summaryrefslogtreecommitdiff
path: root/indra/llcommon/llsys.cpp
diff options
context:
space:
mode:
Diffstat (limited to 'indra/llcommon/llsys.cpp')
-rwxr-xr-x[-rw-r--r--]indra/llcommon/llsys.cpp971
1 files changed, 869 insertions, 102 deletions
diff --git a/indra/llcommon/llsys.cpp b/indra/llcommon/llsys.cpp
index d41d0c8a3f..1a66612e87 100644..100755
--- a/indra/llcommon/llsys.cpp
+++ b/indra/llcommon/llsys.cpp
@@ -1,63 +1,91 @@
/**
* @file llsys.cpp
- * @brief Impelementation of the basic system query functions.
+ * @brief Implementation of the basic system query functions.
*
- * $LicenseInfo:firstyear=2002&license=viewergpl$
- *
- * Copyright (c) 2002-2009, Linden Research, Inc.
- *
+ * $LicenseInfo:firstyear=2002&license=viewerlgpl$
* Second Life Viewer Source Code
- * The source code in this file ("Source Code") is provided by Linden Lab
- * to you under the terms of the GNU General Public License, version 2.0
- * ("GPL"), unless you have obtained a separate licensing agreement
- * ("Other License"), formally executed by you and Linden Lab. Terms of
- * the GPL can be found in doc/GPL-license.txt in this distribution, or
- * online at http://secondlifegrid.net/programs/open_source/licensing/gplv2
+ * Copyright (C) 2010, Linden Research, Inc.
*
- * There are special exceptions to the terms and conditions of the GPL as
- * it is applied to this Source Code. View the full text of the exception
- * in the file doc/FLOSS-exception.txt in this software distribution, or
- * online at
- * http://secondlifegrid.net/programs/open_source/licensing/flossexception
+ * This library is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU Lesser General Public
+ * License as published by the Free Software Foundation;
+ * version 2.1 of the License only.
*
- * By copying, modifying or distributing this software, you acknowledge
- * that you have read and understood your obligations described above,
- * and agree to abide by those obligations.
+ * This library is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * Lesser General Public License for more details.
*
- * ALL LINDEN LAB SOURCE CODE IS PROVIDED "AS IS." LINDEN LAB MAKES NO
- * WARRANTIES, EXPRESS, IMPLIED OR OTHERWISE, REGARDING ITS ACCURACY,
- * COMPLETENESS OR PERFORMANCE.
+ * You should have received a copy of the GNU Lesser General Public
+ * License along with this library; if not, write to the Free Software
+ * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
+ *
+ * Linden Research, Inc., 945 Battery Street, San Francisco, CA 94111 USA
* $/LicenseInfo$
*/
+#if LL_WINDOWS
+#pragma warning (disable : 4355) // 'this' used in initializer list: yes, intentionally
+#endif
+
#include "linden_common.h"
#include "llsys.h"
#include <iostream>
-#ifdef LL_STANDALONE
+#ifdef LL_USESYSTEMLIBS
# include <zlib.h>
#else
# include "zlib/zlib.h"
#endif
#include "llprocessor.h"
+#include "llerrorcontrol.h"
+#include "llevents.h"
+#include "llformat.h"
+#include "lltimer.h"
+#include "llsdserialize.h"
+#include "llsdutil.h"
+#include <boost/bind.hpp>
+#include <boost/circular_buffer.hpp>
+#include <boost/regex.hpp>
+#include <boost/foreach.hpp>
+#include <boost/lexical_cast.hpp>
+#include <boost/range.hpp>
+#include <boost/utility/enable_if.hpp>
+#include <boost/type_traits/is_integral.hpp>
+#include <boost/type_traits/is_float.hpp>
+
+using namespace llsd;
#if LL_WINDOWS
-# define WIN32_LEAN_AND_MEAN
-# include <winsock2.h>
-# include <windows.h>
+# include "llwin32headerslean.h"
+# include <psapi.h> // GetPerformanceInfo() et al.
#elif LL_DARWIN
# include <errno.h>
# include <sys/sysctl.h>
# include <sys/utsname.h>
# include <stdint.h>
+# include <CoreServices/CoreServices.h>
+# include <stdexcept>
+# include <mach/host_info.h>
+# include <mach/mach_host.h>
+# include <mach/task.h>
+# include <mach/task_info.h>
+
+// disable warnings about Gestalt calls being deprecated
+// until Apple get's on the ball and provides an alternative
+//
+#pragma GCC diagnostic ignored "-Wdeprecated-declarations"
+
#elif LL_LINUX
# include <errno.h>
# include <sys/utsname.h>
# include <unistd.h>
# include <sys/sysinfo.h>
+# include <stdexcept>
const char MEMINFO_FILE[] = "/proc/meminfo";
+# include <gnu/libc-version.h>
#elif LL_SOLARIS
# include <stdio.h>
# include <unistd.h>
@@ -71,11 +99,21 @@ const char MEMINFO_FILE[] = "/proc/meminfo";
extern int errno;
#endif
-
-static const S32 CPUINFO_BUFFER_SIZE = 16383;
LLCPUInfo gSysCPU;
+// Don't log memory info any more often than this. It also serves as our
+// framerate sample size.
+static const F32 MEM_INFO_THROTTLE = 20;
+// Sliding window of samples. We intentionally limit the length of time we
+// remember "the slowest" framerate because framerate is very slow at login.
+// If we only triggered FrameWatcher logging when the session framerate
+// dropped below the login framerate, we'd have very little additional data.
+static const F32 MEM_INFO_WINDOW = 10*60;
+
#if LL_WINDOWS
+// We cannot trust GetVersionEx function on Win8.1 , we should check this value when creating OS string
+static const U32 WINNT_WINBLUE = 0x0603;
+
#ifndef DLLVERSIONINFO
typedef struct _DllVersionInfo
{
@@ -144,13 +182,67 @@ bool get_shell32_dll_version(DWORD& major, DWORD& minor, DWORD& build_number)
}
#endif // LL_WINDOWS
+// Wrap boost::regex_match() with a function that doesn't throw.
+template <typename S, typename M, typename R>
+static bool regex_match_no_exc(const S& string, M& match, const R& regex)
+{
+ try
+ {
+ return boost::regex_match(string, match, regex);
+ }
+ catch (const std::runtime_error& e)
+ {
+ LL_WARNS("LLMemoryInfo") << "error matching with '" << regex.str() << "': "
+ << e.what() << ":\n'" << string << "'" << LL_ENDL;
+ return false;
+ }
+}
+
+// Wrap boost::regex_search() with a function that doesn't throw.
+template <typename S, typename M, typename R>
+static bool regex_search_no_exc(const S& string, M& match, const R& regex)
+{
+ try
+ {
+ return boost::regex_search(string, match, regex);
+ }
+ catch (const std::runtime_error& e)
+ {
+ LL_WARNS("LLMemoryInfo") << "error searching with '" << regex.str() << "': "
+ << e.what() << ":\n'" << string << "'" << LL_ENDL;
+ return false;
+ }
+}
+
+#if LL_WINDOWS
+// GetVersionEx should not works correct with Windows 8.1 and the later version. We need to check this case
+static bool check_for_version(WORD wMajorVersion, WORD wMinorVersion, WORD wServicePackMajor)
+{
+ OSVERSIONINFOEXW osvi = { sizeof(osvi), 0, 0, 0, 0, {0}, 0, 0 };
+ DWORDLONG const dwlConditionMask = VerSetConditionMask(
+ VerSetConditionMask(
+ VerSetConditionMask(
+ 0, VER_MAJORVERSION, VER_GREATER_EQUAL),
+ VER_MINORVERSION, VER_GREATER_EQUAL),
+ VER_SERVICEPACKMAJOR, VER_GREATER_EQUAL);
+
+ osvi.dwMajorVersion = wMajorVersion;
+ osvi.dwMinorVersion = wMinorVersion;
+ osvi.wServicePackMajor = wServicePackMajor;
+
+ return VerifyVersionInfoW(&osvi, VER_MAJORVERSION | VER_MINORVERSION | VER_SERVICEPACKMAJOR, dwlConditionMask) != FALSE;
+}
+#endif
+
+
LLOSInfo::LLOSInfo() :
- mMajorVer(0), mMinorVer(0), mBuild(0)
+ mMajorVer(0), mMinorVer(0), mBuild(0), mOSVersionString("")
{
#if LL_WINDOWS
OSVERSIONINFOEX osvi;
BOOL bOsVersionInfoEx;
+ BOOL bShouldUseShellVersion = false;
// Try calling GetVersionEx using the OSVERSIONINFOEX structure.
ZeroMemory(&osvi, sizeof(OSVERSIONINFOEX));
@@ -193,22 +285,38 @@ LLOSInfo::LLOSInfo() :
if(osvi.wProductType == VER_NT_WORKSTATION)
mOSStringSimple = "Microsoft Windows XP x64 Edition ";
else
- mOSStringSimple = "Microsoft Windows Server 2003 ";
+ mOSStringSimple = "Microsoft Windows Server 2003 ";
}
- else if(osvi.dwMajorVersion == 6 && osvi.dwMinorVersion <= 1)
+ else if(osvi.dwMajorVersion == 6 && osvi.dwMinorVersion <= 2)
{
if(osvi.dwMinorVersion == 0)
{
- mOSStringSimple = "Microsoft Windows Vista ";
+ if(osvi.wProductType == VER_NT_WORKSTATION)
+ mOSStringSimple = "Microsoft Windows Vista ";
+ else
+ mOSStringSimple = "Windows Server 2008 ";
}
else if(osvi.dwMinorVersion == 1)
{
- mOSStringSimple = "Microsoft Windows 7 ";
+ if(osvi.wProductType == VER_NT_WORKSTATION)
+ mOSStringSimple = "Microsoft Windows 7 ";
+ else
+ mOSStringSimple = "Windows Server 2008 R2 ";
}
-
- if(osvi.wProductType != VER_NT_WORKSTATION)
+ else if(osvi.dwMinorVersion == 2)
{
- mOSStringSimple += "Server ";
+ if (check_for_version(HIBYTE(WINNT_WINBLUE), LOBYTE(WINNT_WINBLUE), 0))
+ {
+ mOSStringSimple = "Microsoft Windows 8.1 ";
+ bShouldUseShellVersion = true; // GetVersionEx failed, going to use shell version
+ }
+ else
+ {
+ if(osvi.wProductType == VER_NT_WORKSTATION)
+ mOSStringSimple = "Microsoft Windows 8 ";
+ else
+ mOSStringSimple = "Windows Server 2012 ";
+ }
}
///get native system info if available..
@@ -275,9 +383,8 @@ LLOSInfo::LLOSInfo() :
}
else
{
- tmpstr = llformat("%s (Build %d)",
- csdversion.c_str(),
- (osvi.dwBuildNumber & 0xffff));
+ tmpstr = !bShouldUseShellVersion ? llformat("%s (Build %d)", csdversion.c_str(), (osvi.dwBuildNumber & 0xffff)):
+ llformat("%s (Build %d)", csdversion.c_str(), shell32_build);
}
mOSString = mOSStringSimple + tmpstr;
@@ -313,8 +420,7 @@ LLOSInfo::LLOSInfo() :
std::string compatibility_mode;
if(got_shell32_version)
{
- if(osvi.dwMajorVersion != shell32_major
- || osvi.dwMinorVersion != shell32_minor)
+ if((osvi.dwMajorVersion != shell32_major || osvi.dwMinorVersion != shell32_minor) && !bShouldUseShellVersion)
{
compatibility_mode = llformat(" compatibility mode. real ver: %d.%d (Build %d)",
shell32_major,
@@ -324,7 +430,58 @@ LLOSInfo::LLOSInfo() :
}
mOSString += compatibility_mode;
-#else
+#elif LL_DARWIN
+
+ // Initialize mOSStringSimple to something like:
+ // "Mac OS X 10.6.7"
+ {
+ const char * DARWIN_PRODUCT_NAME = "Mac OS X";
+
+ SInt32 major_version, minor_version, bugfix_version;
+ OSErr r1 = Gestalt(gestaltSystemVersionMajor, &major_version);
+ OSErr r2 = Gestalt(gestaltSystemVersionMinor, &minor_version);
+ OSErr r3 = Gestalt(gestaltSystemVersionBugFix, &bugfix_version);
+
+ if((r1 == noErr) && (r2 == noErr) && (r3 == noErr))
+ {
+ mMajorVer = major_version;
+ mMinorVer = minor_version;
+ mBuild = bugfix_version;
+
+ std::stringstream os_version_string;
+ os_version_string << DARWIN_PRODUCT_NAME << " " << mMajorVer << "." << mMinorVer << "." << mBuild;
+
+ // Put it in the OS string we are compiling
+ mOSStringSimple.append(os_version_string.str());
+ }
+ else
+ {
+ mOSStringSimple.append("Unable to collect OS info");
+ }
+ }
+
+ // Initialize mOSString to something like:
+ // "Mac OS X 10.6.7 Darwin Kernel Version 10.7.0: Sat Jan 29 15:17:16 PST 2011; root:xnu-1504.9.37~1/RELEASE_I386 i386"
+ struct utsname un;
+ if(uname(&un) != -1)
+ {
+ mOSString = mOSStringSimple;
+ mOSString.append(" ");
+ mOSString.append(un.sysname);
+ mOSString.append(" ");
+ mOSString.append(un.release);
+ mOSString.append(" ");
+ mOSString.append(un.version);
+ mOSString.append(" ");
+ mOSString.append(un.machine);
+ }
+ else
+ {
+ mOSString = mOSStringSimple;
+ }
+
+#elif LL_LINUX
+
struct utsname un;
if(uname(&un) != -1)
{
@@ -340,15 +497,103 @@ LLOSInfo::LLOSInfo() :
// Simplify 'Simple'
std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0));
- if (ostype == "Darwin")
+ if (ostype == "Linux")
{
- // Only care about major Darwin versions, truncate at first '.'
- S32 idx1 = mOSStringSimple.find_first_of(".", 0);
- std::string simple = mOSStringSimple.substr(0, idx1);
+ // Only care about major and minor Linux versions, truncate at second '.'
+ std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0);
+ std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos;
+ std::string simple = mOSStringSimple.substr(0, idx2);
if (simple.length() > 0)
mOSStringSimple = simple;
}
- else if (ostype == "Linux")
+ }
+ else
+ {
+ mOSStringSimple.append("Unable to collect OS info");
+ mOSString = mOSStringSimple;
+ }
+
+ const char OS_VERSION_MATCH_EXPRESSION[] = "([0-9]+)\\.([0-9]+)(\\.([0-9]+))?";
+ boost::regex os_version_parse(OS_VERSION_MATCH_EXPRESSION);
+ boost::smatch matched;
+
+ std::string glibc_version(gnu_get_libc_version());
+ if ( regex_match_no_exc(glibc_version, matched, os_version_parse) )
+ {
+ LL_INFOS("AppInit") << "Using glibc version '" << glibc_version << "' as OS version" << LL_ENDL;
+
+ std::string version_value;
+
+ if ( matched[1].matched ) // Major version
+ {
+ version_value.assign(matched[1].first, matched[1].second);
+ if (sscanf(version_value.c_str(), "%d", &mMajorVer) != 1)
+ {
+ LL_WARNS("AppInit") << "failed to parse major version '" << version_value << "' as a number" << LL_ENDL;
+ }
+ }
+ else
+ {
+ LL_ERRS("AppInit")
+ << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION
+ << "' returned true, but major version [1] did not match"
+ << LL_ENDL;
+ }
+
+ if ( matched[2].matched ) // Minor version
+ {
+ version_value.assign(matched[2].first, matched[2].second);
+ if (sscanf(version_value.c_str(), "%d", &mMinorVer) != 1)
+ {
+ LL_ERRS("AppInit") << "failed to parse minor version '" << version_value << "' as a number" << LL_ENDL;
+ }
+ }
+ else
+ {
+ LL_ERRS("AppInit")
+ << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION
+ << "' returned true, but minor version [1] did not match"
+ << LL_ENDL;
+ }
+
+ if ( matched[4].matched ) // Build version (optional) - note that [3] includes the '.'
+ {
+ version_value.assign(matched[4].first, matched[4].second);
+ if (sscanf(version_value.c_str(), "%d", &mBuild) != 1)
+ {
+ LL_ERRS("AppInit") << "failed to parse build version '" << version_value << "' as a number" << LL_ENDL;
+ }
+ }
+ else
+ {
+ LL_INFOS("AppInit")
+ << "OS build version not provided; using zero"
+ << LL_ENDL;
+ }
+ }
+ else
+ {
+ LL_WARNS("AppInit") << "glibc version '" << glibc_version << "' cannot be parsed to three numbers; using all zeros" << LL_ENDL;
+ }
+
+#else
+
+ struct utsname un;
+ if(uname(&un) != -1)
+ {
+ mOSStringSimple.append(un.sysname);
+ mOSStringSimple.append(" ");
+ mOSStringSimple.append(un.release);
+
+ mOSString = mOSStringSimple;
+ mOSString.append(" ");
+ mOSString.append(un.version);
+ mOSString.append(" ");
+ mOSString.append(un.machine);
+
+ // Simplify 'Simple'
+ std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0));
+ if (ostype == "Linux")
{
// Only care about major and minor Linux versions, truncate at second '.'
std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0);
@@ -363,8 +608,13 @@ LLOSInfo::LLOSInfo() :
mOSStringSimple.append("Unable to collect OS info");
mOSString = mOSStringSimple;
}
+
#endif
+ std::stringstream dotted_version_string;
+ dotted_version_string << mMajorVer << "." << mMinorVer << "." << mBuild;
+ mOSVersionString.append(dotted_version_string.str());
+
}
#ifndef LL_WINDOWS
@@ -392,7 +642,7 @@ S32 LLOSInfo::getMaxOpenFiles()
}
else
{
- llerrs << "LLOSInfo::getMaxOpenFiles: sysconf error for _SC_OPEN_MAX" << llendl;
+ LL_ERRS() << "LLOSInfo::getMaxOpenFiles: sysconf error for _SC_OPEN_MAX" << LL_ENDL;
}
}
}
@@ -415,7 +665,10 @@ const std::string& LLOSInfo::getOSStringSimple() const
return mOSStringSimple;
}
-const S32 STATUS_SIZE = 8192;
+const std::string& LLOSInfo::getOSVersionString() const
+{
+ return mOSVersionString;
+}
//static
U32 LLOSInfo::getProcessVirtualSizeKB()
@@ -424,6 +677,7 @@ U32 LLOSInfo::getProcessVirtualSizeKB()
#if LL_WINDOWS
#endif
#if LL_LINUX
+# define STATUS_SIZE 2048
LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb");
if (status_filep)
{
@@ -446,12 +700,12 @@ U32 LLOSInfo::getProcessVirtualSizeKB()
sprintf(proc_ps, "/proc/%d/psinfo", (int)getpid());
int proc_fd = -1;
if((proc_fd = open(proc_ps, O_RDONLY)) == -1){
- llwarns << "unable to open " << proc_ps << llendl;
+ LL_WARNS() << "unable to open " << proc_ps << LL_ENDL;
return 0;
}
psinfo_t proc_psinfo;
if(read(proc_fd, &proc_psinfo, sizeof(psinfo_t)) != sizeof(psinfo_t)){
- llwarns << "Unable to read " << proc_ps << llendl;
+ LL_WARNS() << "Unable to read " << proc_ps << LL_ENDL;
close(proc_fd);
return 0;
}
@@ -492,12 +746,12 @@ U32 LLOSInfo::getProcessResidentSizeKB()
sprintf(proc_ps, "/proc/%d/psinfo", (int)getpid());
int proc_fd = -1;
if((proc_fd = open(proc_ps, O_RDONLY)) == -1){
- llwarns << "unable to open " << proc_ps << llendl;
+ LL_WARNS() << "unable to open " << proc_ps << LL_ENDL;
return 0;
}
psinfo_t proc_psinfo;
if(read(proc_fd, &proc_psinfo, sizeof(psinfo_t)) != sizeof(psinfo_t)){
- llwarns << "Unable to read " << proc_ps << llendl;
+ LL_WARNS() << "Unable to read " << proc_ps << LL_ENDL;
close(proc_fd);
return 0;
}
@@ -527,6 +781,7 @@ LLCPUInfo::LLCPUInfo()
out << " (" << mCPUMHz << " MHz)";
}
mCPUString = out.str();
+ LLStringUtil::trim(mCPUString);
}
bool LLCPUInfo::hasAltivec() const
@@ -568,12 +823,50 @@ void LLCPUInfo::stream(std::ostream& s) const
s << "->mCPUString: " << mCPUString << std::endl;
}
+// Helper class for LLMemoryInfo: accumulate stats in the form we store for
+// LLMemoryInfo::getStatsMap().
+class Stats
+{
+public:
+ Stats():
+ mStats(LLSD::emptyMap())
+ {}
+
+ // Store every integer type as LLSD::Integer.
+ template <class T>
+ void add(const LLSD::String& name, const T& value,
+ typename boost::enable_if<boost::is_integral<T> >::type* = 0)
+ {
+ mStats[name] = LLSD::Integer(value);
+ }
+
+ // Store every floating-point type as LLSD::Real.
+ template <class T>
+ void add(const LLSD::String& name, const T& value,
+ typename boost::enable_if<boost::is_float<T> >::type* = 0)
+ {
+ mStats[name] = LLSD::Real(value);
+ }
+
+ // Hope that LLSD::Date values are sufficiently unambiguous.
+ void add(const LLSD::String& name, const LLSD::Date& value)
+ {
+ mStats[name] = value;
+ }
+
+ LLSD get() const { return mStats; }
+
+private:
+ LLSD mStats;
+};
+
LLMemoryInfo::LLMemoryInfo()
{
+ refresh();
}
#if LL_WINDOWS
-static U32 LLMemoryAdjustKBResult(U32 inKB)
+static U32Kilobytes LLMemoryAdjustKBResult(U32Kilobytes inKB)
{
// Moved this here from llfloaterabout.cpp
@@ -584,20 +877,16 @@ static U32 LLMemoryAdjustKBResult(U32 inKB)
// returned from the GetMemoryStatusEx function. Here we keep the
// original adjustment from llfoaterabout.cpp until this can be
// fixed somehow.
- inKB += 1024;
+ inKB += U32Megabytes(1);
return inKB;
}
#endif
-U32 LLMemoryInfo::getPhysicalMemoryKB() const
+U32Kilobytes LLMemoryInfo::getPhysicalMemoryKB() const
{
#if LL_WINDOWS
- MEMORYSTATUSEX state;
- state.dwLength = sizeof(state);
- GlobalMemoryStatusEx(&state);
-
- return LLMemoryAdjustKBResult((U32)(state.ullTotalPhys >> 10));
+ return LLMemoryAdjustKBResult(U32Kilobytes(mStatsMap["Total Physical KB"].asInteger()));
#elif LL_DARWIN
// This might work on Linux as well. Someone check...
@@ -607,17 +896,17 @@ U32 LLMemoryInfo::getPhysicalMemoryKB() const
size_t len = sizeof(phys);
sysctl(mib, 2, &phys, &len, NULL, 0);
- return (U32)(phys >> 10);
+ return U64Bytes(phys);
#elif LL_LINUX
U64 phys = 0;
phys = (U64)(getpagesize()) * (U64)(get_phys_pages());
- return (U32)(phys >> 10);
+ return U64Bytes(phys);
#elif LL_SOLARIS
U64 phys = 0;
phys = (U64)(getpagesize()) * (U64)(sysconf(_SC_PHYS_PAGES));
- return (U32)(phys >> 10);
+ return U64Bytes(phys);
#else
return 0;
@@ -625,74 +914,393 @@ U32 LLMemoryInfo::getPhysicalMemoryKB() const
#endif
}
-U32 LLMemoryInfo::getPhysicalMemoryClamped() const
+U32Bytes LLMemoryInfo::getPhysicalMemoryClamped() const
{
// Return the total physical memory in bytes, but clamp it
// to no more than U32_MAX
- U32 phys_kb = getPhysicalMemoryKB();
- if (phys_kb >= 4194304 /* 4GB in KB */)
+ U32Kilobytes phys_kb = getPhysicalMemoryKB();
+ if (phys_kb >= U32Gigabytes(4))
{
- return U32_MAX;
+ return U32Bytes(U32_MAX);
}
else
{
- return phys_kb << 10;
+ return phys_kb;
}
}
+//static
+void LLMemoryInfo::getAvailableMemoryKB(U32Kilobytes& avail_physical_mem_kb, U32Kilobytes& avail_virtual_mem_kb)
+{
+#if LL_WINDOWS
+ // Sigh, this shouldn't be a static method, then we wouldn't have to
+ // reload this data separately from refresh()
+ LLSD statsMap(loadStatsMap());
+
+ avail_physical_mem_kb = (U32Kilobytes)statsMap["Avail Physical KB"].asInteger();
+ avail_virtual_mem_kb = (U32Kilobytes)statsMap["Avail Virtual KB"].asInteger();
+
+#elif LL_DARWIN
+ // mStatsMap is derived from vm_stat, look for (e.g.) "kb free":
+ // $ vm_stat
+ // Mach Virtual Memory Statistics: (page size of 4096 bytes)
+ // Pages free: 462078.
+ // Pages active: 142010.
+ // Pages inactive: 220007.
+ // Pages wired down: 159552.
+ // "Translation faults": 220825184.
+ // Pages copy-on-write: 2104153.
+ // Pages zero filled: 167034876.
+ // Pages reactivated: 65153.
+ // Pageins: 2097212.
+ // Pageouts: 41759.
+ // Object cache: 841598 hits of 7629869 lookups (11% hit rate)
+ avail_physical_mem_kb = (U32Kilobytes)-1 ;
+ avail_virtual_mem_kb = (U32Kilobytes)-1 ;
+
+#elif LL_LINUX
+ // mStatsMap is derived from MEMINFO_FILE:
+ // $ cat /proc/meminfo
+ // MemTotal: 4108424 kB
+ // MemFree: 1244064 kB
+ // Buffers: 85164 kB
+ // Cached: 1990264 kB
+ // SwapCached: 0 kB
+ // Active: 1176648 kB
+ // Inactive: 1427532 kB
+ // Active(anon): 529152 kB
+ // Inactive(anon): 15924 kB
+ // Active(file): 647496 kB
+ // Inactive(file): 1411608 kB
+ // Unevictable: 16 kB
+ // Mlocked: 16 kB
+ // HighTotal: 3266316 kB
+ // HighFree: 721308 kB
+ // LowTotal: 842108 kB
+ // LowFree: 522756 kB
+ // SwapTotal: 6384632 kB
+ // SwapFree: 6384632 kB
+ // Dirty: 28 kB
+ // Writeback: 0 kB
+ // AnonPages: 528820 kB
+ // Mapped: 89472 kB
+ // Shmem: 16324 kB
+ // Slab: 159624 kB
+ // SReclaimable: 145168 kB
+ // SUnreclaim: 14456 kB
+ // KernelStack: 2560 kB
+ // PageTables: 5560 kB
+ // NFS_Unstable: 0 kB
+ // Bounce: 0 kB
+ // WritebackTmp: 0 kB
+ // CommitLimit: 8438844 kB
+ // Committed_AS: 1271596 kB
+ // VmallocTotal: 122880 kB
+ // VmallocUsed: 65252 kB
+ // VmallocChunk: 52356 kB
+ // HardwareCorrupted: 0 kB
+ // HugePages_Total: 0
+ // HugePages_Free: 0
+ // HugePages_Rsvd: 0
+ // HugePages_Surp: 0
+ // Hugepagesize: 2048 kB
+ // DirectMap4k: 434168 kB
+ // DirectMap2M: 477184 kB
+ // (could also run 'free', but easier to read a file than run a program)
+ avail_physical_mem_kb = (U32Kilobytes)-1 ;
+ avail_virtual_mem_kb = (U32Kilobytes)-1 ;
+
+#else
+ //do not know how to collect available memory info for other systems.
+ //leave it blank here for now.
+
+ avail_physical_mem_kb = (U32Kilobytes)-1 ;
+ avail_virtual_mem_kb = (U32Kilobytes)-1 ;
+#endif
+}
+
void LLMemoryInfo::stream(std::ostream& s) const
{
+ // We want these memory stats to be easy to grep from the log, along with
+ // the timestamp. So preface each line with the timestamp and a
+ // distinctive marker. Without that, we'd have to search the log for the
+ // introducer line, then read subsequent lines, etc...
+ std::string pfx(LLError::utcTime() + " <mem> ");
+
+ // Max key length
+ size_t key_width(0);
+ BOOST_FOREACH(const MapEntry& pair, inMap(mStatsMap))
+ {
+ size_t len(pair.first.length());
+ if (len > key_width)
+ {
+ key_width = len;
+ }
+ }
+
+ // Now stream stats
+ BOOST_FOREACH(const MapEntry& pair, inMap(mStatsMap))
+ {
+ s << pfx << std::setw(key_width+1) << (pair.first + ':') << ' ';
+ LLSD value(pair.second);
+ if (value.isInteger())
+ s << std::setw(12) << value.asInteger();
+ else if (value.isReal())
+ s << std::fixed << std::setprecision(1) << value.asReal();
+ else if (value.isDate())
+ value.asDate().toStream(s);
+ else
+ s << value; // just use default LLSD formatting
+ s << std::endl;
+ }
+}
+
+LLSD LLMemoryInfo::getStatsMap() const
+{
+ return mStatsMap;
+}
+
+LLMemoryInfo& LLMemoryInfo::refresh()
+{
+ mStatsMap = loadStatsMap();
+
+ LL_DEBUGS("LLMemoryInfo") << "Populated mStatsMap:\n";
+ LLSDSerialize::toPrettyXML(mStatsMap, LL_CONT);
+ LL_ENDL;
+
+ return *this;
+}
+
+LLSD LLMemoryInfo::loadStatsMap()
+{
+ // This implementation is derived from stream() code (as of 2011-06-29).
+ Stats stats;
+
+ // associate timestamp for analysis over time
+ stats.add("timestamp", LLDate::now());
+
#if LL_WINDOWS
MEMORYSTATUSEX state;
state.dwLength = sizeof(state);
GlobalMemoryStatusEx(&state);
- s << "Percent Memory use: " << (U32)state.dwMemoryLoad << '%' << std::endl;
- s << "Total Physical KB: " << (U32)(state.ullTotalPhys/1024) << std::endl;
- s << "Avail Physical KB: " << (U32)(state.ullAvailPhys/1024) << std::endl;
- s << "Total page KB: " << (U32)(state.ullTotalPageFile/1024) << std::endl;
- s << "Avail page KB: " << (U32)(state.ullAvailPageFile/1024) << std::endl;
- s << "Total Virtual KB: " << (U32)(state.ullTotalVirtual/1024) << std::endl;
- s << "Avail Virtual KB: " << (U32)(state.ullAvailVirtual/1024) << std::endl;
+ DWORDLONG div = 1024;
+
+ stats.add("Percent Memory use", state.dwMemoryLoad/div);
+ stats.add("Total Physical KB", state.ullTotalPhys/div);
+ stats.add("Avail Physical KB", state.ullAvailPhys/div);
+ stats.add("Total page KB", state.ullTotalPageFile/div);
+ stats.add("Avail page KB", state.ullAvailPageFile/div);
+ stats.add("Total Virtual KB", state.ullTotalVirtual/div);
+ stats.add("Avail Virtual KB", state.ullAvailVirtual/div);
+
+ PERFORMANCE_INFORMATION perf;
+ perf.cb = sizeof(perf);
+ GetPerformanceInfo(&perf, sizeof(perf));
+
+ SIZE_T pagekb(perf.PageSize/1024);
+ stats.add("CommitTotal KB", perf.CommitTotal * pagekb);
+ stats.add("CommitLimit KB", perf.CommitLimit * pagekb);
+ stats.add("CommitPeak KB", perf.CommitPeak * pagekb);
+ stats.add("PhysicalTotal KB", perf.PhysicalTotal * pagekb);
+ stats.add("PhysicalAvail KB", perf.PhysicalAvailable * pagekb);
+ stats.add("SystemCache KB", perf.SystemCache * pagekb);
+ stats.add("KernelTotal KB", perf.KernelTotal * pagekb);
+ stats.add("KernelPaged KB", perf.KernelPaged * pagekb);
+ stats.add("KernelNonpaged KB", perf.KernelNonpaged * pagekb);
+ stats.add("PageSize KB", pagekb);
+ stats.add("HandleCount", perf.HandleCount);
+ stats.add("ProcessCount", perf.ProcessCount);
+ stats.add("ThreadCount", perf.ThreadCount);
+
+ PROCESS_MEMORY_COUNTERS_EX pmem;
+ pmem.cb = sizeof(pmem);
+ // GetProcessMemoryInfo() is documented to accept either
+ // PROCESS_MEMORY_COUNTERS* or PROCESS_MEMORY_COUNTERS_EX*, presumably
+ // using the redundant size info to distinguish. But its prototype
+ // specifically accepts PROCESS_MEMORY_COUNTERS*, and since this is a
+ // classic-C API, PROCESS_MEMORY_COUNTERS_EX isn't a subclass. Cast the
+ // pointer.
+ GetProcessMemoryInfo(GetCurrentProcess(), PPROCESS_MEMORY_COUNTERS(&pmem), sizeof(pmem));
+
+ stats.add("Page Fault Count", pmem.PageFaultCount);
+ stats.add("PeakWorkingSetSize KB", pmem.PeakWorkingSetSize/div);
+ stats.add("WorkingSetSize KB", pmem.WorkingSetSize/div);
+ stats.add("QutaPeakPagedPoolUsage KB", pmem.QuotaPeakPagedPoolUsage/div);
+ stats.add("QuotaPagedPoolUsage KB", pmem.QuotaPagedPoolUsage/div);
+ stats.add("QuotaPeakNonPagedPoolUsage KB", pmem.QuotaPeakNonPagedPoolUsage/div);
+ stats.add("QuotaNonPagedPoolUsage KB", pmem.QuotaNonPagedPoolUsage/div);
+ stats.add("PagefileUsage KB", pmem.PagefileUsage/div);
+ stats.add("PeakPagefileUsage KB", pmem.PeakPagefileUsage/div);
+ stats.add("PrivateUsage KB", pmem.PrivateUsage/div);
+
#elif LL_DARWIN
- uint64_t phys = 0;
- size_t len = sizeof(phys);
+ const vm_size_t pagekb(vm_page_size / 1024);
+
+ //
+ // Collect the vm_stat's
+ //
- if(sysctlbyname("hw.memsize", &phys, &len, NULL, 0) == 0)
{
- s << "Total Physical KB: " << phys/1024 << std::endl;
- }
- else
+ vm_statistics_data_t vmstat;
+ mach_msg_type_number_t vmstatCount = HOST_VM_INFO_COUNT;
+
+ if (host_statistics(mach_host_self(), HOST_VM_INFO, (host_info_t) &vmstat, &vmstatCount) != KERN_SUCCESS)
{
- s << "Unable to collect memory information";
+ LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL;
+ }
+ else
+ {
+ stats.add("Pages free KB", pagekb * vmstat.free_count);
+ stats.add("Pages active KB", pagekb * vmstat.active_count);
+ stats.add("Pages inactive KB", pagekb * vmstat.inactive_count);
+ stats.add("Pages wired KB", pagekb * vmstat.wire_count);
+
+ stats.add("Pages zero fill", vmstat.zero_fill_count);
+ stats.add("Page reactivations", vmstat.reactivations);
+ stats.add("Page-ins", vmstat.pageins);
+ stats.add("Page-outs", vmstat.pageouts);
+
+ stats.add("Faults", vmstat.faults);
+ stats.add("Faults copy-on-write", vmstat.cow_faults);
+
+ stats.add("Cache lookups", vmstat.lookups);
+ stats.add("Cache hits", vmstat.hits);
+
+ stats.add("Page purgeable count", vmstat.purgeable_count);
+ stats.add("Page purges", vmstat.purges);
+
+ stats.add("Page speculative reads", vmstat.speculative_count);
+ }
+ }
+
+ //
+ // Collect the misc task info
+ //
+
+ {
+ task_events_info_data_t taskinfo;
+ unsigned taskinfoSize = sizeof(taskinfo);
+
+ if (task_info(mach_task_self(), TASK_EVENTS_INFO, (task_info_t) &taskinfo, &taskinfoSize) != KERN_SUCCESS)
+ {
+ LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL;
+ }
+ else
+ {
+ stats.add("Task page-ins", taskinfo.pageins);
+ stats.add("Task copy-on-write faults", taskinfo.cow_faults);
+ stats.add("Task messages sent", taskinfo.messages_sent);
+ stats.add("Task messages received", taskinfo.messages_received);
+ stats.add("Task mach system call count", taskinfo.syscalls_mach);
+ stats.add("Task unix system call count", taskinfo.syscalls_unix);
+ stats.add("Task context switch count", taskinfo.csw);
+ }
+ }
+
+ //
+ // Collect the basic task info
+ //
+
+ {
+ task_basic_info_64_data_t taskinfo;
+ unsigned taskinfoSize = sizeof(taskinfo);
+
+ if (task_info(mach_task_self(), TASK_BASIC_INFO_64, (task_info_t) &taskinfo, &taskinfoSize) != KERN_SUCCESS)
+ {
+ LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL;
+ }
+ else
+ {
+ stats.add("Basic suspend count", taskinfo.suspend_count);
+ stats.add("Basic virtual memory KB", taskinfo.virtual_size / 1024);
+ stats.add("Basic resident memory KB", taskinfo.resident_size / 1024);
+ stats.add("Basic new thread policy", taskinfo.policy);
+ }
}
+
#elif LL_SOLARIS
- U64 phys = 0;
+ U64 phys = 0;
- phys = (U64)(sysconf(_SC_PHYS_PAGES)) * (U64)(sysconf(_SC_PAGESIZE)/1024);
+ phys = (U64)(sysconf(_SC_PHYS_PAGES)) * (U64)(sysconf(_SC_PAGESIZE)/1024);
- s << "Total Physical KB: " << phys << std::endl;
-#else
- // *NOTE: This works on linux. What will it do on other systems?
- LLFILE* meminfo = LLFile::fopen(MEMINFO_FILE,"rb");
- if(meminfo)
+ stats.add("Total Physical KB", phys);
+
+#elif LL_LINUX
+ std::ifstream meminfo(MEMINFO_FILE);
+ if (meminfo.is_open())
{
- char line[MAX_STRING]; /* Flawfinder: ignore */
- memset(line, 0, MAX_STRING);
- while(fgets(line, MAX_STRING, meminfo))
+ // MemTotal: 4108424 kB
+ // MemFree: 1244064 kB
+ // Buffers: 85164 kB
+ // Cached: 1990264 kB
+ // SwapCached: 0 kB
+ // Active: 1176648 kB
+ // Inactive: 1427532 kB
+ // ...
+ // VmallocTotal: 122880 kB
+ // VmallocUsed: 65252 kB
+ // VmallocChunk: 52356 kB
+ // HardwareCorrupted: 0 kB
+ // HugePages_Total: 0
+ // HugePages_Free: 0
+ // HugePages_Rsvd: 0
+ // HugePages_Surp: 0
+ // Hugepagesize: 2048 kB
+ // DirectMap4k: 434168 kB
+ // DirectMap2M: 477184 kB
+
+ // Intentionally don't pass the boost::no_except flag. This
+ // boost::regex object is constructed with a string literal, so it
+ // should be valid every time. If it becomes invalid, we WANT an
+ // exception, hopefully even before the dev checks in.
+ boost::regex stat_rx("(.+): +([0-9]+)( kB)?");
+ boost::smatch matched;
+
+ std::string line;
+ while (std::getline(meminfo, line))
{
- line[strlen(line)-1] = ' '; /*Flawfinder: ignore*/
- s << line;
+ LL_DEBUGS("LLMemoryInfo") << line << LL_ENDL;
+ if (regex_match_no_exc(line, matched, stat_rx))
+ {
+ // e.g. "MemTotal: 4108424 kB"
+ LLSD::String key(matched[1].first, matched[1].second);
+ LLSD::String value_str(matched[2].first, matched[2].second);
+ LLSD::Integer value(0);
+ try
+ {
+ value = boost::lexical_cast<LLSD::Integer>(value_str);
+ }
+ catch (const boost::bad_lexical_cast&)
+ {
+ LL_WARNS("LLMemoryInfo") << "couldn't parse '" << value_str
+ << "' in " << MEMINFO_FILE << " line: "
+ << line << LL_ENDL;
+ continue;
+ }
+ // Store this statistic.
+ stats.add(key, value);
+ }
+ else
+ {
+ LL_WARNS("LLMemoryInfo") << "unrecognized " << MEMINFO_FILE << " line: "
+ << line << LL_ENDL;
+ }
}
- fclose(meminfo);
}
else
{
- s << "Unable to collect memory information";
+ LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL;
}
+
+#else
+ LL_WARNS("LLMemoryInfo") << "Unknown system; unable to collect memory information" << LL_ENDL;
+
#endif
+
+ return stats.get();
}
std::ostream& operator<<(std::ostream& s, const LLOSInfo& info)
@@ -713,6 +1321,148 @@ std::ostream& operator<<(std::ostream& s, const LLMemoryInfo& info)
return s;
}
+class FrameWatcher
+{
+public:
+ FrameWatcher():
+ // Hooking onto the "mainloop" event pump gets us one call per frame.
+ mConnection(LLEventPumps::instance()
+ .obtain("mainloop")
+ .listen("FrameWatcher", boost::bind(&FrameWatcher::tick, this, _1))),
+ // Initializing mSampleStart to an invalid timestamp alerts us to skip
+ // trying to compute framerate on the first call.
+ mSampleStart(-1),
+ // Initializing mSampleEnd to 0 ensures that we treat the first call
+ // as the completion of a sample window.
+ mSampleEnd(0),
+ mFrames(0),
+ // Both MEM_INFO_WINDOW and MEM_INFO_THROTTLE are in seconds. We need
+ // the number of integer MEM_INFO_THROTTLE sample slots that will fit
+ // in MEM_INFO_WINDOW. Round up.
+ mSamples(int((MEM_INFO_WINDOW / MEM_INFO_THROTTLE) + 0.7)),
+ // Initializing to F32_MAX means that the first real frame will become
+ // the slowest ever, which sounds like a good idea.
+ mSlowest(F32_MAX)
+ {}
+
+ bool tick(const LLSD&)
+ {
+ F32 timestamp(mTimer.getElapsedTimeF32());
+
+ // Count this frame in the interval just completed.
+ ++mFrames;
+
+ // Have we finished a sample window yet?
+ if (timestamp < mSampleEnd)
+ {
+ // no, just keep waiting
+ return false;
+ }
+
+ // Set up for next sample window. Capture values for previous frame in
+ // local variables and reset data members.
+ U32 frames(mFrames);
+ F32 sampleStart(mSampleStart);
+ // No frames yet in next window
+ mFrames = 0;
+ // which starts right now
+ mSampleStart = timestamp;
+ // and ends MEM_INFO_THROTTLE seconds in the future
+ mSampleEnd = mSampleStart + MEM_INFO_THROTTLE;
+
+ // On the very first call, that's all we can do, no framerate
+ // computation is possible.
+ if (sampleStart < 0)
+ {
+ return false;
+ }
+
+ // How long did this actually take? As framerate slows, the duration
+ // of the frame we just finished could push us WELL beyond our desired
+ // sample window size.
+ F32 elapsed(timestamp - sampleStart);
+ F32 framerate(frames/elapsed);
+
+ // Remember previous slowest framerate because we're just about to
+ // update it.
+ F32 slowest(mSlowest);
+ // Remember previous number of samples.
+ boost::circular_buffer<F32>::size_type prevSize(mSamples.size());
+
+ // Capture new framerate in our samples buffer. Once the buffer is
+ // full (after MEM_INFO_WINDOW seconds), this will displace the oldest
+ // sample. ("So they all rolled over, and one fell out...")
+ mSamples.push_back(framerate);
+
+ // Calculate the new minimum framerate. I know of no way to update a
+ // rolling minimum without ever rescanning the buffer. But since there
+ // are only a few tens of items in this buffer, rescanning it is
+ // probably cheaper (and certainly easier to reason about) than
+ // attempting to optimize away some of the scans.
+ mSlowest = framerate; // pick an arbitrary entry to start
+ for (boost::circular_buffer<F32>::const_iterator si(mSamples.begin()), send(mSamples.end());
+ si != send; ++si)
+ {
+ if (*si < mSlowest)
+ {
+ mSlowest = *si;
+ }
+ }
+
+ // We're especially interested in memory as framerate drops. Only log
+ // when framerate drops below the slowest framerate we remember.
+ // (Should always be true for the end of the very first sample
+ // window.)
+ if (framerate >= slowest)
+ {
+ return false;
+ }
+ // Congratulations, we've hit a new low. :-P
+
+ LL_INFOS("FrameWatcher") << ' ';
+ if (! prevSize)
+ {
+ LL_CONT << "initial framerate ";
+ }
+ else
+ {
+ LL_CONT << "slowest framerate for last " << int(prevSize * MEM_INFO_THROTTLE)
+ << " seconds ";
+ }
+
+ S32 precision = LL_CONT.precision();
+
+ LL_CONT << std::fixed << std::setprecision(1) << framerate << '\n'
+ << LLMemoryInfo();
+
+ LL_CONT.precision(precision);
+ LL_CONT << LL_ENDL;
+ return false;
+ }
+
+private:
+ // Storing the connection in an LLTempBoundListener ensures it will be
+ // disconnected when we're destroyed.
+ LLTempBoundListener mConnection;
+ // Track elapsed time
+ LLTimer mTimer;
+ // Some of what you see here is in fact redundant with functionality you
+ // can get from LLTimer. Unfortunately the LLTimer API is missing the
+ // feature we need: has at least the stated interval elapsed, and if so,
+ // exactly how long has passed? So we have to do it by hand, sigh.
+ // Time at start, end of sample window
+ F32 mSampleStart, mSampleEnd;
+ // Frames this sample window
+ U32 mFrames;
+ // Sliding window of framerate samples
+ boost::circular_buffer<F32> mSamples;
+ // Slowest framerate in mSamples
+ F32 mSlowest;
+};
+
+// Need an instance of FrameWatcher before it does any good
+static FrameWatcher sFrameWatcher;
+
BOOL gunzip_file(const std::string& srcfile, const std::string& dstfile)
{
std::string tmpfile;
@@ -733,7 +1483,7 @@ BOOL gunzip_file(const std::string& srcfile, const std::string& dstfile)
size_t nwrit = fwrite(buffer, sizeof(U8), bytes, dst);
if (nwrit < (size_t) bytes)
{
- llwarns << "Short write on " << tmpfile << ": Wrote " << nwrit << " of " << bytes << " bytes." << llendl;
+ LL_WARNS() << "Short write on " << tmpfile << ": Wrote " << nwrit << " of " << bytes << " bytes." << LL_ENDL;
goto err;
}
} while(gzeof(src) == 0);
@@ -762,11 +1512,21 @@ BOOL gzip_file(const std::string& srcfile, const std::string& dstfile)
src = LLFile::fopen(srcfile, "rb"); /* Flawfinder: ignore */
if (! src) goto err;
- do
+ while ((bytes = (S32)fread(buffer, sizeof(U8), COMPRESS_BUFFER_SIZE, src)) > 0)
+ {
+ if (gzwrite(dst, buffer, bytes) <= 0)
+ {
+ LL_WARNS() << "gzwrite failed: " << gzerror(dst, NULL) << LL_ENDL;
+ goto err;
+ }
+ }
+
+ if (ferror(src))
{
- bytes = (S32)fread(buffer, sizeof(U8), COMPRESS_BUFFER_SIZE,src);
- gzwrite(dst, buffer, bytes);
- } while(feof(src) == 0);
+ LL_WARNS() << "Error reading " << srcfile << LL_ENDL;
+ goto err;
+ }
+
gzclose(dst);
dst = NULL;
#if LL_WINDOWS
@@ -780,3 +1540,10 @@ BOOL gzip_file(const std::string& srcfile, const std::string& dstfile)
if (dst != NULL) gzclose(dst);
return retval;
}
+
+#if LL_DARWIN
+// disable warnings about Gestalt calls being deprecated
+// until Apple get's on the ball and provides an alternative
+//
+#pragma GCC diagnostic ignored "-Wdeprecated-declarations"
+#endif