval = false; - U8 buffer[COMPRESS_BUFFER_SIZE]; - gzFile dst = NULL; - LLFILE *src = NULL; - S32 bytes = 0; - tmpfile = dstfile + ".t"; - -#ifdef LL_WINDOWS - llutf16string utf16filename = utf8str_to_utf16str(tmpfile); - dst = gzopen_w(utf16filename.c_str(), "wb"); -#else - dst = gzopen(tmpfile.c_str(), "wb"); -#endif - - if (! dst) goto err; - src = LLFile::fopen(srcfile, "rb"); /* Flawfinder: ignore */ - if (! src) goto err; - - while ((bytes = (S32)fread(buffer, sizeof(U8), COMPRESS_BUFFER_SIZE, src)) > 0) - { - if (gzwrite(dst, buffer, bytes) <= 0) - { - LL_WARNS() << "gzwrite failed: " << gzerror(dst, NULL) << LL_ENDL; - goto err; - } - } - - if (ferror(src)) - { - LL_WARNS() << "Error reading " << srcfile << LL_ENDL; - goto err; - } - - gzclose(dst); - dst = NULL; -#if LL_WINDOWS - // Rename in windows needs the dstfile to not exist. - LLFile::remove(dstfile); -#endif - if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */ - retval = true; - err: - if (src != NULL) fclose(src); - if (dst != NULL) gzclose(dst); - return retval; -} +/** + * @file llsys.cpp + * @brief Implementation of the basic system query functions. + * + * $LicenseInfo:firstyear=2002&license=viewerlgpl$ + * Second Life Viewer Source Code + * Copyright (C) 2010, Linden Research, Inc. + * + * This library is free software; you can redistribute it and/or + * modify it under the terms of the GNU Lesser General Public + * License as published by the Free Software Foundation; + * version 2.1 of the License only. + * + * This library is distributed in the hope that it will be useful, + * but WITHOUT ANY WARRANTY; without even the implied warranty of + * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU + * Lesser General Public License for more details. + * + * You should have received a copy of the GNU Lesser General Public + * License along with this library; if not, write to the Free Software + * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA + * + * Linden Research, Inc., 945 Battery Street, San Francisco, CA 94111 USA + * $/LicenseInfo$ + */ + +#if LL_WINDOWS +#pragma warning (disable : 4355) // 'this' used in initializer list: yes, intentionally +#endif + +#include "linden_common.h" + +#include "llsys.h" + +#include +#ifdef LL_USESYSTEMLIBS +# include +#else +# include "zlib-ng/zlib.h" +#endif + +#include "llprocessor.h" +#include "llerrorcontrol.h" +#include "llevents.h" +#include "llformat.h" +#include "llregex.h" +#include "lltimer.h" +#include "llsdserialize.h" +#include "llsdutil.h" +#include +#include +#include +#include +#include +#include +#include +#include "llfasttimer.h" + +using namespace llsd; + +#if LL_WINDOWS +# include "llwin32headerslean.h" +# include // GetPerformanceInfo() et al. +# include +#elif LL_DARWIN +# include "llsys_objc.h" +# include +# include +# include +# include +# include +# include +# include +# include +# include +# include +#elif LL_LINUX +# include +# include +# include +# include +# include +const char MEMINFO_FILE[] = "/proc/meminfo"; +# include +#endif + +LLCPUInfo gSysCPU; + +// Don't log memory info any more often than this. It also serves as our +// framerate sample size. +static const F32 MEM_INFO_THROTTLE = 20; +// Sliding window of samples. We intentionally limit the length of time we +// remember "the slowest" framerate because framerate is very slow at login. +// If we only triggered FrameWatcher logging when the session framerate +// dropped below the login framerate, we'd have very little additional data. +static const F32 MEM_INFO_WINDOW = 10*60; + +LLOSInfo::LLOSInfo() : + mMajorVer(0), mMinorVer(0), mBuild(0), mOSVersionString("") +{ + +#if LL_WINDOWS + + if (IsWindows10OrGreater()) + { + mMajorVer = 10; + mMinorVer = 0; + mOSStringSimple = "Microsoft Windows 10 "; + } + else if (IsWindows8Point1OrGreater()) + { + mMajorVer = 6; + mMinorVer = 3; + if (IsWindowsServer()) + { + mOSStringSimple = "Windows Server 2012 R2 "; + } + else + { + mOSStringSimple = "Microsoft Windows 8.1 "; + } + } + else if (IsWindows8OrGreater()) + { + mMajorVer = 6; + mMinorVer = 2; + if (IsWindowsServer()) + { + mOSStringSimple = "Windows Server 2012 "; + } + else + { + mOSStringSimple = "Microsoft Windows 8 "; + } + } + else if (IsWindows7SP1OrGreater()) + { + mMajorVer = 6; + mMinorVer = 1; + if (IsWindowsServer()) + { + mOSStringSimple = "Windows Server 2008 R2 SP1 "; + } + else + { + mOSStringSimple = "Microsoft Windows 7 SP1 "; + } + } + else if (IsWindows7OrGreater()) + { + mMajorVer = 6; + mMinorVer = 1; + if (IsWindowsServer()) + { + mOSStringSimple = "Windows Server 2008 R2 "; + } + else + { + mOSStringSimple = "Microsoft Windows 7 "; + } + } + else if (IsWindowsVistaSP2OrGreater()) + { + mMajorVer = 6; + mMinorVer = 0; + if (IsWindowsServer()) + { + mOSStringSimple = "Windows Server 2008 SP2 "; + } + else + { + mOSStringSimple = "Microsoft Windows Vista SP2 "; + } + } + else + { + mOSStringSimple = "Unsupported Windows version "; + } + + ///get native system info if available.. + typedef void (WINAPI *PGNSI)(LPSYSTEM_INFO); ///function pointer for loading GetNativeSystemInfo + SYSTEM_INFO si; //System Info object file contains architecture info + PGNSI pGNSI; //pointer object + ZeroMemory(&si, sizeof(SYSTEM_INFO)); //zero out the memory in information + pGNSI = (PGNSI)GetProcAddress(GetModuleHandle(TEXT("kernel32.dll")), "GetNativeSystemInfo"); //load kernel32 get function + if (NULL != pGNSI) //check if it has failed + pGNSI(&si); //success + else + GetSystemInfo(&si); //if it fails get regular system info + //(Warning: If GetSystemInfo it may result in incorrect information in a WOW64 machine, if the kernel fails to load) + + // Try calling GetVersionEx using the OSVERSIONINFOEX structure. + OSVERSIONINFOEX osvi; + ZeroMemory(&osvi, sizeof(OSVERSIONINFOEX)); + osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFOEX); + if (GetVersionEx((OSVERSIONINFO *)&osvi)) + { + mBuild = osvi.dwBuildNumber & 0xffff; + } + else + { + // If OSVERSIONINFOEX doesn't work, try OSVERSIONINFO. + osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFO); + if (GetVersionEx((OSVERSIONINFO *)&osvi)) + { + mBuild = osvi.dwBuildNumber & 0xffff; + } + } + + S32 ubr = 0; // Windows 10 Update Build Revision, can be retrieved from a registry + if (mMajorVer == 10) + { + DWORD cbData(sizeof(DWORD)); + DWORD data(0); + HKEY key; + LSTATUS ret_code = RegOpenKeyExW(HKEY_LOCAL_MACHINE, TEXT("SOFTWARE\\Microsoft\\Windows NT\\CurrentVersion"), 0, KEY_READ, &key); + if (ERROR_SUCCESS == ret_code) + { + ret_code = RegQueryValueExW(key, L"UBR", 0, NULL, reinterpret_cast(&data), &cbData); + if (ERROR_SUCCESS == ret_code) + { + ubr = data; + } + } + + if (mBuild >= 22000) + { + // At release Windows 11 version was 10.0.22000.194 + // Windows 10 version was 10.0.19043.1266 + // There is no warranty that Win10 build won't increase, + // so until better solution is found or Microsoft updates + // SDK with IsWindows11OrGreater(), indicate "10/11" + // + // Current alternatives: + // Query WMI's Win32_OperatingSystem for OS string. Slow + // and likely to return 'compatibility' string. + // Check presence of dlls/libs or may be their version. + mOSStringSimple = "Microsoft Windows 10/11 "; + } + } + + //msdn microsoft finds 32 bit and 64 bit flavors this way.. + //http://msdn.microsoft.com/en-us/library/ms724429(VS.85).aspx (example code that contains quite a few more flavors + //of windows than this code does (in case it is needed for the future) + if (si.wProcessorArchitecture == PROCESSOR_ARCHITECTURE_AMD64) //check for 64 bit + { + mOSStringSimple += "64-bit "; + } + else if (si.wProcessorArchitecture == PROCESSOR_ARCHITECTURE_INTEL) + { + mOSStringSimple += "32-bit "; + } + + mOSString = mOSStringSimple; + if (mBuild > 0) + { + mOSString += llformat("(Build %d", mBuild); + if (ubr > 0) + { + mOSString += llformat(".%d", ubr); + } + mOSString += ")"; + } + + LLStringUtil::trim(mOSStringSimple); + LLStringUtil::trim(mOSString); + +#elif LL_DARWIN + + // Initialize mOSStringSimple to something like: + // "macOS 10.13.1" + { + const char * DARWIN_PRODUCT_NAME = "macOS"; + + int64_t major_version, minor_version, bugfix_version = 0; + + if (LLGetDarwinOSInfo(major_version, minor_version, bugfix_version)) + { + mMajorVer = major_version; + mMinorVer = minor_version; + mBuild = bugfix_version; + + std::stringstream os_version_string; + os_version_string << DARWIN_PRODUCT_NAME << " " << mMajorVer << "." << mMinorVer << "." << mBuild; + + // Put it in the OS string we are compiling + mOSStringSimple.append(os_version_string.str()); + } + else + { + mOSStringSimple.append("Unable to collect OS info"); + } + } + + // Initialize mOSString to something like: + // "macOS 10.13.1 Darwin Kernel Version 10.7.0: Sat Jan 29 15:17:16 PST 2011; root:xnu-1504.9.37~1/RELEASE_I386 i386" + struct utsname un; + if(uname(&un) != -1) + { + mOSString = mOSStringSimple; + mOSString.append(" "); + mOSString.append(un.sysname); + mOSString.append(" "); + mOSString.append(un.release); + mOSString.append(" "); + mOSString.append(un.version); + mOSString.append(" "); + mOSString.append(un.machine); + } + else + { + mOSString = mOSStringSimple; + } + +#elif LL_LINUX + + struct utsname un; + if(uname(&un) != -1) + { + mOSStringSimple.append(un.sysname); + mOSStringSimple.append(" "); + mOSStringSimple.append(un.release); + + mOSString = mOSStringSimple; + mOSString.append(" "); + mOSString.append(un.version); + mOSString.append(" "); + mOSString.append(un.machine); + + // Simplify 'Simple' + std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0)); + if (ostype == "Linux") + { + // Only care about major and minor Linux versions, truncate at second '.' + std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0); + std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos; + std::string simple = mOSStringSimple.substr(0, idx2); + if (simple.length() > 0) + mOSStringSimple = simple; + } + } + else + { + mOSStringSimple.append("Unable to collect OS info"); + mOSString = mOSStringSimple; + } + + const char OS_VERSION_MATCH_EXPRESSION[] = "([0-9]+)\\.([0-9]+)(\\.([0-9]+))?"; + boost::regex os_version_parse(OS_VERSION_MATCH_EXPRESSION); + boost::smatch matched; + + std::string glibc_version(gnu_get_libc_version()); + if ( ll_regex_match(glibc_version, matched, os_version_parse) ) + { + LL_INFOS("AppInit") << "Using glibc version '" << glibc_version << "' as OS version" << LL_ENDL; + + std::string version_value; + + if ( matched[1].matched ) // Major version + { + version_value.assign(matched[1].first, matched[1].second); + if (sscanf(version_value.c_str(), "%d", &mMajorVer) != 1) + { + LL_WARNS("AppInit") << "failed to parse major version '" << version_value << "' as a number" << LL_ENDL; + } + } + else + { + LL_ERRS("AppInit") + << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION + << "' returned true, but major version [1] did not match" + << LL_ENDL; + } + + if ( matched[2].matched ) // Minor version + { + version_value.assign(matched[2].first, matched[2].second); + if (sscanf(version_value.c_str(), "%d", &mMinorVer) != 1) + { + LL_ERRS("AppInit") << "failed to parse minor version '" << version_value << "' as a number" << LL_ENDL; + } + } + else + { + LL_ERRS("AppInit") + << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION + << "' returned true, but minor version [1] did not match" + << LL_ENDL; + } + + if ( matched[4].matched ) // Build version (optional) - note that [3] includes the '.' + { + version_value.assign(matched[4].first, matched[4].second); + if (sscanf(version_value.c_str(), "%d", &mBuild) != 1) + { + LL_ERRS("AppInit") << "failed to parse build version '" << version_value << "' as a number" << LL_ENDL; + } + } + else + { + LL_INFOS("AppInit") + << "OS build version not provided; using zero" + << LL_ENDL; + } + } + else + { + LL_WARNS("AppInit") << "glibc version '" << glibc_version << "' cannot be parsed to three numbers; using all zeros" << LL_ENDL; + } + +#else + + struct utsname un; + if(uname(&un) != -1) + { + mOSStringSimple.append(un.sysname); + mOSStringSimple.append(" "); + mOSStringSimple.append(un.release); + + mOSString = mOSStringSimple; + mOSString.append(" "); + mOSString.append(un.version); + mOSString.append(" "); + mOSString.append(un.machine); + + // Simplify 'Simple' + std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0)); + if (ostype == "Linux") + { + // Only care about major and minor Linux versions, truncate at second '.' + std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0); + std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos; + std::string simple = mOSStringSimple.substr(0, idx2); + if (simple.length() > 0) + mOSStringSimple = simple; + } + } + else + { + mOSStringSimple.append("Unable to collect OS info"); + mOSString = mOSStringSimple; + } + +#endif + + std::stringstream dotted_version_string; + dotted_version_string << mMajorVer << "." << mMinorVer << "." << mBuild; + mOSVersionString.append(dotted_version_string.str()); + + mOSBitness = is64Bit() ? 64 : 32; + LL_INFOS("LLOSInfo") << "OS bitness: " << mOSBitness << LL_ENDL; +} + +#ifndef LL_WINDOWS +// static +long LLOSInfo::getMaxOpenFiles() +{ + const long OPEN_MAX_GUESS = 256; + +#ifdef OPEN_MAX + static long open_max = OPEN_MAX; +#else + static long open_max = 0; +#endif + + if (0 == open_max) + { + // First time through. + errno = 0; + if ( (open_max = sysconf(_SC_OPEN_MAX)) < 0) + { + if (0 == errno) + { + // Indeterminate. + open_max = OPEN_MAX_GUESS; + } + else + { + LL_ERRS() << "LLOSInfo::getMaxOpenFiles: sysconf error for _SC_OPEN_MAX" << LL_ENDL; + } + } + } + return open_max; +} +#endif + +void LLOSInfo::stream(std::ostream& s) const +{ + s << mOSString; +} + +const std::string& LLOSInfo::getOSString() const +{ + return mOSString; +} + +const std::string& LLOSInfo::getOSStringSimple() const +{ + return mOSStringSimple; +} + +const std::string& LLOSInfo::getOSVersionString() const +{ + return mOSVersionString; +} + +const S32 LLOSInfo::getOSBitness() const +{ + return mOSBitness; +} + +//static +U32 LLOSInfo::getProcessVirtualSizeKB() +{ + U32 virtual_size = 0; +#if LL_LINUX +# define STATUS_SIZE 2048 + LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb"); + if (status_filep) + { + S32 numRead = 0; + char buff[STATUS_SIZE]; /* Flawfinder: ignore */ + + size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep); + buff[nbytes] = '\0'; + + // All these guys return numbers in KB + char *memp = strstr(buff, "VmSize:"); + if (memp) + { + numRead += sscanf(memp, "%*s %u", &virtual_size); + } + fclose(status_filep); + } +#endif + return virtual_size; +} + +//static +U32 LLOSInfo::getProcessResidentSizeKB() +{ + U32 resident_size = 0; +#if LL_LINUX + LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb"); + if (status_filep != NULL) + { + S32 numRead = 0; + char buff[STATUS_SIZE]; /* Flawfinder: ignore */ + + size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep); + buff[nbytes] = '\0'; + + // All these guys return numbers in KB + char *memp = strstr(buff, "VmRSS:"); + if (memp) + { + numRead += sscanf(memp, "%*s %u", &resident_size); + } + fclose(status_filep); + } +#endif + return resident_size; +} + +//static +bool LLOSInfo::is64Bit() +{ +#if LL_WINDOWS +#if defined(_WIN64) + return true; +#elif defined(_WIN32) + // 32-bit viewer may be run on both 32-bit and 64-bit Windows, need to elaborate + bool f64 = false; + return IsWow64Process(GetCurrentProcess(), &f64) && f64; +#else + return false; +#endif +#else // ! LL_WINDOWS + // we only build a 64-bit mac viewer and currently we don't build for linux at all + return true; +#endif +} + +LLCPUInfo::LLCPUInfo() +{ + std::ostringstream out; + LLProcessorInfo proc; + // proc.WriteInfoTextFile("procInfo.txt"); + mHasSSE = proc.hasSSE(); + mHasSSE2 = proc.hasSSE2(); + mHasSSE3 = proc.hasSSE3(); + mHasSSE3S = proc.hasSSE3S(); + mHasSSE41 = proc.hasSSE41(); + mHasSSE42 = proc.hasSSE42(); + mHasSSE4a = proc.hasSSE4a(); + mHasAltivec = proc.hasAltivec(); + mCPUMHz = (F64)proc.getCPUFrequency(); + mFamily = proc.getCPUFamilyName(); + mCPUString = "Unknown"; + + out << proc.getCPUBrandName(); + if (200 < mCPUMHz && mCPUMHz < 10000) // *NOTE: cpu speed is often way wrong, do a sanity check + { + out << " (" << mCPUMHz << " MHz)"; + } + mCPUString = out.str(); + LLStringUtil::trim(mCPUString); + + if (mHasSSE) + { + mSSEVersions.append("1"); + } + if (mHasSSE2) + { + mSSEVersions.append("2"); + } + if (mHasSSE3) + { + mSSEVersions.append("3"); + } + if (mHasSSE3S) + { + mSSEVersions.append("3S"); + } + if (mHasSSE41) + { + mSSEVersions.append("4.1"); + } + if (mHasSSE42) + { + mSSEVersions.append("4.2"); + } + if (mHasSSE4a) + { + mSSEVersions.append("4a"); + } +} + +bool LLCPUInfo::hasAltivec() const +{ + return mHasAltivec; +} + +bool LLCPUInfo::hasSSE() const +{ + return mHasSSE; +} + +bool LLCPUInfo::hasSSE2() const +{ + return mHasSSE2; +} + +bool LLCPUInfo::hasSSE3() const +{ + return mHasSSE3; +} + +bool LLCPUInfo::hasSSE3S() const +{ + return mHasSSE3S; +} + +bool LLCPUInfo::hasSSE41() const +{ + return mHasSSE41; +} + +bool LLCPUInfo::hasSSE42() const +{ + return mHasSSE42; +} + +bool LLCPUInfo::hasSSE4a() const +{ + return mHasSSE4a; +} + +F64 LLCPUInfo::getMHz() const +{ + return mCPUMHz; +} + +std::string LLCPUInfo::getCPUString() const +{ + return mCPUString; +} + +const LLSD& LLCPUInfo::getSSEVersions() const +{ + return mSSEVersions; +} + +void LLCPUInfo::stream(std::ostream& s) const +{ + // gather machine information. + s << LLProcessorInfo().getCPUFeatureDescription(); + + // These are interesting as they reflect our internal view of the + // CPU's attributes regardless of platform + s << "->mHasSSE: " << (U32)mHasSSE << std::endl; + s << "->mHasSSE2: " << (U32)mHasSSE2 << std::endl; + s << "->mHasSSE3: " << (U32)mHasSSE3 << std::endl; + s << "->mHasSSE3S: " << (U32)mHasSSE3S << std::endl; + s << "->mHasSSE41: " << (U32)mHasSSE41 << std::endl; + s << "->mHasSSE42: " << (U32)mHasSSE42 << std::endl; + s << "->mHasSSE4a: " << (U32)mHasSSE4a << std::endl; + s << "->mHasAltivec: " << (U32)mHasAltivec << std::endl; + s << "->mCPUMHz: " << mCPUMHz << std::endl; + s << "->mCPUString: " << mCPUString << std::endl; +} + +// Helper class for LLMemoryInfo: accumulate stats in the form we store for +// LLMemoryInfo::getStatsMap(). +class Stats +{ +public: + Stats(): + mStats(LLSD::emptyMap()) + {} + + // Store every integer type as LLSD::Integer. + template + void add(const LLSD::String& name, const T& value, + typename boost::enable_if >::type* = 0) + { + mStats[name] = LLSD::Integer(value); + } + + // Store every floating-point type as LLSD::Real. + template + void add(const LLSD::String& name, const T& value, + typename boost::enable_if >::type* = 0) + { + mStats[name] = LLSD::Real(value); + } + + // Hope that LLSD::Date values are sufficiently unambiguous. + void add(const LLSD::String& name, const LLSD::Date& value) + { + mStats[name] = value; + } + + LLSD get() const { return mStats; } + +private: + LLSD mStats; +}; + +LLMemoryInfo::LLMemoryInfo() +{ + refresh(); +} + +#if LL_WINDOWS +static U32Kilobytes LLMemoryAdjustKBResult(U32Kilobytes inKB) +{ + // Moved this here from llfloaterabout.cpp + + //! \bug + // For some reason, the reported amount of memory is always wrong. + // The original adjustment assumes it's always off by one meg, however + // errors of as much as 2520 KB have been observed in the value + // returned from the GetMemoryStatusEx function. Here we keep the + // original adjustment from llfoaterabout.cpp until this can be + // fixed somehow. + inKB += U32Megabytes(1); + + return inKB; +} +#endif + +#if LL_DARWIN +// static +U32Kilobytes LLMemoryInfo::getHardwareMemSize() +{ + // This might work on Linux as well. Someone check... + uint64_t phys = 0; + int mib[2] = { CTL_HW, HW_MEMSIZE }; + + size_t len = sizeof(phys); + sysctl(mib, 2, &phys, &len, NULL, 0); + + return U64Bytes(phys); +} +#endif + +U32Kilobytes LLMemoryInfo::getPhysicalMemoryKB() const +{ +#if LL_WINDOWS + return LLMemoryAdjustKBResult(U32Kilobytes(mStatsMap["Total Physical KB"].asInteger())); + +#elif LL_DARWIN + return getHardwareMemSize(); + +#elif LL_LINUX + U64 phys = 0; + phys = (U64)(getpagesize()) * (U64)(get_phys_pages()); + return U64Bytes(phys); + +#else + return 0; + +#endif +} + +//static +void LLMemoryInfo::getAvailableMemoryKB(U32Kilobytes& avail_physical_mem_kb, U32Kilobytes& avail_virtual_mem_kb) +{ +#if LL_WINDOWS + // Sigh, this shouldn't be a static method, then we wouldn't have to + // reload this data separately from refresh() + LLSD statsMap(loadStatsMap()); + + avail_physical_mem_kb = (U32Kilobytes)statsMap["Avail Physical KB"].asInteger(); + avail_virtual_mem_kb = (U32Kilobytes)statsMap["Avail Virtual KB"].asInteger(); + +#elif LL_DARWIN + // mStatsMap is derived from vm_stat, look for (e.g.) "kb free": + // $ vm_stat + // Mach Virtual Memory Statistics: (page size of 4096 bytes) + // Pages free: 462078. + // Pages active: 142010. + // Pages inactive: 220007. + // Pages wired down: 159552. + // "Translation faults": 220825184. + // Pages copy-on-write: 2104153. + // Pages zero filled: 167034876. + // Pages reactivated: 65153. + // Pageins: 2097212. + // Pageouts: 41759. + // Object cache: 841598 hits of 7629869 lookups (11% hit rate) + avail_physical_mem_kb = (U32Kilobytes)-1 ; + avail_virtual_mem_kb = (U32Kilobytes)-1 ; + +#elif LL_LINUX + // mStatsMap is derived from MEMINFO_FILE: + // $ cat /proc/meminfo + // MemTotal: 4108424 kB + // MemFree: 1244064 kB + // Buffers: 85164 kB + // Cached: 1990264 kB + // SwapCached: 0 kB + // Active: 1176648 kB + // Inactive: 1427532 kB + // Active(anon): 529152 kB + // Inactive(anon): 15924 kB + // Active(file): 647496 kB + // Inactive(file): 1411608 kB + // Unevictable: 16 kB + // Mlocked: 16 kB + // HighTotal: 3266316 kB + // HighFree: 721308 kB + // LowTotal: 842108 kB + // LowFree: 522756 kB + // SwapTotal: 6384632 kB + // SwapFree: 6384632 kB + // Dirty: 28 kB + // Writeback: 0 kB + // AnonPages: 528820 kB + // Mapped: 89472 kB + // Shmem: 16324 kB + // Slab: 159624 kB + // SReclaimable: 145168 kB + // SUnreclaim: 14456 kB + // KernelStack: 2560 kB + // PageTables: 5560 kB + // NFS_Unstable: 0 kB + // Bounce: 0 kB + // WritebackTmp: 0 kB + // CommitLimit: 8438844 kB + // Committed_AS: 1271596 kB + // VmallocTotal: 122880 kB + // VmallocUsed: 65252 kB + // VmallocChunk: 52356 kB + // HardwareCorrupted: 0 kB + // HugePages_Total: 0 + // HugePages_Free: 0 + // HugePages_Rsvd: 0 + // HugePages_Surp: 0 + // Hugepagesize: 2048 kB + // DirectMap4k: 434168 kB + // DirectMap2M: 477184 kB + // (could also run 'free', but easier to read a file than run a program) + avail_physical_mem_kb = (U32Kilobytes)-1 ; + avail_virtual_mem_kb = (U32Kilobytes)-1 ; + +#else + //do not know how to collect available memory info for other systems. + //leave it blank here for now. + + avail_physical_mem_kb = (U32Kilobytes)-1 ; + avail_virtual_mem_kb = (U32Kilobytes)-1 ; +#endif +} + +void LLMemoryInfo::stream(std::ostream& s) const +{ + // We want these memory stats to be easy to grep from the log, along with + // the timestamp. So preface each line with the timestamp and a + // distinctive marker. Without that, we'd have to search the log for the + // introducer line, then read subsequent lines, etc... + std::string pfx(LLError::utcTime() + " "); + + // Max key length + size_t key_width(0); + for (const auto& [key, value] : inMap(mStatsMap)) + { + size_t len(key.length()); + if (len > key_width) + { + key_width = len; + } + } + + // Now stream stats + for (const auto& [key, value] : inMap(mStatsMap)) + { + s << pfx << std::setw(narrow(key_width+1)) << (key + ':') << ' '; + if (value.isInteger()) + s << std::setw(12) << value.asInteger(); + else if (value.isReal()) + s << std::fixed << std::setprecision(1) << value.asReal(); + else if (value.isDate()) + value.asDate().toStream(s); + else + s << value; // just use default LLSD formatting + s << std::endl; + } +} + +LLSD LLMemoryInfo::getStatsMap() const +{ + return mStatsMap; +} + +LLMemoryInfo& LLMemoryInfo::refresh() +{ + LL_PROFILE_ZONE_SCOPED + mStatsMap = loadStatsMap(); + + LL_DEBUGS("LLMemoryInfo") << "Populated mStatsMap:\n"; + LLSDSerialize::toPrettyXML(mStatsMap, LL_CONT); + LL_ENDL; + + return *this; +} + +LLSD LLMemoryInfo::loadStatsMap() +{ + LL_PROFILE_ZONE_SCOPED; + + // This implementation is derived from stream() code (as of 2011-06-29). + Stats stats; + + // associate timestamp for analysis over time + stats.add("timestamp", LLDate::now()); + +#if LL_WINDOWS + MEMORYSTATUSEX state; + state.dwLength = sizeof(state); + GlobalMemoryStatusEx(&state); + + DWORDLONG div = 1024; + + stats.add("Percent Memory use", state.dwMemoryLoad/div); + stats.add("Total Physical KB", state.ullTotalPhys/div); + stats.add("Avail Physical KB", state.ullAvailPhys/div); + stats.add("Total page KB", state.ullTotalPageFile/div); + stats.add("Avail page KB", state.ullAvailPageFile/div); + stats.add("Total Virtual KB", state.ullTotalVirtual/div); + stats.add("Avail Virtual KB", state.ullAvailVirtual/div); + + // SL-12122 - Call to GetPerformanceInfo() was removed here. Took + // on order of 10 ms, causing unacceptable frame time spike every + // second, and results were never used. If this is needed in the + // future, must find a way to avoid frame time impact (e.g. move + // to another thread, call much less often). + + PROCESS_MEMORY_COUNTERS_EX pmem; + pmem.cb = sizeof(pmem); + // GetProcessMemoryInfo() is documented to accept either + // PROCESS_MEMORY_COUNTERS* or PROCESS_MEMORY_COUNTERS_EX*, presumably + // using the redundant size info to distinguish. But its prototype + // specifically accepts PROCESS_MEMORY_COUNTERS*, and since this is a + // classic-C API, PROCESS_MEMORY_COUNTERS_EX isn't a subclass. Cast the + // pointer. + GetProcessMemoryInfo(GetCurrentProcess(), PPROCESS_MEMORY_COUNTERS(&pmem), sizeof(pmem)); + + stats.add("Page Fault Count", pmem.PageFaultCount); + stats.add("PeakWorkingSetSize KB", pmem.PeakWorkingSetSize/div); + stats.add("WorkingSetSize KB", pmem.WorkingSetSize/div); + stats.add("QutaPeakPagedPoolUsage KB", pmem.QuotaPeakPagedPoolUsage/div); + stats.add("QuotaPagedPoolUsage KB", pmem.QuotaPagedPoolUsage/div); + stats.add("QuotaPeakNonPagedPoolUsage KB", pmem.QuotaPeakNonPagedPoolUsage/div); + stats.add("QuotaNonPagedPoolUsage KB", pmem.QuotaNonPagedPoolUsage/div); + stats.add("PagefileUsage KB", pmem.PagefileUsage/div); + stats.add("PeakPagefileUsage KB", pmem.PeakPagefileUsage/div); + stats.add("PrivateUsage KB", pmem.PrivateUsage/div); + +#elif LL_DARWIN + + const vm_size_t pagekb(vm_page_size / 1024); + + // + // Collect the vm_stat's + // + + { + vm_statistics64_data_t vmstat; + mach_msg_type_number_t vmstatCount = HOST_VM_INFO64_COUNT; + + if (host_statistics64(mach_host_self(), HOST_VM_INFO64, (host_info64_t) &vmstat, &vmstatCount) != KERN_SUCCESS) + { + LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL; + } + else + { + stats.add("Pages free KB", pagekb * vmstat.free_count); + stats.add("Pages active KB", pagekb * vmstat.active_count); + stats.add("Pages inactive KB", pagekb * vmstat.inactive_count); + stats.add("Pages wired KB", pagekb * vmstat.wire_count); + + stats.add("Pages zero fill", vmstat.zero_fill_count); + stats.add("Page reactivations", vmstat.reactivations); + stats.add("Page-ins", vmstat.pageins); + stats.add("Page-outs", vmstat.pageouts); + + stats.add("Faults", vmstat.faults); + stats.add("Faults copy-on-write", vmstat.cow_faults); + + stats.add("Cache lookups", vmstat.lookups); + stats.add("Cache hits", vmstat.hits); + + stats.add("Page purgeable count", vmstat.purgeable_count); + stats.add("Page purges", vmstat.purges); + + stats.add("Page speculative reads", vmstat.speculative_count); + } + } + + // + // Collect the misc task info + // + + { + task_events_info_data_t taskinfo; + unsigned taskinfoSize = sizeof(taskinfo); + + if (task_info(mach_task_self(), TASK_EVENTS_INFO, (task_info_t) &taskinfo, &taskinfoSize) != KERN_SUCCESS) + { + LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL; + } + else + { + stats.add("Task page-ins", taskinfo.pageins); + stats.add("Task copy-on-write faults", taskinfo.cow_faults); + stats.add("Task messages sent", taskinfo.messages_sent); + stats.add("Task messages received", taskinfo.messages_received); + stats.add("Task mach system call count", taskinfo.syscalls_mach); + stats.add("Task unix system call count", taskinfo.syscalls_unix); + stats.add("Task context switch count", taskinfo.csw); + } + } + + // + // Collect the basic task info + // + + { + mach_task_basic_info_data_t taskinfo; + mach_msg_type_number_t task_count = MACH_TASK_BASIC_INFO_COUNT; + if (task_info(mach_task_self(), MACH_TASK_BASIC_INFO, (task_info_t) &taskinfo, &task_count) != KERN_SUCCESS) + { + LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL; + } + else + { + stats.add("Basic virtual memory KB", taskinfo.virtual_size / 1024); + stats.add("Basic resident memory KB", taskinfo.resident_size / 1024); + stats.add("Basic max resident memory KB", taskinfo.resident_size_max / 1024); + stats.add("Basic new thread policy", taskinfo.policy); + stats.add("Basic suspend count", taskinfo.suspend_count); + } + } + +#elif LL_LINUX + std::ifstream meminfo(MEMINFO_FILE); + if (meminfo.is_open()) + { + // MemTotal: 4108424 kB + // MemFree: 1244064 kB + // Buffers: 85164 kB + // Cached: 1990264 kB + // SwapCached: 0 kB + // Active: 1176648 kB + // Inactive: 1427532 kB + // ... + // VmallocTotal: 122880 kB + // VmallocUsed: 65252 kB + // VmallocChunk: 52356 kB + // HardwareCorrupted: 0 kB + // HugePages_Total: 0 + // HugePages_Free: 0 + // HugePages_Rsvd: 0 + // HugePages_Surp: 0 + // Hugepagesize: 2048 kB + // DirectMap4k: 434168 kB + // DirectMap2M: 477184 kB + + // Intentionally don't pass the boost::no_except flag. This + // boost::regex object is constructed with a string literal, so it + // should be valid every time. If it becomes invalid, we WANT an + // exception, hopefully even before the dev checks in. + boost::regex stat_rx("(.+): +([0-9]+)( kB)?"); + boost::smatch matched; + + std::string line; + while (std::getline(meminfo, line)) + { + LL_DEBUGS("LLMemoryInfo") << line << LL_ENDL; + if (ll_regex_match(line, matched, stat_rx)) + { + // e.g. "MemTotal: 4108424 kB" + LLSD::String key(matched[1].first, matched[1].second); + LLSD::String value_str(matched[2].first, matched[2].second); + LLSD::Integer value(0); + try + { + value = boost::lexical_cast(value_str); + } + catch (const boost::bad_lexical_cast&) + { + LL_WARNS("LLMemoryInfo") << "couldn't parse '" << value_str + << "' in " << MEMINFO_FILE << " line: " + << line << LL_ENDL; + continue; + } + // Store this statistic. + stats.add(key, value); + } + else + { + LL_WARNS("LLMemoryInfo") << "unrecognized " << MEMINFO_FILE << " line: " + << line << LL_ENDL; + } + } + } + else + { + LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL; + } + +#else + LL_WARNS("LLMemoryInfo") << "Unknown system; unable to collect memory information" << LL_ENDL; + +#endif + + return stats.get(); +} + +std::ostream& operator<<(std::ostream& s, const LLOSInfo& info) +{ + info.stream(s); + return s; +} + +std::ostream& operator<<(std::ostream& s, const LLCPUInfo& info) +{ + info.stream(s); + return s; +} + +std::ostream& operator<<(std::ostream& s, const LLMemoryInfo& info) +{ + info.stream(s); + return s; +} + +class FrameWatcher +{ +public: + FrameWatcher(): + // Hooking onto the "mainloop" event pump gets us one call per frame. + mConnection(LLEventPumps::instance() + .obtain("mainloop") + .listen("FrameWatcher", boost::bind(&FrameWatcher::tick, this, _1))), + // Initializing mSampleStart to an invalid timestamp alerts us to skip + // trying to compute framerate on the first call. + mSampleStart(-1), + // Initializing mSampleEnd to 0 ensures that we treat the first call + // as the completion of a sample window. + mSampleEnd(0), + mFrames(0), + // Both MEM_INFO_WINDOW and MEM_INFO_THROTTLE are in seconds. We need + // the number of integer MEM_INFO_THROTTLE sample slots that will fit + // in MEM_INFO_WINDOW. Round up. + mSamples(int((MEM_INFO_WINDOW / MEM_INFO_THROTTLE) + 0.7)), + // Initializing to F32_MAX means that the first real frame will become + // the slowest ever, which sounds like a good idea. + mSlowest(F32_MAX) + {} + + bool tick(const LLSD&) + { + F32 timestamp(mTimer.getElapsedTimeF32()); + + // Count this frame in the interval just completed. + ++mFrames; + + // Have we finished a sample window yet? + if (timestamp < mSampleEnd) + { + // no, just keep waiting + return false; + } + + // Set up for next sample window. Capture values for previous frame in + // local variables and reset data members. + U32 frames(mFrames); + F32 sampleStart(mSampleStart); + // No frames yet in next window + mFrames = 0; + // which starts right now + mSampleStart = timestamp; + // and ends MEM_INFO_THROTTLE seconds in the future + mSampleEnd = mSampleStart + MEM_INFO_THROTTLE; + + // On the very first call, that's all we can do, no framerate + // computation is possible. + if (sampleStart < 0) + { + return false; + } + + // How long did this actually take? As framerate slows, the duration + // of the frame we just finished could push us WELL beyond our desired + // sample window size. + F32 elapsed(timestamp - sampleStart); + F32 framerate(frames/elapsed); + + // Remember previous slowest framerate because we're just about to + // update it. + F32 slowest(mSlowest); + // Remember previous number of samples. + boost::circular_buffer::size_type prevSize(mSamples.size()); + + // Capture new framerate in our samples buffer. Once the buffer is + // full (after MEM_INFO_WINDOW seconds), this will displace the oldest + // sample. ("So they all rolled over, and one fell out...") + mSamples.push_back(framerate); + + // Calculate the new minimum framerate. I know of no way to update a + // rolling minimum without ever rescanning the buffer. But since there + // are only a few tens of items in this buffer, rescanning it is + // probably cheaper (and certainly easier to reason about) than + // attempting to optimize away some of the scans. + mSlowest = framerate; // pick an arbitrary entry to start + for (boost::circular_buffer::const_iterator si(mSamples.begin()), send(mSamples.end()); + si != send; ++si) + { + if (*si < mSlowest) + { + mSlowest = *si; + } + } + + // We're especially interested in memory as framerate drops. Only log + // when framerate drops below the slowest framerate we remember. + // (Should always be true for the end of the very first sample + // window.) + if (framerate >= slowest) + { + return false; + } + // Congratulations, we've hit a new low. :-P + + LL_INFOS("FrameWatcher") << ' '; + if (! prevSize) + { + LL_CONT << "initial framerate "; + } + else + { + LL_CONT << "slowest framerate for last " << int(prevSize * MEM_INFO_THROTTLE) + << " seconds "; + } + + auto precision = LL_CONT.precision(); + + LL_CONT << std::fixed << std::setprecision(1) << framerate << '\n' + << LLMemoryInfo(); + + LL_CONT.precision(precision); + LL_CONT << LL_ENDL; + return false; + } + +private: + // Storing the connection in an LLTempBoundListener ensures it will be + // disconnected when we're destroyed. + LLTempBoundListener mConnection; + // Track elapsed time + LLTimer mTimer; + // Some of what you see here is in fact redundant with functionality you + // can get from LLTimer. Unfortunately the LLTimer API is missing the + // feature we need: has at least the stated interval elapsed, and if so, + // exactly how long has passed? So we have to do it by hand, sigh. + // Time at start, end of sample window + F32 mSampleStart, mSampleEnd; + // Frames this sample window + U32 mFrames; + // Sliding window of framerate samples + boost::circular_buffer mSamples; + // Slowest framerate in mSamples + F32 mSlowest; +}; + +// Need an instance of FrameWatcher before it does any good +static FrameWatcher sFrameWatcher; + +bool gunzip_file(const std::string& srcfile, const std::string& dstfile) +{ + std::string tmpfile; + const S32 UNCOMPRESS_BUFFER_SIZE = 32768; + bool retval = false; + gzFile src = NULL; + U8 buffer[UNCOMPRESS_BUFFER_SIZE]; + LLFILE *dst = NULL; + S32 bytes = 0; + tmpfile = dstfile + ".t"; +#ifdef LL_WINDOWS + llutf16string utf16filename = utf8str_to_utf16str(srcfile); + src = gzopen_w(utf16filename.c_str(), "rb"); +#else + src = gzopen(srcfile.c_str(), "rb"); +#endif + if (! src) goto err; + dst = LLFile::fopen(tmpfile, "wb"); /* Flawfinder: ignore */ + if (! dst) goto err; + do + { + bytes = gzread(src, buffer, UNCOMPRESS_BUFFER_SIZE); + size_t nwrit = fwrite(buffer, sizeof(U8), bytes, dst); + if (nwrit < (size_t) bytes) + { + LL_WARNS() << "Short write on " << tmpfile << ": Wrote " << nwrit << " of " << bytes << " bytes." << LL_ENDL; + goto err; + } + } while(gzeof(src) == 0); + fclose(dst); + dst = NULL; +#if LL_WINDOWS + // Rename in windows needs the dstfile to not exist. + LLFile::remove(dstfile, ENOENT); +#endif + if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */ + retval = true; +err: + if (src != NULL) gzclose(src); + if (dst != NULL) fclose(dst); + return retval; +} + +bool gzip_file(const std::string& srcfile, const std::string& dstfile) +{ + const S32 COMPRESS_BUFFER_SIZE = 32768; + std::string tmpfile; + bool retval = false; + U8 buffer[COMPRESS_BUFFER_SIZE]; + gzFile dst = NULL; + LLFILE *src = NULL; + S32 bytes = 0; + tmpfile = dstfile + ".t"; + +#ifdef LL_WINDOWS + llutf16string utf16filename = utf8str_to_utf16str(tmpfile); + dst = gzopen_w(utf16filename.c_str(), "wb"); +#else + dst = gzopen(tmpfile.c_str(), "wb"); +#endif + + if (! dst) goto err; + src = LLFile::fopen(srcfile, "rb"); /* Flawfinder: ignore */ + if (! src) goto err; + + while ((bytes = (S32)fread(buffer, sizeof(U8), COMPRESS_BUFFER_SIZE, src)) > 0) + { + if (gzwrite(dst, buffer, bytes) <= 0) + { + LL_WARNS() << "gzwrite failed: " << gzerror(dst, NULL) << LL_ENDL; + goto err; + } + } + + if (ferror(src)) + { + LL_WARNS() << "Error reading " << srcfile << LL_ENDL; + goto err; + } + + gzclose(dst); + dst = NULL; +#if LL_WINDOWS + // Rename in windows needs the dstfile to not exist. + LLFile::remove(dstfile); +#endif + if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */ + retval = true; + err: + if (src != NULL) fclose(src); + if (dst != NULL) gzclose(dst); + return retval; +} -- cgit v1.2.3