diff options
| author | Andrey Lihatskiy <alihatskiy@productengine.com> | 2024-05-01 08:16:58 +0300 |
|---|---|---|
| committer | Andrey Lihatskiy <alihatskiy@productengine.com> | 2024-05-01 08:16:58 +0300 |
| commit | 38c2a5bde985a6a8a96d912d432f8bdf7e5b60be (patch) | |
| tree | b3469444ea8dabe4e76a8a265ac086a9db78891c /indra/llcommon/llsys.cpp | |
| parent | 9bf2dfbb39032d7407295089cf181de0987083e5 (diff) | |
| parent | e7eced3c87310b15ac20cc3cd470d67686104a14 (diff) | |
Merge branch 'marchcat/w-whitespace' into marchcat/x-ws-merge
Diffstat (limited to 'indra/llcommon/llsys.cpp')
| -rw-r--r-- | indra/llcommon/llsys.cpp | 1622 |
1 files changed, 811 insertions, 811 deletions
diff --git a/indra/llcommon/llsys.cpp b/indra/llcommon/llsys.cpp index 02cae908fa..b7ffddc023 100644 --- a/indra/llcommon/llsys.cpp +++ b/indra/llcommon/llsys.cpp @@ -1,25 +1,25 @@ -/** +/** * @file llsys.cpp * @brief Implementation of the basic system query functions. * * $LicenseInfo:firstyear=2002&license=viewerlgpl$ * Second Life Viewer Source Code * Copyright (C) 2010, Linden Research, Inc. - * + * * This library is free software; you can redistribute it and/or * modify it under the terms of the GNU Lesser General Public * License as published by the Free Software Foundation; * version 2.1 of the License only. - * + * * This library is distributed in the hope that it will be useful, * but WITHOUT ANY WARRANTY; without even the implied warranty of * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU * Lesser General Public License for more details. - * + * * You should have received a copy of the GNU Lesser General Public * License along with this library; if not, write to the Free Software * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA - * + * * Linden Research, Inc., 945 Battery Street, San Francisco, CA 94111 USA * $/LicenseInfo$ */ @@ -59,26 +59,26 @@ using namespace llsd; #if LL_WINDOWS -# include "llwin32headerslean.h" +# include "llwin32headerslean.h" # include <psapi.h> // GetPerformanceInfo() et al. -# include <VersionHelpers.h> +# include <VersionHelpers.h> #elif LL_DARWIN # include "llsys_objc.h" -# include <errno.h> -# include <sys/sysctl.h> -# include <sys/utsname.h> -# include <stdint.h> -# include <CoreServices/CoreServices.h> +# include <errno.h> +# include <sys/sysctl.h> +# include <sys/utsname.h> +# include <stdint.h> +# include <CoreServices/CoreServices.h> # include <stdexcept> -# include <mach/host_info.h> -# include <mach/mach_host.h> -# include <mach/task.h> -# include <mach/task_info.h> +# include <mach/host_info.h> +# include <mach/mach_host.h> +# include <mach/task.h> +# include <mach/task_info.h> #elif LL_LINUX -# include <errno.h> -# include <sys/utsname.h> -# include <unistd.h> -# include <sys/sysinfo.h> +# include <errno.h> +# include <sys/utsname.h> +# include <unistd.h> +# include <sys/sysinfo.h> # include <stdexcept> const char MEMINFO_FILE[] = "/proc/meminfo"; # include <gnu/libc-version.h> @@ -96,132 +96,132 @@ static const F32 MEM_INFO_THROTTLE = 20; static const F32 MEM_INFO_WINDOW = 10*60; LLOSInfo::LLOSInfo() : - mMajorVer(0), mMinorVer(0), mBuild(0), mOSVersionString("") + mMajorVer(0), mMinorVer(0), mBuild(0), mOSVersionString("") { #if LL_WINDOWS if (IsWindows10OrGreater()) - { - mMajorVer = 10; - mMinorVer = 0; - mOSStringSimple = "Microsoft Windows 10 "; - } - else if (IsWindows8Point1OrGreater()) - { - mMajorVer = 6; - mMinorVer = 3; - if (IsWindowsServer()) - { - mOSStringSimple = "Windows Server 2012 R2 "; - } - else - { - mOSStringSimple = "Microsoft Windows 8.1 "; - } - } - else if (IsWindows8OrGreater()) - { - mMajorVer = 6; - mMinorVer = 2; - if (IsWindowsServer()) - { - mOSStringSimple = "Windows Server 2012 "; - } - else - { - mOSStringSimple = "Microsoft Windows 8 "; - } - } - else if (IsWindows7SP1OrGreater()) - { - mMajorVer = 6; - mMinorVer = 1; - if (IsWindowsServer()) - { - mOSStringSimple = "Windows Server 2008 R2 SP1 "; - } - else - { - mOSStringSimple = "Microsoft Windows 7 SP1 "; - } - } - else if (IsWindows7OrGreater()) - { - mMajorVer = 6; - mMinorVer = 1; - if (IsWindowsServer()) - { - mOSStringSimple = "Windows Server 2008 R2 "; - } - else - { - mOSStringSimple = "Microsoft Windows 7 "; - } - } - else if (IsWindowsVistaSP2OrGreater()) - { - mMajorVer = 6; - mMinorVer = 0; - if (IsWindowsServer()) - { - mOSStringSimple = "Windows Server 2008 SP2 "; - } - else - { - mOSStringSimple = "Microsoft Windows Vista SP2 "; - } - } - else - { - mOSStringSimple = "Unsupported Windows version "; - } + { + mMajorVer = 10; + mMinorVer = 0; + mOSStringSimple = "Microsoft Windows 10 "; + } + else if (IsWindows8Point1OrGreater()) + { + mMajorVer = 6; + mMinorVer = 3; + if (IsWindowsServer()) + { + mOSStringSimple = "Windows Server 2012 R2 "; + } + else + { + mOSStringSimple = "Microsoft Windows 8.1 "; + } + } + else if (IsWindows8OrGreater()) + { + mMajorVer = 6; + mMinorVer = 2; + if (IsWindowsServer()) + { + mOSStringSimple = "Windows Server 2012 "; + } + else + { + mOSStringSimple = "Microsoft Windows 8 "; + } + } + else if (IsWindows7SP1OrGreater()) + { + mMajorVer = 6; + mMinorVer = 1; + if (IsWindowsServer()) + { + mOSStringSimple = "Windows Server 2008 R2 SP1 "; + } + else + { + mOSStringSimple = "Microsoft Windows 7 SP1 "; + } + } + else if (IsWindows7OrGreater()) + { + mMajorVer = 6; + mMinorVer = 1; + if (IsWindowsServer()) + { + mOSStringSimple = "Windows Server 2008 R2 "; + } + else + { + mOSStringSimple = "Microsoft Windows 7 "; + } + } + else if (IsWindowsVistaSP2OrGreater()) + { + mMajorVer = 6; + mMinorVer = 0; + if (IsWindowsServer()) + { + mOSStringSimple = "Windows Server 2008 SP2 "; + } + else + { + mOSStringSimple = "Microsoft Windows Vista SP2 "; + } + } + else + { + mOSStringSimple = "Unsupported Windows version "; + } - ///get native system info if available.. - typedef void (WINAPI *PGNSI)(LPSYSTEM_INFO); ///function pointer for loading GetNativeSystemInfo - SYSTEM_INFO si; //System Info object file contains architecture info - PGNSI pGNSI; //pointer object - ZeroMemory(&si, sizeof(SYSTEM_INFO)); //zero out the memory in information - pGNSI = (PGNSI)GetProcAddress(GetModuleHandle(TEXT("kernel32.dll")), "GetNativeSystemInfo"); //load kernel32 get function - if (NULL != pGNSI) //check if it has failed - pGNSI(&si); //success - else - GetSystemInfo(&si); //if it fails get regular system info - //(Warning: If GetSystemInfo it may result in incorrect information in a WOW64 machine, if the kernel fails to load) + ///get native system info if available.. + typedef void (WINAPI *PGNSI)(LPSYSTEM_INFO); ///function pointer for loading GetNativeSystemInfo + SYSTEM_INFO si; //System Info object file contains architecture info + PGNSI pGNSI; //pointer object + ZeroMemory(&si, sizeof(SYSTEM_INFO)); //zero out the memory in information + pGNSI = (PGNSI)GetProcAddress(GetModuleHandle(TEXT("kernel32.dll")), "GetNativeSystemInfo"); //load kernel32 get function + if (NULL != pGNSI) //check if it has failed + pGNSI(&si); //success + else + GetSystemInfo(&si); //if it fails get regular system info + //(Warning: If GetSystemInfo it may result in incorrect information in a WOW64 machine, if the kernel fails to load) - // Try calling GetVersionEx using the OSVERSIONINFOEX structure. - OSVERSIONINFOEX osvi; - ZeroMemory(&osvi, sizeof(OSVERSIONINFOEX)); - osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFOEX); - if (GetVersionEx((OSVERSIONINFO *)&osvi)) - { - mBuild = osvi.dwBuildNumber & 0xffff; - } - else - { - // If OSVERSIONINFOEX doesn't work, try OSVERSIONINFO. - osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFO); - if (GetVersionEx((OSVERSIONINFO *)&osvi)) - { - mBuild = osvi.dwBuildNumber & 0xffff; - } - } + // Try calling GetVersionEx using the OSVERSIONINFOEX structure. + OSVERSIONINFOEX osvi; + ZeroMemory(&osvi, sizeof(OSVERSIONINFOEX)); + osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFOEX); + if (GetVersionEx((OSVERSIONINFO *)&osvi)) + { + mBuild = osvi.dwBuildNumber & 0xffff; + } + else + { + // If OSVERSIONINFOEX doesn't work, try OSVERSIONINFO. + osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFO); + if (GetVersionEx((OSVERSIONINFO *)&osvi)) + { + mBuild = osvi.dwBuildNumber & 0xffff; + } + } - S32 ubr = 0; // Windows 10 Update Build Revision, can be retrieved from a registry - if (mMajorVer == 10) - { - DWORD cbData(sizeof(DWORD)); - DWORD data(0); - HKEY key; - BOOL ret_code = RegOpenKeyExW(HKEY_LOCAL_MACHINE, TEXT("SOFTWARE\\Microsoft\\Windows NT\\CurrentVersion"), 0, KEY_READ, &key); - if (ERROR_SUCCESS == ret_code) - { - ret_code = RegQueryValueExW(key, L"UBR", 0, NULL, reinterpret_cast<LPBYTE>(&data), &cbData); - if (ERROR_SUCCESS == ret_code) - { - ubr = data; - } - } + S32 ubr = 0; // Windows 10 Update Build Revision, can be retrieved from a registry + if (mMajorVer == 10) + { + DWORD cbData(sizeof(DWORD)); + DWORD data(0); + HKEY key; + BOOL ret_code = RegOpenKeyExW(HKEY_LOCAL_MACHINE, TEXT("SOFTWARE\\Microsoft\\Windows NT\\CurrentVersion"), 0, KEY_READ, &key); + if (ERROR_SUCCESS == ret_code) + { + ret_code = RegQueryValueExW(key, L"UBR", 0, NULL, reinterpret_cast<LPBYTE>(&data), &cbData); + if (ERROR_SUCCESS == ret_code) + { + ubr = data; + } + } if (mBuild >= 22000) { @@ -251,315 +251,315 @@ LLOSInfo::LLOSInfo() : mOSStringSimple += "32-bit "; } - mOSString = mOSStringSimple; - if (mBuild > 0) - { - mOSString += llformat("(Build %d", mBuild); - if (ubr > 0) - { - mOSString += llformat(".%d", ubr); - } - mOSString += ")"; - } + mOSString = mOSStringSimple; + if (mBuild > 0) + { + mOSString += llformat("(Build %d", mBuild); + if (ubr > 0) + { + mOSString += llformat(".%d", ubr); + } + mOSString += ")"; + } - LLStringUtil::trim(mOSStringSimple); - LLStringUtil::trim(mOSString); + LLStringUtil::trim(mOSStringSimple); + LLStringUtil::trim(mOSString); #elif LL_DARWIN - - // Initialize mOSStringSimple to something like: - // "Mac OS X 10.6.7" - { - const char * DARWIN_PRODUCT_NAME = "Mac OS X"; - - int64_t major_version, minor_version, bugfix_version = 0; - if (LLGetDarwinOSInfo(major_version, minor_version, bugfix_version)) - { - mMajorVer = major_version; - mMinorVer = minor_version; - mBuild = bugfix_version; + // Initialize mOSStringSimple to something like: + // "Mac OS X 10.6.7" + { + const char * DARWIN_PRODUCT_NAME = "Mac OS X"; + + int64_t major_version, minor_version, bugfix_version = 0; + + if (LLGetDarwinOSInfo(major_version, minor_version, bugfix_version)) + { + mMajorVer = major_version; + mMinorVer = minor_version; + mBuild = bugfix_version; + + std::stringstream os_version_string; + os_version_string << DARWIN_PRODUCT_NAME << " " << mMajorVer << "." << mMinorVer << "." << mBuild; + + // Put it in the OS string we are compiling + mOSStringSimple.append(os_version_string.str()); + } + else + { + mOSStringSimple.append("Unable to collect OS info"); + } + } + + // Initialize mOSString to something like: + // "Mac OS X 10.6.7 Darwin Kernel Version 10.7.0: Sat Jan 29 15:17:16 PST 2011; root:xnu-1504.9.37~1/RELEASE_I386 i386" + struct utsname un; + if(uname(&un) != -1) + { + mOSString = mOSStringSimple; + mOSString.append(" "); + mOSString.append(un.sysname); + mOSString.append(" "); + mOSString.append(un.release); + mOSString.append(" "); + mOSString.append(un.version); + mOSString.append(" "); + mOSString.append(un.machine); + } + else + { + mOSString = mOSStringSimple; + } - std::stringstream os_version_string; - os_version_string << DARWIN_PRODUCT_NAME << " " << mMajorVer << "." << mMinorVer << "." << mBuild; - - // Put it in the OS string we are compiling - mOSStringSimple.append(os_version_string.str()); - } - else - { - mOSStringSimple.append("Unable to collect OS info"); - } - } - - // Initialize mOSString to something like: - // "Mac OS X 10.6.7 Darwin Kernel Version 10.7.0: Sat Jan 29 15:17:16 PST 2011; root:xnu-1504.9.37~1/RELEASE_I386 i386" - struct utsname un; - if(uname(&un) != -1) - { - mOSString = mOSStringSimple; - mOSString.append(" "); - mOSString.append(un.sysname); - mOSString.append(" "); - mOSString.append(un.release); - mOSString.append(" "); - mOSString.append(un.version); - mOSString.append(" "); - mOSString.append(un.machine); - } - else - { - mOSString = mOSStringSimple; - } - #elif LL_LINUX - - struct utsname un; - if(uname(&un) != -1) - { - mOSStringSimple.append(un.sysname); - mOSStringSimple.append(" "); - mOSStringSimple.append(un.release); - mOSString = mOSStringSimple; - mOSString.append(" "); - mOSString.append(un.version); - mOSString.append(" "); - mOSString.append(un.machine); + struct utsname un; + if(uname(&un) != -1) + { + mOSStringSimple.append(un.sysname); + mOSStringSimple.append(" "); + mOSStringSimple.append(un.release); + + mOSString = mOSStringSimple; + mOSString.append(" "); + mOSString.append(un.version); + mOSString.append(" "); + mOSString.append(un.machine); + + // Simplify 'Simple' + std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0)); + if (ostype == "Linux") + { + // Only care about major and minor Linux versions, truncate at second '.' + std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0); + std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos; + std::string simple = mOSStringSimple.substr(0, idx2); + if (simple.length() > 0) + mOSStringSimple = simple; + } + } + else + { + mOSStringSimple.append("Unable to collect OS info"); + mOSString = mOSStringSimple; + } - // Simplify 'Simple' - std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0)); - if (ostype == "Linux") - { - // Only care about major and minor Linux versions, truncate at second '.' - std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0); - std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos; - std::string simple = mOSStringSimple.substr(0, idx2); - if (simple.length() > 0) - mOSStringSimple = simple; - } - } - else - { - mOSStringSimple.append("Unable to collect OS info"); - mOSString = mOSStringSimple; - } + const char OS_VERSION_MATCH_EXPRESSION[] = "([0-9]+)\\.([0-9]+)(\\.([0-9]+))?"; + boost::regex os_version_parse(OS_VERSION_MATCH_EXPRESSION); + boost::smatch matched; - const char OS_VERSION_MATCH_EXPRESSION[] = "([0-9]+)\\.([0-9]+)(\\.([0-9]+))?"; - boost::regex os_version_parse(OS_VERSION_MATCH_EXPRESSION); - boost::smatch matched; + std::string glibc_version(gnu_get_libc_version()); + if ( ll_regex_match(glibc_version, matched, os_version_parse) ) + { + LL_INFOS("AppInit") << "Using glibc version '" << glibc_version << "' as OS version" << LL_ENDL; - std::string glibc_version(gnu_get_libc_version()); - if ( ll_regex_match(glibc_version, matched, os_version_parse) ) - { - LL_INFOS("AppInit") << "Using glibc version '" << glibc_version << "' as OS version" << LL_ENDL; - - std::string version_value; + std::string version_value; - if ( matched[1].matched ) // Major version - { - version_value.assign(matched[1].first, matched[1].second); - if (sscanf(version_value.c_str(), "%d", &mMajorVer) != 1) - { - LL_WARNS("AppInit") << "failed to parse major version '" << version_value << "' as a number" << LL_ENDL; - } - } - else - { - LL_ERRS("AppInit") - << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION - << "' returned true, but major version [1] did not match" - << LL_ENDL; - } + if ( matched[1].matched ) // Major version + { + version_value.assign(matched[1].first, matched[1].second); + if (sscanf(version_value.c_str(), "%d", &mMajorVer) != 1) + { + LL_WARNS("AppInit") << "failed to parse major version '" << version_value << "' as a number" << LL_ENDL; + } + } + else + { + LL_ERRS("AppInit") + << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION + << "' returned true, but major version [1] did not match" + << LL_ENDL; + } - if ( matched[2].matched ) // Minor version - { - version_value.assign(matched[2].first, matched[2].second); - if (sscanf(version_value.c_str(), "%d", &mMinorVer) != 1) - { - LL_ERRS("AppInit") << "failed to parse minor version '" << version_value << "' as a number" << LL_ENDL; - } - } - else - { - LL_ERRS("AppInit") - << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION - << "' returned true, but minor version [1] did not match" - << LL_ENDL; - } + if ( matched[2].matched ) // Minor version + { + version_value.assign(matched[2].first, matched[2].second); + if (sscanf(version_value.c_str(), "%d", &mMinorVer) != 1) + { + LL_ERRS("AppInit") << "failed to parse minor version '" << version_value << "' as a number" << LL_ENDL; + } + } + else + { + LL_ERRS("AppInit") + << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION + << "' returned true, but minor version [1] did not match" + << LL_ENDL; + } - if ( matched[4].matched ) // Build version (optional) - note that [3] includes the '.' - { - version_value.assign(matched[4].first, matched[4].second); - if (sscanf(version_value.c_str(), "%d", &mBuild) != 1) - { - LL_ERRS("AppInit") << "failed to parse build version '" << version_value << "' as a number" << LL_ENDL; - } - } - else - { - LL_INFOS("AppInit") - << "OS build version not provided; using zero" - << LL_ENDL; - } - } - else - { - LL_WARNS("AppInit") << "glibc version '" << glibc_version << "' cannot be parsed to three numbers; using all zeros" << LL_ENDL; - } + if ( matched[4].matched ) // Build version (optional) - note that [3] includes the '.' + { + version_value.assign(matched[4].first, matched[4].second); + if (sscanf(version_value.c_str(), "%d", &mBuild) != 1) + { + LL_ERRS("AppInit") << "failed to parse build version '" << version_value << "' as a number" << LL_ENDL; + } + } + else + { + LL_INFOS("AppInit") + << "OS build version not provided; using zero" + << LL_ENDL; + } + } + else + { + LL_WARNS("AppInit") << "glibc version '" << glibc_version << "' cannot be parsed to three numbers; using all zeros" << LL_ENDL; + } #else - - struct utsname un; - if(uname(&un) != -1) - { - mOSStringSimple.append(un.sysname); - mOSStringSimple.append(" "); - mOSStringSimple.append(un.release); - mOSString = mOSStringSimple; - mOSString.append(" "); - mOSString.append(un.version); - mOSString.append(" "); - mOSString.append(un.machine); + struct utsname un; + if(uname(&un) != -1) + { + mOSStringSimple.append(un.sysname); + mOSStringSimple.append(" "); + mOSStringSimple.append(un.release); - // Simplify 'Simple' - std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0)); - if (ostype == "Linux") - { - // Only care about major and minor Linux versions, truncate at second '.' - std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0); - std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos; - std::string simple = mOSStringSimple.substr(0, idx2); - if (simple.length() > 0) - mOSStringSimple = simple; - } - } - else - { - mOSStringSimple.append("Unable to collect OS info"); - mOSString = mOSStringSimple; - } + mOSString = mOSStringSimple; + mOSString.append(" "); + mOSString.append(un.version); + mOSString.append(" "); + mOSString.append(un.machine); + + // Simplify 'Simple' + std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0)); + if (ostype == "Linux") + { + // Only care about major and minor Linux versions, truncate at second '.' + std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0); + std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos; + std::string simple = mOSStringSimple.substr(0, idx2); + if (simple.length() > 0) + mOSStringSimple = simple; + } + } + else + { + mOSStringSimple.append("Unable to collect OS info"); + mOSString = mOSStringSimple; + } #endif - std::stringstream dotted_version_string; - dotted_version_string << mMajorVer << "." << mMinorVer << "." << mBuild; - mOSVersionString.append(dotted_version_string.str()); + std::stringstream dotted_version_string; + dotted_version_string << mMajorVer << "." << mMinorVer << "." << mBuild; + mOSVersionString.append(dotted_version_string.str()); - mOSBitness = is64Bit() ? 64 : 32; - LL_INFOS("LLOSInfo") << "OS bitness: " << mOSBitness << LL_ENDL; + mOSBitness = is64Bit() ? 64 : 32; + LL_INFOS("LLOSInfo") << "OS bitness: " << mOSBitness << LL_ENDL; } #ifndef LL_WINDOWS // static long LLOSInfo::getMaxOpenFiles() { - const long OPEN_MAX_GUESS = 256; + const long OPEN_MAX_GUESS = 256; -#ifdef OPEN_MAX - static long open_max = OPEN_MAX; +#ifdef OPEN_MAX + static long open_max = OPEN_MAX; #else - static long open_max = 0; + static long open_max = 0; #endif - if (0 == open_max) - { - // First time through. - errno = 0; - if ( (open_max = sysconf(_SC_OPEN_MAX)) < 0) - { - if (0 == errno) - { - // Indeterminate. - open_max = OPEN_MAX_GUESS; - } - else - { - LL_ERRS() << "LLOSInfo::getMaxOpenFiles: sysconf error for _SC_OPEN_MAX" << LL_ENDL; - } - } - } - return open_max; + if (0 == open_max) + { + // First time through. + errno = 0; + if ( (open_max = sysconf(_SC_OPEN_MAX)) < 0) + { + if (0 == errno) + { + // Indeterminate. + open_max = OPEN_MAX_GUESS; + } + else + { + LL_ERRS() << "LLOSInfo::getMaxOpenFiles: sysconf error for _SC_OPEN_MAX" << LL_ENDL; + } + } + } + return open_max; } #endif void LLOSInfo::stream(std::ostream& s) const { - s << mOSString; + s << mOSString; } const std::string& LLOSInfo::getOSString() const { - return mOSString; + return mOSString; } const std::string& LLOSInfo::getOSStringSimple() const { - return mOSStringSimple; + return mOSStringSimple; } const std::string& LLOSInfo::getOSVersionString() const { - return mOSVersionString; + return mOSVersionString; } const S32 LLOSInfo::getOSBitness() const { - return mOSBitness; + return mOSBitness; } //static U32 LLOSInfo::getProcessVirtualSizeKB() { - U32 virtual_size = 0; + U32 virtual_size = 0; #if LL_LINUX -# define STATUS_SIZE 2048 - LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb"); - if (status_filep) - { - S32 numRead = 0; - char buff[STATUS_SIZE]; /* Flawfinder: ignore */ +# define STATUS_SIZE 2048 + LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb"); + if (status_filep) + { + S32 numRead = 0; + char buff[STATUS_SIZE]; /* Flawfinder: ignore */ - size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep); - buff[nbytes] = '\0'; + size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep); + buff[nbytes] = '\0'; - // All these guys return numbers in KB - char *memp = strstr(buff, "VmSize:"); - if (memp) - { - numRead += sscanf(memp, "%*s %u", &virtual_size); - } - fclose(status_filep); - } + // All these guys return numbers in KB + char *memp = strstr(buff, "VmSize:"); + if (memp) + { + numRead += sscanf(memp, "%*s %u", &virtual_size); + } + fclose(status_filep); + } #endif - return virtual_size; + return virtual_size; } //static U32 LLOSInfo::getProcessResidentSizeKB() { - U32 resident_size = 0; + U32 resident_size = 0; #if LL_LINUX - LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb"); - if (status_filep != NULL) - { - S32 numRead = 0; - char buff[STATUS_SIZE]; /* Flawfinder: ignore */ + LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb"); + if (status_filep != NULL) + { + S32 numRead = 0; + char buff[STATUS_SIZE]; /* Flawfinder: ignore */ - size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep); - buff[nbytes] = '\0'; + size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep); + buff[nbytes] = '\0'; - // All these guys return numbers in KB - char *memp = strstr(buff, "VmRSS:"); - if (memp) - { - numRead += sscanf(memp, "%*s %u", &resident_size); - } - fclose(status_filep); - } + // All these guys return numbers in KB + char *memp = strstr(buff, "VmRSS:"); + if (memp) + { + numRead += sscanf(memp, "%*s %u", &resident_size); + } + fclose(status_filep); + } #endif - return resident_size; + return resident_size; } //static @@ -577,34 +577,34 @@ bool LLOSInfo::is64Bit() #endif #else // ! LL_WINDOWS // we only build a 64-bit mac viewer and currently we don't build for linux at all - return true; + return true; #endif } LLCPUInfo::LLCPUInfo() { - std::ostringstream out; - LLProcessorInfo proc; - // proc.WriteInfoTextFile("procInfo.txt"); - mHasSSE = proc.hasSSE(); - mHasSSE2 = proc.hasSSE2(); + std::ostringstream out; + LLProcessorInfo proc; + // proc.WriteInfoTextFile("procInfo.txt"); + mHasSSE = proc.hasSSE(); + mHasSSE2 = proc.hasSSE2(); mHasSSE3 = proc.hasSSE3(); mHasSSE3S = proc.hasSSE3S(); mHasSSE41 = proc.hasSSE41(); mHasSSE42 = proc.hasSSE42(); mHasSSE4a = proc.hasSSE4a(); - mHasAltivec = proc.hasAltivec(); - mCPUMHz = (F64)proc.getCPUFrequency(); - mFamily = proc.getCPUFamilyName(); - mCPUString = "Unknown"; + mHasAltivec = proc.hasAltivec(); + mCPUMHz = (F64)proc.getCPUFrequency(); + mFamily = proc.getCPUFamilyName(); + mCPUString = "Unknown"; - out << proc.getCPUBrandName(); - if (200 < mCPUMHz && mCPUMHz < 10000) // *NOTE: cpu speed is often way wrong, do a sanity check - { - out << " (" << mCPUMHz << " MHz)"; - } - mCPUString = out.str(); - LLStringUtil::trim(mCPUString); + out << proc.getCPUBrandName(); + if (200 < mCPUMHz && mCPUMHz < 10000) // *NOTE: cpu speed is often way wrong, do a sanity check + { + out << " (" << mCPUMHz << " MHz)"; + } + mCPUString = out.str(); + LLStringUtil::trim(mCPUString); if (mHasSSE) { @@ -638,17 +638,17 @@ LLCPUInfo::LLCPUInfo() bool LLCPUInfo::hasAltivec() const { - return mHasAltivec; + return mHasAltivec; } bool LLCPUInfo::hasSSE() const { - return mHasSSE; + return mHasSSE; } bool LLCPUInfo::hasSSE2() const { - return mHasSSE2; + return mHasSSE2; } bool LLCPUInfo::hasSSE3() const @@ -678,12 +678,12 @@ bool LLCPUInfo::hasSSE4a() const F64 LLCPUInfo::getMHz() const { - return mCPUMHz; + return mCPUMHz; } std::string LLCPUInfo::getCPUString() const { - return mCPUString; + return mCPUString; } const LLSD& LLCPUInfo::getSSEVersions() const @@ -693,21 +693,21 @@ const LLSD& LLCPUInfo::getSSEVersions() const void LLCPUInfo::stream(std::ostream& s) const { - // gather machine information. - s << LLProcessorInfo().getCPUFeatureDescription(); + // gather machine information. + s << LLProcessorInfo().getCPUFeatureDescription(); - // These are interesting as they reflect our internal view of the - // CPU's attributes regardless of platform - s << "->mHasSSE: " << (U32)mHasSSE << std::endl; - s << "->mHasSSE2: " << (U32)mHasSSE2 << std::endl; + // These are interesting as they reflect our internal view of the + // CPU's attributes regardless of platform + s << "->mHasSSE: " << (U32)mHasSSE << std::endl; + s << "->mHasSSE2: " << (U32)mHasSSE2 << std::endl; s << "->mHasSSE3: " << (U32)mHasSSE3 << std::endl; s << "->mHasSSE3S: " << (U32)mHasSSE3S << std::endl; s << "->mHasSSE41: " << (U32)mHasSSE41 << std::endl; s << "->mHasSSE42: " << (U32)mHasSSE42 << std::endl; s << "->mHasSSE4a: " << (U32)mHasSSE4a << std::endl; - s << "->mHasAltivec: " << (U32)mHasAltivec << std::endl; - s << "->mCPUMHz: " << mCPUMHz << std::endl; - s << "->mCPUString: " << mCPUString << std::endl; + s << "->mHasAltivec: " << (U32)mHasAltivec << std::endl; + s << "->mCPUMHz: " << mCPUMHz << std::endl; + s << "->mCPUString: " << mCPUString << std::endl; } // Helper class for LLMemoryInfo: accumulate stats in the form we store for @@ -715,58 +715,58 @@ void LLCPUInfo::stream(std::ostream& s) const class Stats { public: - Stats(): - mStats(LLSD::emptyMap()) - {} + Stats(): + mStats(LLSD::emptyMap()) + {} - // Store every integer type as LLSD::Integer. - template <class T> - void add(const LLSD::String& name, const T& value, - typename boost::enable_if<boost::is_integral<T> >::type* = 0) - { - mStats[name] = LLSD::Integer(value); - } + // Store every integer type as LLSD::Integer. + template <class T> + void add(const LLSD::String& name, const T& value, + typename boost::enable_if<boost::is_integral<T> >::type* = 0) + { + mStats[name] = LLSD::Integer(value); + } - // Store every floating-point type as LLSD::Real. - template <class T> - void add(const LLSD::String& name, const T& value, - typename boost::enable_if<boost::is_float<T> >::type* = 0) - { - mStats[name] = LLSD::Real(value); - } + // Store every floating-point type as LLSD::Real. + template <class T> + void add(const LLSD::String& name, const T& value, + typename boost::enable_if<boost::is_float<T> >::type* = 0) + { + mStats[name] = LLSD::Real(value); + } - // Hope that LLSD::Date values are sufficiently unambiguous. - void add(const LLSD::String& name, const LLSD::Date& value) - { - mStats[name] = value; - } + // Hope that LLSD::Date values are sufficiently unambiguous. + void add(const LLSD::String& name, const LLSD::Date& value) + { + mStats[name] = value; + } - LLSD get() const { return mStats; } + LLSD get() const { return mStats; } private: - LLSD mStats; + LLSD mStats; }; LLMemoryInfo::LLMemoryInfo() { - refresh(); + refresh(); } #if LL_WINDOWS static U32Kilobytes LLMemoryAdjustKBResult(U32Kilobytes inKB) { - // Moved this here from llfloaterabout.cpp + // Moved this here from llfloaterabout.cpp - //! \bug - // For some reason, the reported amount of memory is always wrong. - // The original adjustment assumes it's always off by one meg, however - // errors of as much as 2520 KB have been observed in the value - // returned from the GetMemoryStatusEx function. Here we keep the - // original adjustment from llfoaterabout.cpp until this can be - // fixed somehow. - inKB += U32Megabytes(1); + //! \bug + // For some reason, the reported amount of memory is always wrong. + // The original adjustment assumes it's always off by one meg, however + // errors of as much as 2520 KB have been observed in the value + // returned from the GetMemoryStatusEx function. Here we keep the + // original adjustment from llfoaterabout.cpp until this can be + // fixed somehow. + inKB += U32Megabytes(1); - return inKB; + return inKB; } #endif @@ -788,18 +788,18 @@ U32Kilobytes LLMemoryInfo::getHardwareMemSize() U32Kilobytes LLMemoryInfo::getPhysicalMemoryKB() const { #if LL_WINDOWS - return LLMemoryAdjustKBResult(U32Kilobytes(mStatsMap["Total Physical KB"].asInteger())); + return LLMemoryAdjustKBResult(U32Kilobytes(mStatsMap["Total Physical KB"].asInteger())); #elif LL_DARWIN return getHardwareMemSize(); #elif LL_LINUX - U64 phys = 0; - phys = (U64)(getpagesize()) * (U64)(get_phys_pages()); - return U64Bytes(phys); + U64 phys = 0; + phys = (U64)(getpagesize()) * (U64)(get_phys_pages()); + return U64Bytes(phys); #else - return 0; + return 0; #endif } @@ -808,373 +808,373 @@ U32Kilobytes LLMemoryInfo::getPhysicalMemoryKB() const void LLMemoryInfo::getAvailableMemoryKB(U32Kilobytes& avail_physical_mem_kb, U32Kilobytes& avail_virtual_mem_kb) { #if LL_WINDOWS - // Sigh, this shouldn't be a static method, then we wouldn't have to - // reload this data separately from refresh() - LLSD statsMap(loadStatsMap()); + // Sigh, this shouldn't be a static method, then we wouldn't have to + // reload this data separately from refresh() + LLSD statsMap(loadStatsMap()); - avail_physical_mem_kb = (U32Kilobytes)statsMap["Avail Physical KB"].asInteger(); - avail_virtual_mem_kb = (U32Kilobytes)statsMap["Avail Virtual KB"].asInteger(); + avail_physical_mem_kb = (U32Kilobytes)statsMap["Avail Physical KB"].asInteger(); + avail_virtual_mem_kb = (U32Kilobytes)statsMap["Avail Virtual KB"].asInteger(); #elif LL_DARWIN - // mStatsMap is derived from vm_stat, look for (e.g.) "kb free": - // $ vm_stat - // Mach Virtual Memory Statistics: (page size of 4096 bytes) - // Pages free: 462078. - // Pages active: 142010. - // Pages inactive: 220007. - // Pages wired down: 159552. - // "Translation faults": 220825184. - // Pages copy-on-write: 2104153. - // Pages zero filled: 167034876. - // Pages reactivated: 65153. - // Pageins: 2097212. - // Pageouts: 41759. - // Object cache: 841598 hits of 7629869 lookups (11% hit rate) - avail_physical_mem_kb = (U32Kilobytes)-1 ; - avail_virtual_mem_kb = (U32Kilobytes)-1 ; + // mStatsMap is derived from vm_stat, look for (e.g.) "kb free": + // $ vm_stat + // Mach Virtual Memory Statistics: (page size of 4096 bytes) + // Pages free: 462078. + // Pages active: 142010. + // Pages inactive: 220007. + // Pages wired down: 159552. + // "Translation faults": 220825184. + // Pages copy-on-write: 2104153. + // Pages zero filled: 167034876. + // Pages reactivated: 65153. + // Pageins: 2097212. + // Pageouts: 41759. + // Object cache: 841598 hits of 7629869 lookups (11% hit rate) + avail_physical_mem_kb = (U32Kilobytes)-1 ; + avail_virtual_mem_kb = (U32Kilobytes)-1 ; #elif LL_LINUX - // mStatsMap is derived from MEMINFO_FILE: - // $ cat /proc/meminfo - // MemTotal: 4108424 kB - // MemFree: 1244064 kB - // Buffers: 85164 kB - // Cached: 1990264 kB - // SwapCached: 0 kB - // Active: 1176648 kB - // Inactive: 1427532 kB - // Active(anon): 529152 kB - // Inactive(anon): 15924 kB - // Active(file): 647496 kB - // Inactive(file): 1411608 kB - // Unevictable: 16 kB - // Mlocked: 16 kB - // HighTotal: 3266316 kB - // HighFree: 721308 kB - // LowTotal: 842108 kB - // LowFree: 522756 kB - // SwapTotal: 6384632 kB - // SwapFree: 6384632 kB - // Dirty: 28 kB - // Writeback: 0 kB - // AnonPages: 528820 kB - // Mapped: 89472 kB - // Shmem: 16324 kB - // Slab: 159624 kB - // SReclaimable: 145168 kB - // SUnreclaim: 14456 kB - // KernelStack: 2560 kB - // PageTables: 5560 kB - // NFS_Unstable: 0 kB - // Bounce: 0 kB - // WritebackTmp: 0 kB - // CommitLimit: 8438844 kB - // Committed_AS: 1271596 kB - // VmallocTotal: 122880 kB - // VmallocUsed: 65252 kB - // VmallocChunk: 52356 kB - // HardwareCorrupted: 0 kB - // HugePages_Total: 0 - // HugePages_Free: 0 - // HugePages_Rsvd: 0 - // HugePages_Surp: 0 - // Hugepagesize: 2048 kB - // DirectMap4k: 434168 kB - // DirectMap2M: 477184 kB - // (could also run 'free', but easier to read a file than run a program) - avail_physical_mem_kb = (U32Kilobytes)-1 ; - avail_virtual_mem_kb = (U32Kilobytes)-1 ; + // mStatsMap is derived from MEMINFO_FILE: + // $ cat /proc/meminfo + // MemTotal: 4108424 kB + // MemFree: 1244064 kB + // Buffers: 85164 kB + // Cached: 1990264 kB + // SwapCached: 0 kB + // Active: 1176648 kB + // Inactive: 1427532 kB + // Active(anon): 529152 kB + // Inactive(anon): 15924 kB + // Active(file): 647496 kB + // Inactive(file): 1411608 kB + // Unevictable: 16 kB + // Mlocked: 16 kB + // HighTotal: 3266316 kB + // HighFree: 721308 kB + // LowTotal: 842108 kB + // LowFree: 522756 kB + // SwapTotal: 6384632 kB + // SwapFree: 6384632 kB + // Dirty: 28 kB + // Writeback: 0 kB + // AnonPages: 528820 kB + // Mapped: 89472 kB + // Shmem: 16324 kB + // Slab: 159624 kB + // SReclaimable: 145168 kB + // SUnreclaim: 14456 kB + // KernelStack: 2560 kB + // PageTables: 5560 kB + // NFS_Unstable: 0 kB + // Bounce: 0 kB + // WritebackTmp: 0 kB + // CommitLimit: 8438844 kB + // Committed_AS: 1271596 kB + // VmallocTotal: 122880 kB + // VmallocUsed: 65252 kB + // VmallocChunk: 52356 kB + // HardwareCorrupted: 0 kB + // HugePages_Total: 0 + // HugePages_Free: 0 + // HugePages_Rsvd: 0 + // HugePages_Surp: 0 + // Hugepagesize: 2048 kB + // DirectMap4k: 434168 kB + // DirectMap2M: 477184 kB + // (could also run 'free', but easier to read a file than run a program) + avail_physical_mem_kb = (U32Kilobytes)-1 ; + avail_virtual_mem_kb = (U32Kilobytes)-1 ; #else - //do not know how to collect available memory info for other systems. - //leave it blank here for now. + //do not know how to collect available memory info for other systems. + //leave it blank here for now. - avail_physical_mem_kb = (U32Kilobytes)-1 ; - avail_virtual_mem_kb = (U32Kilobytes)-1 ; + avail_physical_mem_kb = (U32Kilobytes)-1 ; + avail_virtual_mem_kb = (U32Kilobytes)-1 ; #endif } void LLMemoryInfo::stream(std::ostream& s) const { - // We want these memory stats to be easy to grep from the log, along with - // the timestamp. So preface each line with the timestamp and a - // distinctive marker. Without that, we'd have to search the log for the - // introducer line, then read subsequent lines, etc... - std::string pfx(LLError::utcTime() + " <mem> "); + // We want these memory stats to be easy to grep from the log, along with + // the timestamp. So preface each line with the timestamp and a + // distinctive marker. Without that, we'd have to search the log for the + // introducer line, then read subsequent lines, etc... + std::string pfx(LLError::utcTime() + " <mem> "); - // Max key length - size_t key_width(0); - for (const auto& [key, value] : inMap(mStatsMap)) - { - size_t len(key.length()); - if (len > key_width) - { - key_width = len; - } - } + // Max key length + size_t key_width(0); + for (const auto& [key, value] : inMap(mStatsMap)) + { + size_t len(key.length()); + if (len > key_width) + { + key_width = len; + } + } - // Now stream stats - for (const auto& [key, value] : inMap(mStatsMap)) - { - s << pfx << std::setw(narrow<size_t>(key_width+1)) << (key + ':') << ' '; - if (value.isInteger()) - s << std::setw(12) << value.asInteger(); - else if (value.isReal()) - s << std::fixed << std::setprecision(1) << value.asReal(); - else if (value.isDate()) - value.asDate().toStream(s); - else - s << value; // just use default LLSD formatting - s << std::endl; - } + // Now stream stats + for (const auto& [key, value] : inMap(mStatsMap)) + { + s << pfx << std::setw(narrow<size_t>(key_width+1)) << (key + ':') << ' '; + if (value.isInteger()) + s << std::setw(12) << value.asInteger(); + else if (value.isReal()) + s << std::fixed << std::setprecision(1) << value.asReal(); + else if (value.isDate()) + value.asDate().toStream(s); + else + s << value; // just use default LLSD formatting + s << std::endl; + } } LLSD LLMemoryInfo::getStatsMap() const { - return mStatsMap; + return mStatsMap; } LLMemoryInfo& LLMemoryInfo::refresh() { - LL_PROFILE_ZONE_SCOPED - mStatsMap = loadStatsMap(); + LL_PROFILE_ZONE_SCOPED + mStatsMap = loadStatsMap(); - LL_DEBUGS("LLMemoryInfo") << "Populated mStatsMap:\n"; - LLSDSerialize::toPrettyXML(mStatsMap, LL_CONT); - LL_ENDL; + LL_DEBUGS("LLMemoryInfo") << "Populated mStatsMap:\n"; + LLSDSerialize::toPrettyXML(mStatsMap, LL_CONT); + LL_ENDL; - return *this; + return *this; } LLSD LLMemoryInfo::loadStatsMap() { LL_PROFILE_ZONE_SCOPED; - // This implementation is derived from stream() code (as of 2011-06-29). - Stats stats; + // This implementation is derived from stream() code (as of 2011-06-29). + Stats stats; - // associate timestamp for analysis over time - stats.add("timestamp", LLDate::now()); + // associate timestamp for analysis over time + stats.add("timestamp", LLDate::now()); #if LL_WINDOWS - MEMORYSTATUSEX state; - state.dwLength = sizeof(state); - GlobalMemoryStatusEx(&state); + MEMORYSTATUSEX state; + state.dwLength = sizeof(state); + GlobalMemoryStatusEx(&state); - DWORDLONG div = 1024; + DWORDLONG div = 1024; - stats.add("Percent Memory use", state.dwMemoryLoad/div); - stats.add("Total Physical KB", state.ullTotalPhys/div); - stats.add("Avail Physical KB", state.ullAvailPhys/div); - stats.add("Total page KB", state.ullTotalPageFile/div); - stats.add("Avail page KB", state.ullAvailPageFile/div); - stats.add("Total Virtual KB", state.ullTotalVirtual/div); - stats.add("Avail Virtual KB", state.ullAvailVirtual/div); + stats.add("Percent Memory use", state.dwMemoryLoad/div); + stats.add("Total Physical KB", state.ullTotalPhys/div); + stats.add("Avail Physical KB", state.ullAvailPhys/div); + stats.add("Total page KB", state.ullTotalPageFile/div); + stats.add("Avail page KB", state.ullAvailPageFile/div); + stats.add("Total Virtual KB", state.ullTotalVirtual/div); + stats.add("Avail Virtual KB", state.ullAvailVirtual/div); - // SL-12122 - Call to GetPerformanceInfo() was removed here. Took - // on order of 10 ms, causing unacceptable frame time spike every - // second, and results were never used. If this is needed in the - // future, must find a way to avoid frame time impact (e.g. move - // to another thread, call much less often). + // SL-12122 - Call to GetPerformanceInfo() was removed here. Took + // on order of 10 ms, causing unacceptable frame time spike every + // second, and results were never used. If this is needed in the + // future, must find a way to avoid frame time impact (e.g. move + // to another thread, call much less often). - PROCESS_MEMORY_COUNTERS_EX pmem; - pmem.cb = sizeof(pmem); - // GetProcessMemoryInfo() is documented to accept either - // PROCESS_MEMORY_COUNTERS* or PROCESS_MEMORY_COUNTERS_EX*, presumably - // using the redundant size info to distinguish. But its prototype - // specifically accepts PROCESS_MEMORY_COUNTERS*, and since this is a - // classic-C API, PROCESS_MEMORY_COUNTERS_EX isn't a subclass. Cast the - // pointer. - GetProcessMemoryInfo(GetCurrentProcess(), PPROCESS_MEMORY_COUNTERS(&pmem), sizeof(pmem)); + PROCESS_MEMORY_COUNTERS_EX pmem; + pmem.cb = sizeof(pmem); + // GetProcessMemoryInfo() is documented to accept either + // PROCESS_MEMORY_COUNTERS* or PROCESS_MEMORY_COUNTERS_EX*, presumably + // using the redundant size info to distinguish. But its prototype + // specifically accepts PROCESS_MEMORY_COUNTERS*, and since this is a + // classic-C API, PROCESS_MEMORY_COUNTERS_EX isn't a subclass. Cast the + // pointer. + GetProcessMemoryInfo(GetCurrentProcess(), PPROCESS_MEMORY_COUNTERS(&pmem), sizeof(pmem)); - stats.add("Page Fault Count", pmem.PageFaultCount); - stats.add("PeakWorkingSetSize KB", pmem.PeakWorkingSetSize/div); - stats.add("WorkingSetSize KB", pmem.WorkingSetSize/div); - stats.add("QutaPeakPagedPoolUsage KB", pmem.QuotaPeakPagedPoolUsage/div); - stats.add("QuotaPagedPoolUsage KB", pmem.QuotaPagedPoolUsage/div); - stats.add("QuotaPeakNonPagedPoolUsage KB", pmem.QuotaPeakNonPagedPoolUsage/div); - stats.add("QuotaNonPagedPoolUsage KB", pmem.QuotaNonPagedPoolUsage/div); - stats.add("PagefileUsage KB", pmem.PagefileUsage/div); - stats.add("PeakPagefileUsage KB", pmem.PeakPagefileUsage/div); - stats.add("PrivateUsage KB", pmem.PrivateUsage/div); + stats.add("Page Fault Count", pmem.PageFaultCount); + stats.add("PeakWorkingSetSize KB", pmem.PeakWorkingSetSize/div); + stats.add("WorkingSetSize KB", pmem.WorkingSetSize/div); + stats.add("QutaPeakPagedPoolUsage KB", pmem.QuotaPeakPagedPoolUsage/div); + stats.add("QuotaPagedPoolUsage KB", pmem.QuotaPagedPoolUsage/div); + stats.add("QuotaPeakNonPagedPoolUsage KB", pmem.QuotaPeakNonPagedPoolUsage/div); + stats.add("QuotaNonPagedPoolUsage KB", pmem.QuotaNonPagedPoolUsage/div); + stats.add("PagefileUsage KB", pmem.PagefileUsage/div); + stats.add("PeakPagefileUsage KB", pmem.PeakPagefileUsage/div); + stats.add("PrivateUsage KB", pmem.PrivateUsage/div); #elif LL_DARWIN - const vm_size_t pagekb(vm_page_size / 1024); - - // - // Collect the vm_stat's - // - - { - vm_statistics64_data_t vmstat; - mach_msg_type_number_t vmstatCount = HOST_VM_INFO64_COUNT; + const vm_size_t pagekb(vm_page_size / 1024); + + // + // Collect the vm_stat's + // + + { + vm_statistics64_data_t vmstat; + mach_msg_type_number_t vmstatCount = HOST_VM_INFO64_COUNT; + + if (host_statistics64(mach_host_self(), HOST_VM_INFO64, (host_info64_t) &vmstat, &vmstatCount) != KERN_SUCCESS) + { + LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL; + } + else + { + stats.add("Pages free KB", pagekb * vmstat.free_count); + stats.add("Pages active KB", pagekb * vmstat.active_count); + stats.add("Pages inactive KB", pagekb * vmstat.inactive_count); + stats.add("Pages wired KB", pagekb * vmstat.wire_count); + + stats.add("Pages zero fill", vmstat.zero_fill_count); + stats.add("Page reactivations", vmstat.reactivations); + stats.add("Page-ins", vmstat.pageins); + stats.add("Page-outs", vmstat.pageouts); + + stats.add("Faults", vmstat.faults); + stats.add("Faults copy-on-write", vmstat.cow_faults); - if (host_statistics64(mach_host_self(), HOST_VM_INFO64, (host_info64_t) &vmstat, &vmstatCount) != KERN_SUCCESS) - { - LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL; - } - else - { - stats.add("Pages free KB", pagekb * vmstat.free_count); - stats.add("Pages active KB", pagekb * vmstat.active_count); - stats.add("Pages inactive KB", pagekb * vmstat.inactive_count); - stats.add("Pages wired KB", pagekb * vmstat.wire_count); + stats.add("Cache lookups", vmstat.lookups); + stats.add("Cache hits", vmstat.hits); - stats.add("Pages zero fill", vmstat.zero_fill_count); - stats.add("Page reactivations", vmstat.reactivations); - stats.add("Page-ins", vmstat.pageins); - stats.add("Page-outs", vmstat.pageouts); - - stats.add("Faults", vmstat.faults); - stats.add("Faults copy-on-write", vmstat.cow_faults); - - stats.add("Cache lookups", vmstat.lookups); - stats.add("Cache hits", vmstat.hits); - - stats.add("Page purgeable count", vmstat.purgeable_count); - stats.add("Page purges", vmstat.purges); - - stats.add("Page speculative reads", vmstat.speculative_count); - } - } + stats.add("Page purgeable count", vmstat.purgeable_count); + stats.add("Page purges", vmstat.purges); - // - // Collect the misc task info - // + stats.add("Page speculative reads", vmstat.speculative_count); + } + } + + // + // Collect the misc task info + // + + { + task_events_info_data_t taskinfo; + unsigned taskinfoSize = sizeof(taskinfo); + + if (task_info(mach_task_self(), TASK_EVENTS_INFO, (task_info_t) &taskinfo, &taskinfoSize) != KERN_SUCCESS) + { + LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL; + } + else + { + stats.add("Task page-ins", taskinfo.pageins); + stats.add("Task copy-on-write faults", taskinfo.cow_faults); + stats.add("Task messages sent", taskinfo.messages_sent); + stats.add("Task messages received", taskinfo.messages_received); + stats.add("Task mach system call count", taskinfo.syscalls_mach); + stats.add("Task unix system call count", taskinfo.syscalls_unix); + stats.add("Task context switch count", taskinfo.csw); + } + } - { - task_events_info_data_t taskinfo; - unsigned taskinfoSize = sizeof(taskinfo); - - if (task_info(mach_task_self(), TASK_EVENTS_INFO, (task_info_t) &taskinfo, &taskinfoSize) != KERN_SUCCESS) - { - LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL; - } - else - { - stats.add("Task page-ins", taskinfo.pageins); - stats.add("Task copy-on-write faults", taskinfo.cow_faults); - stats.add("Task messages sent", taskinfo.messages_sent); - stats.add("Task messages received", taskinfo.messages_received); - stats.add("Task mach system call count", taskinfo.syscalls_mach); - stats.add("Task unix system call count", taskinfo.syscalls_unix); - stats.add("Task context switch count", taskinfo.csw); - } - } - - // - // Collect the basic task info - // + // + // Collect the basic task info + // - { - mach_task_basic_info_data_t taskinfo; - mach_msg_type_number_t task_count = MACH_TASK_BASIC_INFO_COUNT; - if (task_info(mach_task_self(), MACH_TASK_BASIC_INFO, (task_info_t) &taskinfo, &task_count) != KERN_SUCCESS) - { - LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL; - } - else - { - stats.add("Basic virtual memory KB", taskinfo.virtual_size / 1024); - stats.add("Basic resident memory KB", taskinfo.resident_size / 1024); - stats.add("Basic max resident memory KB", taskinfo.resident_size_max / 1024); - stats.add("Basic new thread policy", taskinfo.policy); - stats.add("Basic suspend count", taskinfo.suspend_count); - } - } + { + mach_task_basic_info_data_t taskinfo; + mach_msg_type_number_t task_count = MACH_TASK_BASIC_INFO_COUNT; + if (task_info(mach_task_self(), MACH_TASK_BASIC_INFO, (task_info_t) &taskinfo, &task_count) != KERN_SUCCESS) + { + LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL; + } + else + { + stats.add("Basic virtual memory KB", taskinfo.virtual_size / 1024); + stats.add("Basic resident memory KB", taskinfo.resident_size / 1024); + stats.add("Basic max resident memory KB", taskinfo.resident_size_max / 1024); + stats.add("Basic new thread policy", taskinfo.policy); + stats.add("Basic suspend count", taskinfo.suspend_count); + } + } #elif LL_LINUX - std::ifstream meminfo(MEMINFO_FILE); - if (meminfo.is_open()) - { - // MemTotal: 4108424 kB - // MemFree: 1244064 kB - // Buffers: 85164 kB - // Cached: 1990264 kB - // SwapCached: 0 kB - // Active: 1176648 kB - // Inactive: 1427532 kB - // ... - // VmallocTotal: 122880 kB - // VmallocUsed: 65252 kB - // VmallocChunk: 52356 kB - // HardwareCorrupted: 0 kB - // HugePages_Total: 0 - // HugePages_Free: 0 - // HugePages_Rsvd: 0 - // HugePages_Surp: 0 - // Hugepagesize: 2048 kB - // DirectMap4k: 434168 kB - // DirectMap2M: 477184 kB + std::ifstream meminfo(MEMINFO_FILE); + if (meminfo.is_open()) + { + // MemTotal: 4108424 kB + // MemFree: 1244064 kB + // Buffers: 85164 kB + // Cached: 1990264 kB + // SwapCached: 0 kB + // Active: 1176648 kB + // Inactive: 1427532 kB + // ... + // VmallocTotal: 122880 kB + // VmallocUsed: 65252 kB + // VmallocChunk: 52356 kB + // HardwareCorrupted: 0 kB + // HugePages_Total: 0 + // HugePages_Free: 0 + // HugePages_Rsvd: 0 + // HugePages_Surp: 0 + // Hugepagesize: 2048 kB + // DirectMap4k: 434168 kB + // DirectMap2M: 477184 kB - // Intentionally don't pass the boost::no_except flag. This - // boost::regex object is constructed with a string literal, so it - // should be valid every time. If it becomes invalid, we WANT an - // exception, hopefully even before the dev checks in. - boost::regex stat_rx("(.+): +([0-9]+)( kB)?"); - boost::smatch matched; + // Intentionally don't pass the boost::no_except flag. This + // boost::regex object is constructed with a string literal, so it + // should be valid every time. If it becomes invalid, we WANT an + // exception, hopefully even before the dev checks in. + boost::regex stat_rx("(.+): +([0-9]+)( kB)?"); + boost::smatch matched; - std::string line; - while (std::getline(meminfo, line)) - { - LL_DEBUGS("LLMemoryInfo") << line << LL_ENDL; - if (ll_regex_match(line, matched, stat_rx)) - { - // e.g. "MemTotal: 4108424 kB" - LLSD::String key(matched[1].first, matched[1].second); - LLSD::String value_str(matched[2].first, matched[2].second); - LLSD::Integer value(0); - try - { - value = boost::lexical_cast<LLSD::Integer>(value_str); - } - catch (const boost::bad_lexical_cast&) - { - LL_WARNS("LLMemoryInfo") << "couldn't parse '" << value_str - << "' in " << MEMINFO_FILE << " line: " - << line << LL_ENDL; - continue; - } - // Store this statistic. - stats.add(key, value); - } - else - { - LL_WARNS("LLMemoryInfo") << "unrecognized " << MEMINFO_FILE << " line: " - << line << LL_ENDL; - } - } - } - else - { - LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL; - } + std::string line; + while (std::getline(meminfo, line)) + { + LL_DEBUGS("LLMemoryInfo") << line << LL_ENDL; + if (ll_regex_match(line, matched, stat_rx)) + { + // e.g. "MemTotal: 4108424 kB" + LLSD::String key(matched[1].first, matched[1].second); + LLSD::String value_str(matched[2].first, matched[2].second); + LLSD::Integer value(0); + try + { + value = boost::lexical_cast<LLSD::Integer>(value_str); + } + catch (const boost::bad_lexical_cast&) + { + LL_WARNS("LLMemoryInfo") << "couldn't parse '" << value_str + << "' in " << MEMINFO_FILE << " line: " + << line << LL_ENDL; + continue; + } + // Store this statistic. + stats.add(key, value); + } + else + { + LL_WARNS("LLMemoryInfo") << "unrecognized " << MEMINFO_FILE << " line: " + << line << LL_ENDL; + } + } + } + else + { + LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL; + } #else - LL_WARNS("LLMemoryInfo") << "Unknown system; unable to collect memory information" << LL_ENDL; + LL_WARNS("LLMemoryInfo") << "Unknown system; unable to collect memory information" << LL_ENDL; #endif - return stats.get(); + return stats.get(); } std::ostream& operator<<(std::ostream& s, const LLOSInfo& info) { - info.stream(s); - return s; + info.stream(s); + return s; } std::ostream& operator<<(std::ostream& s, const LLCPUInfo& info) { - info.stream(s); - return s; + info.stream(s); + return s; } std::ostream& operator<<(std::ostream& s, const LLMemoryInfo& info) { - info.stream(s); - return s; + info.stream(s); + return s; } class FrameWatcher @@ -1286,13 +1286,13 @@ public: << " seconds "; } - auto precision = LL_CONT.precision(); + auto precision = LL_CONT.precision(); LL_CONT << std::fixed << std::setprecision(1) << framerate << '\n' << LLMemoryInfo(); - LL_CONT.precision(precision); - LL_CONT << LL_ENDL; + LL_CONT.precision(precision); + LL_CONT << LL_ENDL; return false; } @@ -1321,57 +1321,57 @@ static FrameWatcher sFrameWatcher; BOOL gunzip_file(const std::string& srcfile, const std::string& dstfile) { - std::string tmpfile; - const S32 UNCOMPRESS_BUFFER_SIZE = 32768; - BOOL retval = FALSE; - gzFile src = NULL; - U8 buffer[UNCOMPRESS_BUFFER_SIZE]; - LLFILE *dst = NULL; - S32 bytes = 0; - tmpfile = dstfile + ".t"; + std::string tmpfile; + const S32 UNCOMPRESS_BUFFER_SIZE = 32768; + BOOL retval = FALSE; + gzFile src = NULL; + U8 buffer[UNCOMPRESS_BUFFER_SIZE]; + LLFILE *dst = NULL; + S32 bytes = 0; + tmpfile = dstfile + ".t"; #ifdef LL_WINDOWS llutf16string utf16filename = utf8str_to_utf16str(srcfile); src = gzopen_w(utf16filename.c_str(), "rb"); #else src = gzopen(srcfile.c_str(), "rb"); #endif - if (! src) goto err; - dst = LLFile::fopen(tmpfile, "wb"); /* Flawfinder: ignore */ - if (! dst) goto err; - do - { - bytes = gzread(src, buffer, UNCOMPRESS_BUFFER_SIZE); - size_t nwrit = fwrite(buffer, sizeof(U8), bytes, dst); - if (nwrit < (size_t) bytes) - { - LL_WARNS() << "Short write on " << tmpfile << ": Wrote " << nwrit << " of " << bytes << " bytes." << LL_ENDL; - goto err; - } - } while(gzeof(src) == 0); - fclose(dst); - dst = NULL; + if (! src) goto err; + dst = LLFile::fopen(tmpfile, "wb"); /* Flawfinder: ignore */ + if (! dst) goto err; + do + { + bytes = gzread(src, buffer, UNCOMPRESS_BUFFER_SIZE); + size_t nwrit = fwrite(buffer, sizeof(U8), bytes, dst); + if (nwrit < (size_t) bytes) + { + LL_WARNS() << "Short write on " << tmpfile << ": Wrote " << nwrit << " of " << bytes << " bytes." << LL_ENDL; + goto err; + } + } while(gzeof(src) == 0); + fclose(dst); + dst = NULL; #if LL_WINDOWS // Rename in windows needs the dstfile to not exist. LLFile::remove(dstfile, ENOENT); #endif - if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */ - retval = TRUE; + if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */ + retval = TRUE; err: - if (src != NULL) gzclose(src); - if (dst != NULL) fclose(dst); - return retval; + if (src != NULL) gzclose(src); + if (dst != NULL) fclose(dst); + return retval; } BOOL gzip_file(const std::string& srcfile, const std::string& dstfile) { - const S32 COMPRESS_BUFFER_SIZE = 32768; - std::string tmpfile; - BOOL retval = FALSE; - U8 buffer[COMPRESS_BUFFER_SIZE]; - gzFile dst = NULL; - LLFILE *src = NULL; - S32 bytes = 0; - tmpfile = dstfile + ".t"; + const S32 COMPRESS_BUFFER_SIZE = 32768; + std::string tmpfile; + BOOL retval = FALSE; + U8 buffer[COMPRESS_BUFFER_SIZE]; + gzFile dst = NULL; + LLFILE *src = NULL; + S32 bytes = 0; + tmpfile = dstfile + ".t"; #ifdef LL_WINDOWS llutf16string utf16filename = utf8str_to_utf16str(tmpfile); @@ -1380,35 +1380,35 @@ BOOL gzip_file(const std::string& srcfile, const std::string& dstfile) dst = gzopen(tmpfile.c_str(), "wb"); #endif - if (! dst) goto err; - src = LLFile::fopen(srcfile, "rb"); /* Flawfinder: ignore */ - if (! src) goto err; + if (! dst) goto err; + src = LLFile::fopen(srcfile, "rb"); /* Flawfinder: ignore */ + if (! src) goto err; - while ((bytes = (S32)fread(buffer, sizeof(U8), COMPRESS_BUFFER_SIZE, src)) > 0) - { - if (gzwrite(dst, buffer, bytes) <= 0) - { - LL_WARNS() << "gzwrite failed: " << gzerror(dst, NULL) << LL_ENDL; - goto err; - } - } + while ((bytes = (S32)fread(buffer, sizeof(U8), COMPRESS_BUFFER_SIZE, src)) > 0) + { + if (gzwrite(dst, buffer, bytes) <= 0) + { + LL_WARNS() << "gzwrite failed: " << gzerror(dst, NULL) << LL_ENDL; + goto err; + } + } - if (ferror(src)) - { - LL_WARNS() << "Error reading " << srcfile << LL_ENDL; - goto err; - } + if (ferror(src)) + { + LL_WARNS() << "Error reading " << srcfile << LL_ENDL; + goto err; + } - gzclose(dst); - dst = NULL; + gzclose(dst); + dst = NULL; #if LL_WINDOWS - // Rename in windows needs the dstfile to not exist. - LLFile::remove(dstfile); + // Rename in windows needs the dstfile to not exist. + LLFile::remove(dstfile); #endif - if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */ - retval = TRUE; + if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */ + retval = TRUE; err: - if (src != NULL) fclose(src); - if (dst != NULL) gzclose(dst); - return retval; + if (src != NULL) fclose(src); + if (dst != NULL) gzclose(dst); + return retval; } |
