summaryrefslogtreecommitdiff
path: root/indra/llcommon/llsys.cpp
diff options
context:
space:
mode:
authorNat Goodspeed <nat@lindenlab.com>2024-05-14 21:02:28 -0400
committerNat Goodspeed <nat@lindenlab.com>2024-05-14 21:02:28 -0400
commit094dcc07f8c1d90ae723dbe60eddacb90a09eae8 (patch)
treee750942e5f22ed677b543bd49509c2a7cdc5ce56 /indra/llcommon/llsys.cpp
parentd4043d3b011c32eb503c43c551872f9c24d7344f (diff)
parent38c2a5bde985a6a8a96d912d432f8bdf7e5b60be (diff)
Merge DRTVWR-591-maint-X to main on promotion of secondlife/viewer #705: Maintenance X
Diffstat (limited to 'indra/llcommon/llsys.cpp')
-rw-r--r--indra/llcommon/llsys.cpp1626
1 files changed, 815 insertions, 811 deletions
diff --git a/indra/llcommon/llsys.cpp b/indra/llcommon/llsys.cpp
index 42400e90af..b7ffddc023 100644
--- a/indra/llcommon/llsys.cpp
+++ b/indra/llcommon/llsys.cpp
@@ -1,25 +1,25 @@
-/**
+/**
* @file llsys.cpp
* @brief Implementation of the basic system query functions.
*
* $LicenseInfo:firstyear=2002&license=viewerlgpl$
* Second Life Viewer Source Code
* Copyright (C) 2010, Linden Research, Inc.
- *
+ *
* This library is free software; you can redistribute it and/or
* modify it under the terms of the GNU Lesser General Public
* License as published by the Free Software Foundation;
* version 2.1 of the License only.
- *
+ *
* This library is distributed in the hope that it will be useful,
* but WITHOUT ANY WARRANTY; without even the implied warranty of
* MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
* Lesser General Public License for more details.
- *
+ *
* You should have received a copy of the GNU Lesser General Public
* License along with this library; if not, write to the Free Software
* Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
- *
+ *
* Linden Research, Inc., 945 Battery Street, San Francisco, CA 94111 USA
* $/LicenseInfo$
*/
@@ -59,26 +59,26 @@
using namespace llsd;
#if LL_WINDOWS
-# include "llwin32headerslean.h"
+# include "llwin32headerslean.h"
# include <psapi.h> // GetPerformanceInfo() et al.
-# include <VersionHelpers.h>
+# include <VersionHelpers.h>
#elif LL_DARWIN
# include "llsys_objc.h"
-# include <errno.h>
-# include <sys/sysctl.h>
-# include <sys/utsname.h>
-# include <stdint.h>
-# include <CoreServices/CoreServices.h>
+# include <errno.h>
+# include <sys/sysctl.h>
+# include <sys/utsname.h>
+# include <stdint.h>
+# include <CoreServices/CoreServices.h>
# include <stdexcept>
-# include <mach/host_info.h>
-# include <mach/mach_host.h>
-# include <mach/task.h>
-# include <mach/task_info.h>
+# include <mach/host_info.h>
+# include <mach/mach_host.h>
+# include <mach/task.h>
+# include <mach/task_info.h>
#elif LL_LINUX
-# include <errno.h>
-# include <sys/utsname.h>
-# include <unistd.h>
-# include <sys/sysinfo.h>
+# include <errno.h>
+# include <sys/utsname.h>
+# include <unistd.h>
+# include <sys/sysinfo.h>
# include <stdexcept>
const char MEMINFO_FILE[] = "/proc/meminfo";
# include <gnu/libc-version.h>
@@ -96,132 +96,132 @@ static const F32 MEM_INFO_THROTTLE = 20;
static const F32 MEM_INFO_WINDOW = 10*60;
LLOSInfo::LLOSInfo() :
- mMajorVer(0), mMinorVer(0), mBuild(0), mOSVersionString("")
+ mMajorVer(0), mMinorVer(0), mBuild(0), mOSVersionString("")
{
#if LL_WINDOWS
if (IsWindows10OrGreater())
- {
- mMajorVer = 10;
- mMinorVer = 0;
- mOSStringSimple = "Microsoft Windows 10 ";
- }
- else if (IsWindows8Point1OrGreater())
- {
- mMajorVer = 6;
- mMinorVer = 3;
- if (IsWindowsServer())
- {
- mOSStringSimple = "Windows Server 2012 R2 ";
- }
- else
- {
- mOSStringSimple = "Microsoft Windows 8.1 ";
- }
- }
- else if (IsWindows8OrGreater())
- {
- mMajorVer = 6;
- mMinorVer = 2;
- if (IsWindowsServer())
- {
- mOSStringSimple = "Windows Server 2012 ";
- }
- else
- {
- mOSStringSimple = "Microsoft Windows 8 ";
- }
- }
- else if (IsWindows7SP1OrGreater())
- {
- mMajorVer = 6;
- mMinorVer = 1;
- if (IsWindowsServer())
- {
- mOSStringSimple = "Windows Server 2008 R2 SP1 ";
- }
- else
- {
- mOSStringSimple = "Microsoft Windows 7 SP1 ";
- }
- }
- else if (IsWindows7OrGreater())
- {
- mMajorVer = 6;
- mMinorVer = 1;
- if (IsWindowsServer())
- {
- mOSStringSimple = "Windows Server 2008 R2 ";
- }
- else
- {
- mOSStringSimple = "Microsoft Windows 7 ";
- }
- }
- else if (IsWindowsVistaSP2OrGreater())
- {
- mMajorVer = 6;
- mMinorVer = 0;
- if (IsWindowsServer())
- {
- mOSStringSimple = "Windows Server 2008 SP2 ";
- }
- else
- {
- mOSStringSimple = "Microsoft Windows Vista SP2 ";
- }
- }
- else
- {
- mOSStringSimple = "Unsupported Windows version ";
- }
+ {
+ mMajorVer = 10;
+ mMinorVer = 0;
+ mOSStringSimple = "Microsoft Windows 10 ";
+ }
+ else if (IsWindows8Point1OrGreater())
+ {
+ mMajorVer = 6;
+ mMinorVer = 3;
+ if (IsWindowsServer())
+ {
+ mOSStringSimple = "Windows Server 2012 R2 ";
+ }
+ else
+ {
+ mOSStringSimple = "Microsoft Windows 8.1 ";
+ }
+ }
+ else if (IsWindows8OrGreater())
+ {
+ mMajorVer = 6;
+ mMinorVer = 2;
+ if (IsWindowsServer())
+ {
+ mOSStringSimple = "Windows Server 2012 ";
+ }
+ else
+ {
+ mOSStringSimple = "Microsoft Windows 8 ";
+ }
+ }
+ else if (IsWindows7SP1OrGreater())
+ {
+ mMajorVer = 6;
+ mMinorVer = 1;
+ if (IsWindowsServer())
+ {
+ mOSStringSimple = "Windows Server 2008 R2 SP1 ";
+ }
+ else
+ {
+ mOSStringSimple = "Microsoft Windows 7 SP1 ";
+ }
+ }
+ else if (IsWindows7OrGreater())
+ {
+ mMajorVer = 6;
+ mMinorVer = 1;
+ if (IsWindowsServer())
+ {
+ mOSStringSimple = "Windows Server 2008 R2 ";
+ }
+ else
+ {
+ mOSStringSimple = "Microsoft Windows 7 ";
+ }
+ }
+ else if (IsWindowsVistaSP2OrGreater())
+ {
+ mMajorVer = 6;
+ mMinorVer = 0;
+ if (IsWindowsServer())
+ {
+ mOSStringSimple = "Windows Server 2008 SP2 ";
+ }
+ else
+ {
+ mOSStringSimple = "Microsoft Windows Vista SP2 ";
+ }
+ }
+ else
+ {
+ mOSStringSimple = "Unsupported Windows version ";
+ }
- ///get native system info if available..
- typedef void (WINAPI *PGNSI)(LPSYSTEM_INFO); ///function pointer for loading GetNativeSystemInfo
- SYSTEM_INFO si; //System Info object file contains architecture info
- PGNSI pGNSI; //pointer object
- ZeroMemory(&si, sizeof(SYSTEM_INFO)); //zero out the memory in information
- pGNSI = (PGNSI)GetProcAddress(GetModuleHandle(TEXT("kernel32.dll")), "GetNativeSystemInfo"); //load kernel32 get function
- if (NULL != pGNSI) //check if it has failed
- pGNSI(&si); //success
- else
- GetSystemInfo(&si); //if it fails get regular system info
- //(Warning: If GetSystemInfo it may result in incorrect information in a WOW64 machine, if the kernel fails to load)
+ ///get native system info if available..
+ typedef void (WINAPI *PGNSI)(LPSYSTEM_INFO); ///function pointer for loading GetNativeSystemInfo
+ SYSTEM_INFO si; //System Info object file contains architecture info
+ PGNSI pGNSI; //pointer object
+ ZeroMemory(&si, sizeof(SYSTEM_INFO)); //zero out the memory in information
+ pGNSI = (PGNSI)GetProcAddress(GetModuleHandle(TEXT("kernel32.dll")), "GetNativeSystemInfo"); //load kernel32 get function
+ if (NULL != pGNSI) //check if it has failed
+ pGNSI(&si); //success
+ else
+ GetSystemInfo(&si); //if it fails get regular system info
+ //(Warning: If GetSystemInfo it may result in incorrect information in a WOW64 machine, if the kernel fails to load)
- // Try calling GetVersionEx using the OSVERSIONINFOEX structure.
- OSVERSIONINFOEX osvi;
- ZeroMemory(&osvi, sizeof(OSVERSIONINFOEX));
- osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFOEX);
- if (GetVersionEx((OSVERSIONINFO *)&osvi))
- {
- mBuild = osvi.dwBuildNumber & 0xffff;
- }
- else
- {
- // If OSVERSIONINFOEX doesn't work, try OSVERSIONINFO.
- osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFO);
- if (GetVersionEx((OSVERSIONINFO *)&osvi))
- {
- mBuild = osvi.dwBuildNumber & 0xffff;
- }
- }
+ // Try calling GetVersionEx using the OSVERSIONINFOEX structure.
+ OSVERSIONINFOEX osvi;
+ ZeroMemory(&osvi, sizeof(OSVERSIONINFOEX));
+ osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFOEX);
+ if (GetVersionEx((OSVERSIONINFO *)&osvi))
+ {
+ mBuild = osvi.dwBuildNumber & 0xffff;
+ }
+ else
+ {
+ // If OSVERSIONINFOEX doesn't work, try OSVERSIONINFO.
+ osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFO);
+ if (GetVersionEx((OSVERSIONINFO *)&osvi))
+ {
+ mBuild = osvi.dwBuildNumber & 0xffff;
+ }
+ }
- S32 ubr = 0; // Windows 10 Update Build Revision, can be retrieved from a registry
- if (mMajorVer == 10)
- {
- DWORD cbData(sizeof(DWORD));
- DWORD data(0);
- HKEY key;
- BOOL ret_code = RegOpenKeyExW(HKEY_LOCAL_MACHINE, TEXT("SOFTWARE\\Microsoft\\Windows NT\\CurrentVersion"), 0, KEY_READ, &key);
- if (ERROR_SUCCESS == ret_code)
- {
- ret_code = RegQueryValueExW(key, L"UBR", 0, NULL, reinterpret_cast<LPBYTE>(&data), &cbData);
- if (ERROR_SUCCESS == ret_code)
- {
- ubr = data;
- }
- }
+ S32 ubr = 0; // Windows 10 Update Build Revision, can be retrieved from a registry
+ if (mMajorVer == 10)
+ {
+ DWORD cbData(sizeof(DWORD));
+ DWORD data(0);
+ HKEY key;
+ BOOL ret_code = RegOpenKeyExW(HKEY_LOCAL_MACHINE, TEXT("SOFTWARE\\Microsoft\\Windows NT\\CurrentVersion"), 0, KEY_READ, &key);
+ if (ERROR_SUCCESS == ret_code)
+ {
+ ret_code = RegQueryValueExW(key, L"UBR", 0, NULL, reinterpret_cast<LPBYTE>(&data), &cbData);
+ if (ERROR_SUCCESS == ret_code)
+ {
+ ubr = data;
+ }
+ }
if (mBuild >= 22000)
{
@@ -251,315 +251,315 @@ LLOSInfo::LLOSInfo() :
mOSStringSimple += "32-bit ";
}
- mOSString = mOSStringSimple;
- if (mBuild > 0)
- {
- mOSString += llformat("(Build %d", mBuild);
- if (ubr > 0)
- {
- mOSString += llformat(".%d", ubr);
- }
- mOSString += ")";
- }
+ mOSString = mOSStringSimple;
+ if (mBuild > 0)
+ {
+ mOSString += llformat("(Build %d", mBuild);
+ if (ubr > 0)
+ {
+ mOSString += llformat(".%d", ubr);
+ }
+ mOSString += ")";
+ }
- LLStringUtil::trim(mOSStringSimple);
- LLStringUtil::trim(mOSString);
+ LLStringUtil::trim(mOSStringSimple);
+ LLStringUtil::trim(mOSString);
#elif LL_DARWIN
-
- // Initialize mOSStringSimple to something like:
- // "Mac OS X 10.6.7"
- {
- const char * DARWIN_PRODUCT_NAME = "Mac OS X";
-
- int64_t major_version, minor_version, bugfix_version = 0;
- if (LLGetDarwinOSInfo(major_version, minor_version, bugfix_version))
- {
- mMajorVer = major_version;
- mMinorVer = minor_version;
- mBuild = bugfix_version;
+ // Initialize mOSStringSimple to something like:
+ // "Mac OS X 10.6.7"
+ {
+ const char * DARWIN_PRODUCT_NAME = "Mac OS X";
+
+ int64_t major_version, minor_version, bugfix_version = 0;
+
+ if (LLGetDarwinOSInfo(major_version, minor_version, bugfix_version))
+ {
+ mMajorVer = major_version;
+ mMinorVer = minor_version;
+ mBuild = bugfix_version;
+
+ std::stringstream os_version_string;
+ os_version_string << DARWIN_PRODUCT_NAME << " " << mMajorVer << "." << mMinorVer << "." << mBuild;
+
+ // Put it in the OS string we are compiling
+ mOSStringSimple.append(os_version_string.str());
+ }
+ else
+ {
+ mOSStringSimple.append("Unable to collect OS info");
+ }
+ }
+
+ // Initialize mOSString to something like:
+ // "Mac OS X 10.6.7 Darwin Kernel Version 10.7.0: Sat Jan 29 15:17:16 PST 2011; root:xnu-1504.9.37~1/RELEASE_I386 i386"
+ struct utsname un;
+ if(uname(&un) != -1)
+ {
+ mOSString = mOSStringSimple;
+ mOSString.append(" ");
+ mOSString.append(un.sysname);
+ mOSString.append(" ");
+ mOSString.append(un.release);
+ mOSString.append(" ");
+ mOSString.append(un.version);
+ mOSString.append(" ");
+ mOSString.append(un.machine);
+ }
+ else
+ {
+ mOSString = mOSStringSimple;
+ }
- std::stringstream os_version_string;
- os_version_string << DARWIN_PRODUCT_NAME << " " << mMajorVer << "." << mMinorVer << "." << mBuild;
-
- // Put it in the OS string we are compiling
- mOSStringSimple.append(os_version_string.str());
- }
- else
- {
- mOSStringSimple.append("Unable to collect OS info");
- }
- }
-
- // Initialize mOSString to something like:
- // "Mac OS X 10.6.7 Darwin Kernel Version 10.7.0: Sat Jan 29 15:17:16 PST 2011; root:xnu-1504.9.37~1/RELEASE_I386 i386"
- struct utsname un;
- if(uname(&un) != -1)
- {
- mOSString = mOSStringSimple;
- mOSString.append(" ");
- mOSString.append(un.sysname);
- mOSString.append(" ");
- mOSString.append(un.release);
- mOSString.append(" ");
- mOSString.append(un.version);
- mOSString.append(" ");
- mOSString.append(un.machine);
- }
- else
- {
- mOSString = mOSStringSimple;
- }
-
#elif LL_LINUX
-
- struct utsname un;
- if(uname(&un) != -1)
- {
- mOSStringSimple.append(un.sysname);
- mOSStringSimple.append(" ");
- mOSStringSimple.append(un.release);
- mOSString = mOSStringSimple;
- mOSString.append(" ");
- mOSString.append(un.version);
- mOSString.append(" ");
- mOSString.append(un.machine);
+ struct utsname un;
+ if(uname(&un) != -1)
+ {
+ mOSStringSimple.append(un.sysname);
+ mOSStringSimple.append(" ");
+ mOSStringSimple.append(un.release);
+
+ mOSString = mOSStringSimple;
+ mOSString.append(" ");
+ mOSString.append(un.version);
+ mOSString.append(" ");
+ mOSString.append(un.machine);
- // Simplify 'Simple'
- std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0));
- if (ostype == "Linux")
- {
- // Only care about major and minor Linux versions, truncate at second '.'
- std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0);
- std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos;
- std::string simple = mOSStringSimple.substr(0, idx2);
- if (simple.length() > 0)
- mOSStringSimple = simple;
- }
- }
- else
- {
- mOSStringSimple.append("Unable to collect OS info");
- mOSString = mOSStringSimple;
- }
+ // Simplify 'Simple'
+ std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0));
+ if (ostype == "Linux")
+ {
+ // Only care about major and minor Linux versions, truncate at second '.'
+ std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0);
+ std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos;
+ std::string simple = mOSStringSimple.substr(0, idx2);
+ if (simple.length() > 0)
+ mOSStringSimple = simple;
+ }
+ }
+ else
+ {
+ mOSStringSimple.append("Unable to collect OS info");
+ mOSString = mOSStringSimple;
+ }
- const char OS_VERSION_MATCH_EXPRESSION[] = "([0-9]+)\\.([0-9]+)(\\.([0-9]+))?";
- boost::regex os_version_parse(OS_VERSION_MATCH_EXPRESSION);
- boost::smatch matched;
+ const char OS_VERSION_MATCH_EXPRESSION[] = "([0-9]+)\\.([0-9]+)(\\.([0-9]+))?";
+ boost::regex os_version_parse(OS_VERSION_MATCH_EXPRESSION);
+ boost::smatch matched;
- std::string glibc_version(gnu_get_libc_version());
- if ( ll_regex_match(glibc_version, matched, os_version_parse) )
- {
- LL_INFOS("AppInit") << "Using glibc version '" << glibc_version << "' as OS version" << LL_ENDL;
-
- std::string version_value;
+ std::string glibc_version(gnu_get_libc_version());
+ if ( ll_regex_match(glibc_version, matched, os_version_parse) )
+ {
+ LL_INFOS("AppInit") << "Using glibc version '" << glibc_version << "' as OS version" << LL_ENDL;
- if ( matched[1].matched ) // Major version
- {
- version_value.assign(matched[1].first, matched[1].second);
- if (sscanf(version_value.c_str(), "%d", &mMajorVer) != 1)
- {
- LL_WARNS("AppInit") << "failed to parse major version '" << version_value << "' as a number" << LL_ENDL;
- }
- }
- else
- {
- LL_ERRS("AppInit")
- << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION
- << "' returned true, but major version [1] did not match"
- << LL_ENDL;
- }
+ std::string version_value;
- if ( matched[2].matched ) // Minor version
- {
- version_value.assign(matched[2].first, matched[2].second);
- if (sscanf(version_value.c_str(), "%d", &mMinorVer) != 1)
- {
- LL_ERRS("AppInit") << "failed to parse minor version '" << version_value << "' as a number" << LL_ENDL;
- }
- }
- else
- {
- LL_ERRS("AppInit")
- << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION
- << "' returned true, but minor version [1] did not match"
- << LL_ENDL;
- }
+ if ( matched[1].matched ) // Major version
+ {
+ version_value.assign(matched[1].first, matched[1].second);
+ if (sscanf(version_value.c_str(), "%d", &mMajorVer) != 1)
+ {
+ LL_WARNS("AppInit") << "failed to parse major version '" << version_value << "' as a number" << LL_ENDL;
+ }
+ }
+ else
+ {
+ LL_ERRS("AppInit")
+ << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION
+ << "' returned true, but major version [1] did not match"
+ << LL_ENDL;
+ }
- if ( matched[4].matched ) // Build version (optional) - note that [3] includes the '.'
- {
- version_value.assign(matched[4].first, matched[4].second);
- if (sscanf(version_value.c_str(), "%d", &mBuild) != 1)
- {
- LL_ERRS("AppInit") << "failed to parse build version '" << version_value << "' as a number" << LL_ENDL;
- }
- }
- else
- {
- LL_INFOS("AppInit")
- << "OS build version not provided; using zero"
- << LL_ENDL;
- }
- }
- else
- {
- LL_WARNS("AppInit") << "glibc version '" << glibc_version << "' cannot be parsed to three numbers; using all zeros" << LL_ENDL;
- }
+ if ( matched[2].matched ) // Minor version
+ {
+ version_value.assign(matched[2].first, matched[2].second);
+ if (sscanf(version_value.c_str(), "%d", &mMinorVer) != 1)
+ {
+ LL_ERRS("AppInit") << "failed to parse minor version '" << version_value << "' as a number" << LL_ENDL;
+ }
+ }
+ else
+ {
+ LL_ERRS("AppInit")
+ << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION
+ << "' returned true, but minor version [1] did not match"
+ << LL_ENDL;
+ }
+
+ if ( matched[4].matched ) // Build version (optional) - note that [3] includes the '.'
+ {
+ version_value.assign(matched[4].first, matched[4].second);
+ if (sscanf(version_value.c_str(), "%d", &mBuild) != 1)
+ {
+ LL_ERRS("AppInit") << "failed to parse build version '" << version_value << "' as a number" << LL_ENDL;
+ }
+ }
+ else
+ {
+ LL_INFOS("AppInit")
+ << "OS build version not provided; using zero"
+ << LL_ENDL;
+ }
+ }
+ else
+ {
+ LL_WARNS("AppInit") << "glibc version '" << glibc_version << "' cannot be parsed to three numbers; using all zeros" << LL_ENDL;
+ }
#else
-
- struct utsname un;
- if(uname(&un) != -1)
- {
- mOSStringSimple.append(un.sysname);
- mOSStringSimple.append(" ");
- mOSStringSimple.append(un.release);
- mOSString = mOSStringSimple;
- mOSString.append(" ");
- mOSString.append(un.version);
- mOSString.append(" ");
- mOSString.append(un.machine);
+ struct utsname un;
+ if(uname(&un) != -1)
+ {
+ mOSStringSimple.append(un.sysname);
+ mOSStringSimple.append(" ");
+ mOSStringSimple.append(un.release);
- // Simplify 'Simple'
- std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0));
- if (ostype == "Linux")
- {
- // Only care about major and minor Linux versions, truncate at second '.'
- std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0);
- std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos;
- std::string simple = mOSStringSimple.substr(0, idx2);
- if (simple.length() > 0)
- mOSStringSimple = simple;
- }
- }
- else
- {
- mOSStringSimple.append("Unable to collect OS info");
- mOSString = mOSStringSimple;
- }
+ mOSString = mOSStringSimple;
+ mOSString.append(" ");
+ mOSString.append(un.version);
+ mOSString.append(" ");
+ mOSString.append(un.machine);
+
+ // Simplify 'Simple'
+ std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0));
+ if (ostype == "Linux")
+ {
+ // Only care about major and minor Linux versions, truncate at second '.'
+ std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0);
+ std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos;
+ std::string simple = mOSStringSimple.substr(0, idx2);
+ if (simple.length() > 0)
+ mOSStringSimple = simple;
+ }
+ }
+ else
+ {
+ mOSStringSimple.append("Unable to collect OS info");
+ mOSString = mOSStringSimple;
+ }
#endif
- std::stringstream dotted_version_string;
- dotted_version_string << mMajorVer << "." << mMinorVer << "." << mBuild;
- mOSVersionString.append(dotted_version_string.str());
+ std::stringstream dotted_version_string;
+ dotted_version_string << mMajorVer << "." << mMinorVer << "." << mBuild;
+ mOSVersionString.append(dotted_version_string.str());
- mOSBitness = is64Bit() ? 64 : 32;
- LL_INFOS("LLOSInfo") << "OS bitness: " << mOSBitness << LL_ENDL;
+ mOSBitness = is64Bit() ? 64 : 32;
+ LL_INFOS("LLOSInfo") << "OS bitness: " << mOSBitness << LL_ENDL;
}
#ifndef LL_WINDOWS
// static
long LLOSInfo::getMaxOpenFiles()
{
- const long OPEN_MAX_GUESS = 256;
+ const long OPEN_MAX_GUESS = 256;
-#ifdef OPEN_MAX
- static long open_max = OPEN_MAX;
+#ifdef OPEN_MAX
+ static long open_max = OPEN_MAX;
#else
- static long open_max = 0;
+ static long open_max = 0;
#endif
- if (0 == open_max)
- {
- // First time through.
- errno = 0;
- if ( (open_max = sysconf(_SC_OPEN_MAX)) < 0)
- {
- if (0 == errno)
- {
- // Indeterminate.
- open_max = OPEN_MAX_GUESS;
- }
- else
- {
- LL_ERRS() << "LLOSInfo::getMaxOpenFiles: sysconf error for _SC_OPEN_MAX" << LL_ENDL;
- }
- }
- }
- return open_max;
+ if (0 == open_max)
+ {
+ // First time through.
+ errno = 0;
+ if ( (open_max = sysconf(_SC_OPEN_MAX)) < 0)
+ {
+ if (0 == errno)
+ {
+ // Indeterminate.
+ open_max = OPEN_MAX_GUESS;
+ }
+ else
+ {
+ LL_ERRS() << "LLOSInfo::getMaxOpenFiles: sysconf error for _SC_OPEN_MAX" << LL_ENDL;
+ }
+ }
+ }
+ return open_max;
}
#endif
void LLOSInfo::stream(std::ostream& s) const
{
- s << mOSString;
+ s << mOSString;
}
const std::string& LLOSInfo::getOSString() const
{
- return mOSString;
+ return mOSString;
}
const std::string& LLOSInfo::getOSStringSimple() const
{
- return mOSStringSimple;
+ return mOSStringSimple;
}
const std::string& LLOSInfo::getOSVersionString() const
{
- return mOSVersionString;
+ return mOSVersionString;
}
const S32 LLOSInfo::getOSBitness() const
{
- return mOSBitness;
+ return mOSBitness;
}
//static
U32 LLOSInfo::getProcessVirtualSizeKB()
{
- U32 virtual_size = 0;
+ U32 virtual_size = 0;
#if LL_LINUX
-# define STATUS_SIZE 2048
- LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb");
- if (status_filep)
- {
- S32 numRead = 0;
- char buff[STATUS_SIZE]; /* Flawfinder: ignore */
+# define STATUS_SIZE 2048
+ LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb");
+ if (status_filep)
+ {
+ S32 numRead = 0;
+ char buff[STATUS_SIZE]; /* Flawfinder: ignore */
- size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep);
- buff[nbytes] = '\0';
+ size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep);
+ buff[nbytes] = '\0';
- // All these guys return numbers in KB
- char *memp = strstr(buff, "VmSize:");
- if (memp)
- {
- numRead += sscanf(memp, "%*s %u", &virtual_size);
- }
- fclose(status_filep);
- }
+ // All these guys return numbers in KB
+ char *memp = strstr(buff, "VmSize:");
+ if (memp)
+ {
+ numRead += sscanf(memp, "%*s %u", &virtual_size);
+ }
+ fclose(status_filep);
+ }
#endif
- return virtual_size;
+ return virtual_size;
}
//static
U32 LLOSInfo::getProcessResidentSizeKB()
{
- U32 resident_size = 0;
+ U32 resident_size = 0;
#if LL_LINUX
- LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb");
- if (status_filep != NULL)
- {
- S32 numRead = 0;
- char buff[STATUS_SIZE]; /* Flawfinder: ignore */
+ LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb");
+ if (status_filep != NULL)
+ {
+ S32 numRead = 0;
+ char buff[STATUS_SIZE]; /* Flawfinder: ignore */
- size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep);
- buff[nbytes] = '\0';
+ size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep);
+ buff[nbytes] = '\0';
- // All these guys return numbers in KB
- char *memp = strstr(buff, "VmRSS:");
- if (memp)
- {
- numRead += sscanf(memp, "%*s %u", &resident_size);
- }
- fclose(status_filep);
- }
+ // All these guys return numbers in KB
+ char *memp = strstr(buff, "VmRSS:");
+ if (memp)
+ {
+ numRead += sscanf(memp, "%*s %u", &resident_size);
+ }
+ fclose(status_filep);
+ }
#endif
- return resident_size;
+ return resident_size;
}
//static
@@ -577,34 +577,34 @@ bool LLOSInfo::is64Bit()
#endif
#else // ! LL_WINDOWS
// we only build a 64-bit mac viewer and currently we don't build for linux at all
- return true;
+ return true;
#endif
}
LLCPUInfo::LLCPUInfo()
{
- std::ostringstream out;
- LLProcessorInfo proc;
- // proc.WriteInfoTextFile("procInfo.txt");
- mHasSSE = proc.hasSSE();
- mHasSSE2 = proc.hasSSE2();
+ std::ostringstream out;
+ LLProcessorInfo proc;
+ // proc.WriteInfoTextFile("procInfo.txt");
+ mHasSSE = proc.hasSSE();
+ mHasSSE2 = proc.hasSSE2();
mHasSSE3 = proc.hasSSE3();
mHasSSE3S = proc.hasSSE3S();
mHasSSE41 = proc.hasSSE41();
mHasSSE42 = proc.hasSSE42();
mHasSSE4a = proc.hasSSE4a();
- mHasAltivec = proc.hasAltivec();
- mCPUMHz = (F64)proc.getCPUFrequency();
- mFamily = proc.getCPUFamilyName();
- mCPUString = "Unknown";
+ mHasAltivec = proc.hasAltivec();
+ mCPUMHz = (F64)proc.getCPUFrequency();
+ mFamily = proc.getCPUFamilyName();
+ mCPUString = "Unknown";
- out << proc.getCPUBrandName();
- if (200 < mCPUMHz && mCPUMHz < 10000) // *NOTE: cpu speed is often way wrong, do a sanity check
- {
- out << " (" << mCPUMHz << " MHz)";
- }
- mCPUString = out.str();
- LLStringUtil::trim(mCPUString);
+ out << proc.getCPUBrandName();
+ if (200 < mCPUMHz && mCPUMHz < 10000) // *NOTE: cpu speed is often way wrong, do a sanity check
+ {
+ out << " (" << mCPUMHz << " MHz)";
+ }
+ mCPUString = out.str();
+ LLStringUtil::trim(mCPUString);
if (mHasSSE)
{
@@ -638,17 +638,17 @@ LLCPUInfo::LLCPUInfo()
bool LLCPUInfo::hasAltivec() const
{
- return mHasAltivec;
+ return mHasAltivec;
}
bool LLCPUInfo::hasSSE() const
{
- return mHasSSE;
+ return mHasSSE;
}
bool LLCPUInfo::hasSSE2() const
{
- return mHasSSE2;
+ return mHasSSE2;
}
bool LLCPUInfo::hasSSE3() const
@@ -678,12 +678,12 @@ bool LLCPUInfo::hasSSE4a() const
F64 LLCPUInfo::getMHz() const
{
- return mCPUMHz;
+ return mCPUMHz;
}
std::string LLCPUInfo::getCPUString() const
{
- return mCPUString;
+ return mCPUString;
}
const LLSD& LLCPUInfo::getSSEVersions() const
@@ -693,21 +693,21 @@ const LLSD& LLCPUInfo::getSSEVersions() const
void LLCPUInfo::stream(std::ostream& s) const
{
- // gather machine information.
- s << LLProcessorInfo().getCPUFeatureDescription();
+ // gather machine information.
+ s << LLProcessorInfo().getCPUFeatureDescription();
- // These are interesting as they reflect our internal view of the
- // CPU's attributes regardless of platform
- s << "->mHasSSE: " << (U32)mHasSSE << std::endl;
- s << "->mHasSSE2: " << (U32)mHasSSE2 << std::endl;
+ // These are interesting as they reflect our internal view of the
+ // CPU's attributes regardless of platform
+ s << "->mHasSSE: " << (U32)mHasSSE << std::endl;
+ s << "->mHasSSE2: " << (U32)mHasSSE2 << std::endl;
s << "->mHasSSE3: " << (U32)mHasSSE3 << std::endl;
s << "->mHasSSE3S: " << (U32)mHasSSE3S << std::endl;
s << "->mHasSSE41: " << (U32)mHasSSE41 << std::endl;
s << "->mHasSSE42: " << (U32)mHasSSE42 << std::endl;
s << "->mHasSSE4a: " << (U32)mHasSSE4a << std::endl;
- s << "->mHasAltivec: " << (U32)mHasAltivec << std::endl;
- s << "->mCPUMHz: " << mCPUMHz << std::endl;
- s << "->mCPUString: " << mCPUString << std::endl;
+ s << "->mHasAltivec: " << (U32)mHasAltivec << std::endl;
+ s << "->mCPUMHz: " << mCPUMHz << std::endl;
+ s << "->mCPUString: " << mCPUString << std::endl;
}
// Helper class for LLMemoryInfo: accumulate stats in the form we store for
@@ -715,58 +715,58 @@ void LLCPUInfo::stream(std::ostream& s) const
class Stats
{
public:
- Stats():
- mStats(LLSD::emptyMap())
- {}
+ Stats():
+ mStats(LLSD::emptyMap())
+ {}
- // Store every integer type as LLSD::Integer.
- template <class T>
- void add(const LLSD::String& name, const T& value,
- typename boost::enable_if<boost::is_integral<T> >::type* = 0)
- {
- mStats[name] = LLSD::Integer(value);
- }
+ // Store every integer type as LLSD::Integer.
+ template <class T>
+ void add(const LLSD::String& name, const T& value,
+ typename boost::enable_if<boost::is_integral<T> >::type* = 0)
+ {
+ mStats[name] = LLSD::Integer(value);
+ }
- // Store every floating-point type as LLSD::Real.
- template <class T>
- void add(const LLSD::String& name, const T& value,
- typename boost::enable_if<boost::is_float<T> >::type* = 0)
- {
- mStats[name] = LLSD::Real(value);
- }
+ // Store every floating-point type as LLSD::Real.
+ template <class T>
+ void add(const LLSD::String& name, const T& value,
+ typename boost::enable_if<boost::is_float<T> >::type* = 0)
+ {
+ mStats[name] = LLSD::Real(value);
+ }
- // Hope that LLSD::Date values are sufficiently unambiguous.
- void add(const LLSD::String& name, const LLSD::Date& value)
- {
- mStats[name] = value;
- }
+ // Hope that LLSD::Date values are sufficiently unambiguous.
+ void add(const LLSD::String& name, const LLSD::Date& value)
+ {
+ mStats[name] = value;
+ }
- LLSD get() const { return mStats; }
+ LLSD get() const { return mStats; }
private:
- LLSD mStats;
+ LLSD mStats;
};
LLMemoryInfo::LLMemoryInfo()
{
- refresh();
+ refresh();
}
#if LL_WINDOWS
static U32Kilobytes LLMemoryAdjustKBResult(U32Kilobytes inKB)
{
- // Moved this here from llfloaterabout.cpp
+ // Moved this here from llfloaterabout.cpp
- //! \bug
- // For some reason, the reported amount of memory is always wrong.
- // The original adjustment assumes it's always off by one meg, however
- // errors of as much as 2520 KB have been observed in the value
- // returned from the GetMemoryStatusEx function. Here we keep the
- // original adjustment from llfoaterabout.cpp until this can be
- // fixed somehow.
- inKB += U32Megabytes(1);
+ //! \bug
+ // For some reason, the reported amount of memory is always wrong.
+ // The original adjustment assumes it's always off by one meg, however
+ // errors of as much as 2520 KB have been observed in the value
+ // returned from the GetMemoryStatusEx function. Here we keep the
+ // original adjustment from llfoaterabout.cpp until this can be
+ // fixed somehow.
+ inKB += U32Megabytes(1);
- return inKB;
+ return inKB;
}
#endif
@@ -788,18 +788,18 @@ U32Kilobytes LLMemoryInfo::getHardwareMemSize()
U32Kilobytes LLMemoryInfo::getPhysicalMemoryKB() const
{
#if LL_WINDOWS
- return LLMemoryAdjustKBResult(U32Kilobytes(mStatsMap["Total Physical KB"].asInteger()));
+ return LLMemoryAdjustKBResult(U32Kilobytes(mStatsMap["Total Physical KB"].asInteger()));
#elif LL_DARWIN
return getHardwareMemSize();
#elif LL_LINUX
- U64 phys = 0;
- phys = (U64)(getpagesize()) * (U64)(get_phys_pages());
- return U64Bytes(phys);
+ U64 phys = 0;
+ phys = (U64)(getpagesize()) * (U64)(get_phys_pages());
+ return U64Bytes(phys);
#else
- return 0;
+ return 0;
#endif
}
@@ -808,373 +808,373 @@ U32Kilobytes LLMemoryInfo::getPhysicalMemoryKB() const
void LLMemoryInfo::getAvailableMemoryKB(U32Kilobytes& avail_physical_mem_kb, U32Kilobytes& avail_virtual_mem_kb)
{
#if LL_WINDOWS
- // Sigh, this shouldn't be a static method, then we wouldn't have to
- // reload this data separately from refresh()
- LLSD statsMap(loadStatsMap());
+ // Sigh, this shouldn't be a static method, then we wouldn't have to
+ // reload this data separately from refresh()
+ LLSD statsMap(loadStatsMap());
- avail_physical_mem_kb = (U32Kilobytes)statsMap["Avail Physical KB"].asInteger();
- avail_virtual_mem_kb = (U32Kilobytes)statsMap["Avail Virtual KB"].asInteger();
+ avail_physical_mem_kb = (U32Kilobytes)statsMap["Avail Physical KB"].asInteger();
+ avail_virtual_mem_kb = (U32Kilobytes)statsMap["Avail Virtual KB"].asInteger();
#elif LL_DARWIN
- // mStatsMap is derived from vm_stat, look for (e.g.) "kb free":
- // $ vm_stat
- // Mach Virtual Memory Statistics: (page size of 4096 bytes)
- // Pages free: 462078.
- // Pages active: 142010.
- // Pages inactive: 220007.
- // Pages wired down: 159552.
- // "Translation faults": 220825184.
- // Pages copy-on-write: 2104153.
- // Pages zero filled: 167034876.
- // Pages reactivated: 65153.
- // Pageins: 2097212.
- // Pageouts: 41759.
- // Object cache: 841598 hits of 7629869 lookups (11% hit rate)
- avail_physical_mem_kb = (U32Kilobytes)-1 ;
- avail_virtual_mem_kb = (U32Kilobytes)-1 ;
+ // mStatsMap is derived from vm_stat, look for (e.g.) "kb free":
+ // $ vm_stat
+ // Mach Virtual Memory Statistics: (page size of 4096 bytes)
+ // Pages free: 462078.
+ // Pages active: 142010.
+ // Pages inactive: 220007.
+ // Pages wired down: 159552.
+ // "Translation faults": 220825184.
+ // Pages copy-on-write: 2104153.
+ // Pages zero filled: 167034876.
+ // Pages reactivated: 65153.
+ // Pageins: 2097212.
+ // Pageouts: 41759.
+ // Object cache: 841598 hits of 7629869 lookups (11% hit rate)
+ avail_physical_mem_kb = (U32Kilobytes)-1 ;
+ avail_virtual_mem_kb = (U32Kilobytes)-1 ;
#elif LL_LINUX
- // mStatsMap is derived from MEMINFO_FILE:
- // $ cat /proc/meminfo
- // MemTotal: 4108424 kB
- // MemFree: 1244064 kB
- // Buffers: 85164 kB
- // Cached: 1990264 kB
- // SwapCached: 0 kB
- // Active: 1176648 kB
- // Inactive: 1427532 kB
- // Active(anon): 529152 kB
- // Inactive(anon): 15924 kB
- // Active(file): 647496 kB
- // Inactive(file): 1411608 kB
- // Unevictable: 16 kB
- // Mlocked: 16 kB
- // HighTotal: 3266316 kB
- // HighFree: 721308 kB
- // LowTotal: 842108 kB
- // LowFree: 522756 kB
- // SwapTotal: 6384632 kB
- // SwapFree: 6384632 kB
- // Dirty: 28 kB
- // Writeback: 0 kB
- // AnonPages: 528820 kB
- // Mapped: 89472 kB
- // Shmem: 16324 kB
- // Slab: 159624 kB
- // SReclaimable: 145168 kB
- // SUnreclaim: 14456 kB
- // KernelStack: 2560 kB
- // PageTables: 5560 kB
- // NFS_Unstable: 0 kB
- // Bounce: 0 kB
- // WritebackTmp: 0 kB
- // CommitLimit: 8438844 kB
- // Committed_AS: 1271596 kB
- // VmallocTotal: 122880 kB
- // VmallocUsed: 65252 kB
- // VmallocChunk: 52356 kB
- // HardwareCorrupted: 0 kB
- // HugePages_Total: 0
- // HugePages_Free: 0
- // HugePages_Rsvd: 0
- // HugePages_Surp: 0
- // Hugepagesize: 2048 kB
- // DirectMap4k: 434168 kB
- // DirectMap2M: 477184 kB
- // (could also run 'free', but easier to read a file than run a program)
- avail_physical_mem_kb = (U32Kilobytes)-1 ;
- avail_virtual_mem_kb = (U32Kilobytes)-1 ;
+ // mStatsMap is derived from MEMINFO_FILE:
+ // $ cat /proc/meminfo
+ // MemTotal: 4108424 kB
+ // MemFree: 1244064 kB
+ // Buffers: 85164 kB
+ // Cached: 1990264 kB
+ // SwapCached: 0 kB
+ // Active: 1176648 kB
+ // Inactive: 1427532 kB
+ // Active(anon): 529152 kB
+ // Inactive(anon): 15924 kB
+ // Active(file): 647496 kB
+ // Inactive(file): 1411608 kB
+ // Unevictable: 16 kB
+ // Mlocked: 16 kB
+ // HighTotal: 3266316 kB
+ // HighFree: 721308 kB
+ // LowTotal: 842108 kB
+ // LowFree: 522756 kB
+ // SwapTotal: 6384632 kB
+ // SwapFree: 6384632 kB
+ // Dirty: 28 kB
+ // Writeback: 0 kB
+ // AnonPages: 528820 kB
+ // Mapped: 89472 kB
+ // Shmem: 16324 kB
+ // Slab: 159624 kB
+ // SReclaimable: 145168 kB
+ // SUnreclaim: 14456 kB
+ // KernelStack: 2560 kB
+ // PageTables: 5560 kB
+ // NFS_Unstable: 0 kB
+ // Bounce: 0 kB
+ // WritebackTmp: 0 kB
+ // CommitLimit: 8438844 kB
+ // Committed_AS: 1271596 kB
+ // VmallocTotal: 122880 kB
+ // VmallocUsed: 65252 kB
+ // VmallocChunk: 52356 kB
+ // HardwareCorrupted: 0 kB
+ // HugePages_Total: 0
+ // HugePages_Free: 0
+ // HugePages_Rsvd: 0
+ // HugePages_Surp: 0
+ // Hugepagesize: 2048 kB
+ // DirectMap4k: 434168 kB
+ // DirectMap2M: 477184 kB
+ // (could also run 'free', but easier to read a file than run a program)
+ avail_physical_mem_kb = (U32Kilobytes)-1 ;
+ avail_virtual_mem_kb = (U32Kilobytes)-1 ;
#else
- //do not know how to collect available memory info for other systems.
- //leave it blank here for now.
+ //do not know how to collect available memory info for other systems.
+ //leave it blank here for now.
- avail_physical_mem_kb = (U32Kilobytes)-1 ;
- avail_virtual_mem_kb = (U32Kilobytes)-1 ;
+ avail_physical_mem_kb = (U32Kilobytes)-1 ;
+ avail_virtual_mem_kb = (U32Kilobytes)-1 ;
#endif
}
void LLMemoryInfo::stream(std::ostream& s) const
{
- // We want these memory stats to be easy to grep from the log, along with
- // the timestamp. So preface each line with the timestamp and a
- // distinctive marker. Without that, we'd have to search the log for the
- // introducer line, then read subsequent lines, etc...
- std::string pfx(LLError::utcTime() + " <mem> ");
+ // We want these memory stats to be easy to grep from the log, along with
+ // the timestamp. So preface each line with the timestamp and a
+ // distinctive marker. Without that, we'd have to search the log for the
+ // introducer line, then read subsequent lines, etc...
+ std::string pfx(LLError::utcTime() + " <mem> ");
- // Max key length
- size_t key_width(0);
- for (const auto& [key, value] : inMap(mStatsMap))
- {
- size_t len(key.length());
- if (len > key_width)
- {
- key_width = len;
- }
- }
+ // Max key length
+ size_t key_width(0);
+ for (const auto& [key, value] : inMap(mStatsMap))
+ {
+ size_t len(key.length());
+ if (len > key_width)
+ {
+ key_width = len;
+ }
+ }
- // Now stream stats
- for (const auto& [key, value] : inMap(mStatsMap))
- {
- s << pfx << std::setw(narrow<size_t>(key_width+1)) << (key + ':') << ' ';
- if (value.isInteger())
- s << std::setw(12) << value.asInteger();
- else if (value.isReal())
- s << std::fixed << std::setprecision(1) << value.asReal();
- else if (value.isDate())
- value.asDate().toStream(s);
- else
- s << value; // just use default LLSD formatting
- s << std::endl;
- }
+ // Now stream stats
+ for (const auto& [key, value] : inMap(mStatsMap))
+ {
+ s << pfx << std::setw(narrow<size_t>(key_width+1)) << (key + ':') << ' ';
+ if (value.isInteger())
+ s << std::setw(12) << value.asInteger();
+ else if (value.isReal())
+ s << std::fixed << std::setprecision(1) << value.asReal();
+ else if (value.isDate())
+ value.asDate().toStream(s);
+ else
+ s << value; // just use default LLSD formatting
+ s << std::endl;
+ }
}
LLSD LLMemoryInfo::getStatsMap() const
{
- return mStatsMap;
+ return mStatsMap;
}
LLMemoryInfo& LLMemoryInfo::refresh()
{
- LL_PROFILE_ZONE_SCOPED
- mStatsMap = loadStatsMap();
+ LL_PROFILE_ZONE_SCOPED
+ mStatsMap = loadStatsMap();
- LL_DEBUGS("LLMemoryInfo") << "Populated mStatsMap:\n";
- LLSDSerialize::toPrettyXML(mStatsMap, LL_CONT);
- LL_ENDL;
+ LL_DEBUGS("LLMemoryInfo") << "Populated mStatsMap:\n";
+ LLSDSerialize::toPrettyXML(mStatsMap, LL_CONT);
+ LL_ENDL;
- return *this;
+ return *this;
}
LLSD LLMemoryInfo::loadStatsMap()
{
LL_PROFILE_ZONE_SCOPED;
- // This implementation is derived from stream() code (as of 2011-06-29).
- Stats stats;
+ // This implementation is derived from stream() code (as of 2011-06-29).
+ Stats stats;
- // associate timestamp for analysis over time
- stats.add("timestamp", LLDate::now());
+ // associate timestamp for analysis over time
+ stats.add("timestamp", LLDate::now());
#if LL_WINDOWS
- MEMORYSTATUSEX state;
- state.dwLength = sizeof(state);
- GlobalMemoryStatusEx(&state);
+ MEMORYSTATUSEX state;
+ state.dwLength = sizeof(state);
+ GlobalMemoryStatusEx(&state);
- DWORDLONG div = 1024;
+ DWORDLONG div = 1024;
- stats.add("Percent Memory use", state.dwMemoryLoad/div);
- stats.add("Total Physical KB", state.ullTotalPhys/div);
- stats.add("Avail Physical KB", state.ullAvailPhys/div);
- stats.add("Total page KB", state.ullTotalPageFile/div);
- stats.add("Avail page KB", state.ullAvailPageFile/div);
- stats.add("Total Virtual KB", state.ullTotalVirtual/div);
- stats.add("Avail Virtual KB", state.ullAvailVirtual/div);
+ stats.add("Percent Memory use", state.dwMemoryLoad/div);
+ stats.add("Total Physical KB", state.ullTotalPhys/div);
+ stats.add("Avail Physical KB", state.ullAvailPhys/div);
+ stats.add("Total page KB", state.ullTotalPageFile/div);
+ stats.add("Avail page KB", state.ullAvailPageFile/div);
+ stats.add("Total Virtual KB", state.ullTotalVirtual/div);
+ stats.add("Avail Virtual KB", state.ullAvailVirtual/div);
- // SL-12122 - Call to GetPerformanceInfo() was removed here. Took
- // on order of 10 ms, causing unacceptable frame time spike every
- // second, and results were never used. If this is needed in the
- // future, must find a way to avoid frame time impact (e.g. move
- // to another thread, call much less often).
+ // SL-12122 - Call to GetPerformanceInfo() was removed here. Took
+ // on order of 10 ms, causing unacceptable frame time spike every
+ // second, and results were never used. If this is needed in the
+ // future, must find a way to avoid frame time impact (e.g. move
+ // to another thread, call much less often).
- PROCESS_MEMORY_COUNTERS_EX pmem;
- pmem.cb = sizeof(pmem);
- // GetProcessMemoryInfo() is documented to accept either
- // PROCESS_MEMORY_COUNTERS* or PROCESS_MEMORY_COUNTERS_EX*, presumably
- // using the redundant size info to distinguish. But its prototype
- // specifically accepts PROCESS_MEMORY_COUNTERS*, and since this is a
- // classic-C API, PROCESS_MEMORY_COUNTERS_EX isn't a subclass. Cast the
- // pointer.
- GetProcessMemoryInfo(GetCurrentProcess(), PPROCESS_MEMORY_COUNTERS(&pmem), sizeof(pmem));
+ PROCESS_MEMORY_COUNTERS_EX pmem;
+ pmem.cb = sizeof(pmem);
+ // GetProcessMemoryInfo() is documented to accept either
+ // PROCESS_MEMORY_COUNTERS* or PROCESS_MEMORY_COUNTERS_EX*, presumably
+ // using the redundant size info to distinguish. But its prototype
+ // specifically accepts PROCESS_MEMORY_COUNTERS*, and since this is a
+ // classic-C API, PROCESS_MEMORY_COUNTERS_EX isn't a subclass. Cast the
+ // pointer.
+ GetProcessMemoryInfo(GetCurrentProcess(), PPROCESS_MEMORY_COUNTERS(&pmem), sizeof(pmem));
- stats.add("Page Fault Count", pmem.PageFaultCount);
- stats.add("PeakWorkingSetSize KB", pmem.PeakWorkingSetSize/div);
- stats.add("WorkingSetSize KB", pmem.WorkingSetSize/div);
- stats.add("QutaPeakPagedPoolUsage KB", pmem.QuotaPeakPagedPoolUsage/div);
- stats.add("QuotaPagedPoolUsage KB", pmem.QuotaPagedPoolUsage/div);
- stats.add("QuotaPeakNonPagedPoolUsage KB", pmem.QuotaPeakNonPagedPoolUsage/div);
- stats.add("QuotaNonPagedPoolUsage KB", pmem.QuotaNonPagedPoolUsage/div);
- stats.add("PagefileUsage KB", pmem.PagefileUsage/div);
- stats.add("PeakPagefileUsage KB", pmem.PeakPagefileUsage/div);
- stats.add("PrivateUsage KB", pmem.PrivateUsage/div);
+ stats.add("Page Fault Count", pmem.PageFaultCount);
+ stats.add("PeakWorkingSetSize KB", pmem.PeakWorkingSetSize/div);
+ stats.add("WorkingSetSize KB", pmem.WorkingSetSize/div);
+ stats.add("QutaPeakPagedPoolUsage KB", pmem.QuotaPeakPagedPoolUsage/div);
+ stats.add("QuotaPagedPoolUsage KB", pmem.QuotaPagedPoolUsage/div);
+ stats.add("QuotaPeakNonPagedPoolUsage KB", pmem.QuotaPeakNonPagedPoolUsage/div);
+ stats.add("QuotaNonPagedPoolUsage KB", pmem.QuotaNonPagedPoolUsage/div);
+ stats.add("PagefileUsage KB", pmem.PagefileUsage/div);
+ stats.add("PeakPagefileUsage KB", pmem.PeakPagefileUsage/div);
+ stats.add("PrivateUsage KB", pmem.PrivateUsage/div);
#elif LL_DARWIN
- const vm_size_t pagekb(vm_page_size / 1024);
-
- //
- // Collect the vm_stat's
- //
-
- {
- vm_statistics64_data_t vmstat;
- mach_msg_type_number_t vmstatCount = HOST_VM_INFO64_COUNT;
+ const vm_size_t pagekb(vm_page_size / 1024);
+
+ //
+ // Collect the vm_stat's
+ //
+
+ {
+ vm_statistics64_data_t vmstat;
+ mach_msg_type_number_t vmstatCount = HOST_VM_INFO64_COUNT;
+
+ if (host_statistics64(mach_host_self(), HOST_VM_INFO64, (host_info64_t) &vmstat, &vmstatCount) != KERN_SUCCESS)
+ {
+ LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL;
+ }
+ else
+ {
+ stats.add("Pages free KB", pagekb * vmstat.free_count);
+ stats.add("Pages active KB", pagekb * vmstat.active_count);
+ stats.add("Pages inactive KB", pagekb * vmstat.inactive_count);
+ stats.add("Pages wired KB", pagekb * vmstat.wire_count);
+
+ stats.add("Pages zero fill", vmstat.zero_fill_count);
+ stats.add("Page reactivations", vmstat.reactivations);
+ stats.add("Page-ins", vmstat.pageins);
+ stats.add("Page-outs", vmstat.pageouts);
+
+ stats.add("Faults", vmstat.faults);
+ stats.add("Faults copy-on-write", vmstat.cow_faults);
+
+ stats.add("Cache lookups", vmstat.lookups);
+ stats.add("Cache hits", vmstat.hits);
- if (host_statistics64(mach_host_self(), HOST_VM_INFO64, (host_info64_t) &vmstat, &vmstatCount) != KERN_SUCCESS)
- {
- LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL;
- }
- else
- {
- stats.add("Pages free KB", pagekb * vmstat.free_count);
- stats.add("Pages active KB", pagekb * vmstat.active_count);
- stats.add("Pages inactive KB", pagekb * vmstat.inactive_count);
- stats.add("Pages wired KB", pagekb * vmstat.wire_count);
+ stats.add("Page purgeable count", vmstat.purgeable_count);
+ stats.add("Page purges", vmstat.purges);
- stats.add("Pages zero fill", vmstat.zero_fill_count);
- stats.add("Page reactivations", vmstat.reactivations);
- stats.add("Page-ins", vmstat.pageins);
- stats.add("Page-outs", vmstat.pageouts);
-
- stats.add("Faults", vmstat.faults);
- stats.add("Faults copy-on-write", vmstat.cow_faults);
-
- stats.add("Cache lookups", vmstat.lookups);
- stats.add("Cache hits", vmstat.hits);
-
- stats.add("Page purgeable count", vmstat.purgeable_count);
- stats.add("Page purges", vmstat.purges);
-
- stats.add("Page speculative reads", vmstat.speculative_count);
- }
- }
+ stats.add("Page speculative reads", vmstat.speculative_count);
+ }
+ }
+
+ //
+ // Collect the misc task info
+ //
- //
- // Collect the misc task info
- //
+ {
+ task_events_info_data_t taskinfo;
+ unsigned taskinfoSize = sizeof(taskinfo);
+
+ if (task_info(mach_task_self(), TASK_EVENTS_INFO, (task_info_t) &taskinfo, &taskinfoSize) != KERN_SUCCESS)
+ {
+ LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL;
+ }
+ else
+ {
+ stats.add("Task page-ins", taskinfo.pageins);
+ stats.add("Task copy-on-write faults", taskinfo.cow_faults);
+ stats.add("Task messages sent", taskinfo.messages_sent);
+ stats.add("Task messages received", taskinfo.messages_received);
+ stats.add("Task mach system call count", taskinfo.syscalls_mach);
+ stats.add("Task unix system call count", taskinfo.syscalls_unix);
+ stats.add("Task context switch count", taskinfo.csw);
+ }
+ }
- {
- task_events_info_data_t taskinfo;
- unsigned taskinfoSize = sizeof(taskinfo);
-
- if (task_info(mach_task_self(), TASK_EVENTS_INFO, (task_info_t) &taskinfo, &taskinfoSize) != KERN_SUCCESS)
- {
- LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL;
- }
- else
- {
- stats.add("Task page-ins", taskinfo.pageins);
- stats.add("Task copy-on-write faults", taskinfo.cow_faults);
- stats.add("Task messages sent", taskinfo.messages_sent);
- stats.add("Task messages received", taskinfo.messages_received);
- stats.add("Task mach system call count", taskinfo.syscalls_mach);
- stats.add("Task unix system call count", taskinfo.syscalls_unix);
- stats.add("Task context switch count", taskinfo.csw);
- }
- }
-
- //
- // Collect the basic task info
- //
+ //
+ // Collect the basic task info
+ //
- {
- mach_task_basic_info_data_t taskinfo;
- mach_msg_type_number_t task_count = MACH_TASK_BASIC_INFO_COUNT;
- if (task_info(mach_task_self(), MACH_TASK_BASIC_INFO, (task_info_t) &taskinfo, &task_count) != KERN_SUCCESS)
- {
- LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL;
- }
- else
- {
- stats.add("Basic virtual memory KB", taskinfo.virtual_size / 1024);
- stats.add("Basic resident memory KB", taskinfo.resident_size / 1024);
- stats.add("Basic max resident memory KB", taskinfo.resident_size_max / 1024);
- stats.add("Basic new thread policy", taskinfo.policy);
- stats.add("Basic suspend count", taskinfo.suspend_count);
- }
- }
+ {
+ mach_task_basic_info_data_t taskinfo;
+ mach_msg_type_number_t task_count = MACH_TASK_BASIC_INFO_COUNT;
+ if (task_info(mach_task_self(), MACH_TASK_BASIC_INFO, (task_info_t) &taskinfo, &task_count) != KERN_SUCCESS)
+ {
+ LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL;
+ }
+ else
+ {
+ stats.add("Basic virtual memory KB", taskinfo.virtual_size / 1024);
+ stats.add("Basic resident memory KB", taskinfo.resident_size / 1024);
+ stats.add("Basic max resident memory KB", taskinfo.resident_size_max / 1024);
+ stats.add("Basic new thread policy", taskinfo.policy);
+ stats.add("Basic suspend count", taskinfo.suspend_count);
+ }
+ }
#elif LL_LINUX
- std::ifstream meminfo(MEMINFO_FILE);
- if (meminfo.is_open())
- {
- // MemTotal: 4108424 kB
- // MemFree: 1244064 kB
- // Buffers: 85164 kB
- // Cached: 1990264 kB
- // SwapCached: 0 kB
- // Active: 1176648 kB
- // Inactive: 1427532 kB
- // ...
- // VmallocTotal: 122880 kB
- // VmallocUsed: 65252 kB
- // VmallocChunk: 52356 kB
- // HardwareCorrupted: 0 kB
- // HugePages_Total: 0
- // HugePages_Free: 0
- // HugePages_Rsvd: 0
- // HugePages_Surp: 0
- // Hugepagesize: 2048 kB
- // DirectMap4k: 434168 kB
- // DirectMap2M: 477184 kB
+ std::ifstream meminfo(MEMINFO_FILE);
+ if (meminfo.is_open())
+ {
+ // MemTotal: 4108424 kB
+ // MemFree: 1244064 kB
+ // Buffers: 85164 kB
+ // Cached: 1990264 kB
+ // SwapCached: 0 kB
+ // Active: 1176648 kB
+ // Inactive: 1427532 kB
+ // ...
+ // VmallocTotal: 122880 kB
+ // VmallocUsed: 65252 kB
+ // VmallocChunk: 52356 kB
+ // HardwareCorrupted: 0 kB
+ // HugePages_Total: 0
+ // HugePages_Free: 0
+ // HugePages_Rsvd: 0
+ // HugePages_Surp: 0
+ // Hugepagesize: 2048 kB
+ // DirectMap4k: 434168 kB
+ // DirectMap2M: 477184 kB
- // Intentionally don't pass the boost::no_except flag. This
- // boost::regex object is constructed with a string literal, so it
- // should be valid every time. If it becomes invalid, we WANT an
- // exception, hopefully even before the dev checks in.
- boost::regex stat_rx("(.+): +([0-9]+)( kB)?");
- boost::smatch matched;
+ // Intentionally don't pass the boost::no_except flag. This
+ // boost::regex object is constructed with a string literal, so it
+ // should be valid every time. If it becomes invalid, we WANT an
+ // exception, hopefully even before the dev checks in.
+ boost::regex stat_rx("(.+): +([0-9]+)( kB)?");
+ boost::smatch matched;
- std::string line;
- while (std::getline(meminfo, line))
- {
- LL_DEBUGS("LLMemoryInfo") << line << LL_ENDL;
- if (ll_regex_match(line, matched, stat_rx))
- {
- // e.g. "MemTotal: 4108424 kB"
- LLSD::String key(matched[1].first, matched[1].second);
- LLSD::String value_str(matched[2].first, matched[2].second);
- LLSD::Integer value(0);
- try
- {
- value = boost::lexical_cast<LLSD::Integer>(value_str);
- }
- catch (const boost::bad_lexical_cast&)
- {
- LL_WARNS("LLMemoryInfo") << "couldn't parse '" << value_str
- << "' in " << MEMINFO_FILE << " line: "
- << line << LL_ENDL;
- continue;
- }
- // Store this statistic.
- stats.add(key, value);
- }
- else
- {
- LL_WARNS("LLMemoryInfo") << "unrecognized " << MEMINFO_FILE << " line: "
- << line << LL_ENDL;
- }
- }
- }
- else
- {
- LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL;
- }
+ std::string line;
+ while (std::getline(meminfo, line))
+ {
+ LL_DEBUGS("LLMemoryInfo") << line << LL_ENDL;
+ if (ll_regex_match(line, matched, stat_rx))
+ {
+ // e.g. "MemTotal: 4108424 kB"
+ LLSD::String key(matched[1].first, matched[1].second);
+ LLSD::String value_str(matched[2].first, matched[2].second);
+ LLSD::Integer value(0);
+ try
+ {
+ value = boost::lexical_cast<LLSD::Integer>(value_str);
+ }
+ catch (const boost::bad_lexical_cast&)
+ {
+ LL_WARNS("LLMemoryInfo") << "couldn't parse '" << value_str
+ << "' in " << MEMINFO_FILE << " line: "
+ << line << LL_ENDL;
+ continue;
+ }
+ // Store this statistic.
+ stats.add(key, value);
+ }
+ else
+ {
+ LL_WARNS("LLMemoryInfo") << "unrecognized " << MEMINFO_FILE << " line: "
+ << line << LL_ENDL;
+ }
+ }
+ }
+ else
+ {
+ LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL;
+ }
#else
- LL_WARNS("LLMemoryInfo") << "Unknown system; unable to collect memory information" << LL_ENDL;
+ LL_WARNS("LLMemoryInfo") << "Unknown system; unable to collect memory information" << LL_ENDL;
#endif
- return stats.get();
+ return stats.get();
}
std::ostream& operator<<(std::ostream& s, const LLOSInfo& info)
{
- info.stream(s);
- return s;
+ info.stream(s);
+ return s;
}
std::ostream& operator<<(std::ostream& s, const LLCPUInfo& info)
{
- info.stream(s);
- return s;
+ info.stream(s);
+ return s;
}
std::ostream& operator<<(std::ostream& s, const LLMemoryInfo& info)
{
- info.stream(s);
- return s;
+ info.stream(s);
+ return s;
}
class FrameWatcher
@@ -1286,13 +1286,13 @@ public:
<< " seconds ";
}
- auto precision = LL_CONT.precision();
+ auto precision = LL_CONT.precision();
LL_CONT << std::fixed << std::setprecision(1) << framerate << '\n'
<< LLMemoryInfo();
- LL_CONT.precision(precision);
- LL_CONT << LL_ENDL;
+ LL_CONT.precision(precision);
+ LL_CONT << LL_ENDL;
return false;
}
@@ -1321,53 +1321,57 @@ static FrameWatcher sFrameWatcher;
BOOL gunzip_file(const std::string& srcfile, const std::string& dstfile)
{
- std::string tmpfile;
- const S32 UNCOMPRESS_BUFFER_SIZE = 32768;
- BOOL retval = FALSE;
- gzFile src = NULL;
- U8 buffer[UNCOMPRESS_BUFFER_SIZE];
- LLFILE *dst = NULL;
- S32 bytes = 0;
- tmpfile = dstfile + ".t";
+ std::string tmpfile;
+ const S32 UNCOMPRESS_BUFFER_SIZE = 32768;
+ BOOL retval = FALSE;
+ gzFile src = NULL;
+ U8 buffer[UNCOMPRESS_BUFFER_SIZE];
+ LLFILE *dst = NULL;
+ S32 bytes = 0;
+ tmpfile = dstfile + ".t";
#ifdef LL_WINDOWS
llutf16string utf16filename = utf8str_to_utf16str(srcfile);
src = gzopen_w(utf16filename.c_str(), "rb");
#else
src = gzopen(srcfile.c_str(), "rb");
#endif
- if (! src) goto err;
- dst = LLFile::fopen(tmpfile, "wb"); /* Flawfinder: ignore */
- if (! dst) goto err;
- do
- {
- bytes = gzread(src, buffer, UNCOMPRESS_BUFFER_SIZE);
- size_t nwrit = fwrite(buffer, sizeof(U8), bytes, dst);
- if (nwrit < (size_t) bytes)
- {
- LL_WARNS() << "Short write on " << tmpfile << ": Wrote " << nwrit << " of " << bytes << " bytes." << LL_ENDL;
- goto err;
- }
- } while(gzeof(src) == 0);
- fclose(dst);
- dst = NULL;
- if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */
- retval = TRUE;
+ if (! src) goto err;
+ dst = LLFile::fopen(tmpfile, "wb"); /* Flawfinder: ignore */
+ if (! dst) goto err;
+ do
+ {
+ bytes = gzread(src, buffer, UNCOMPRESS_BUFFER_SIZE);
+ size_t nwrit = fwrite(buffer, sizeof(U8), bytes, dst);
+ if (nwrit < (size_t) bytes)
+ {
+ LL_WARNS() << "Short write on " << tmpfile << ": Wrote " << nwrit << " of " << bytes << " bytes." << LL_ENDL;
+ goto err;
+ }
+ } while(gzeof(src) == 0);
+ fclose(dst);
+ dst = NULL;
+#if LL_WINDOWS
+ // Rename in windows needs the dstfile to not exist.
+ LLFile::remove(dstfile, ENOENT);
+#endif
+ if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */
+ retval = TRUE;
err:
- if (src != NULL) gzclose(src);
- if (dst != NULL) fclose(dst);
- return retval;
+ if (src != NULL) gzclose(src);
+ if (dst != NULL) fclose(dst);
+ return retval;
}
BOOL gzip_file(const std::string& srcfile, const std::string& dstfile)
{
- const S32 COMPRESS_BUFFER_SIZE = 32768;
- std::string tmpfile;
- BOOL retval = FALSE;
- U8 buffer[COMPRESS_BUFFER_SIZE];
- gzFile dst = NULL;
- LLFILE *src = NULL;
- S32 bytes = 0;
- tmpfile = dstfile + ".t";
+ const S32 COMPRESS_BUFFER_SIZE = 32768;
+ std::string tmpfile;
+ BOOL retval = FALSE;
+ U8 buffer[COMPRESS_BUFFER_SIZE];
+ gzFile dst = NULL;
+ LLFILE *src = NULL;
+ S32 bytes = 0;
+ tmpfile = dstfile + ".t";
#ifdef LL_WINDOWS
llutf16string utf16filename = utf8str_to_utf16str(tmpfile);
@@ -1376,35 +1380,35 @@ BOOL gzip_file(const std::string& srcfile, const std::string& dstfile)
dst = gzopen(tmpfile.c_str(), "wb");
#endif
- if (! dst) goto err;
- src = LLFile::fopen(srcfile, "rb"); /* Flawfinder: ignore */
- if (! src) goto err;
+ if (! dst) goto err;
+ src = LLFile::fopen(srcfile, "rb"); /* Flawfinder: ignore */
+ if (! src) goto err;
- while ((bytes = (S32)fread(buffer, sizeof(U8), COMPRESS_BUFFER_SIZE, src)) > 0)
- {
- if (gzwrite(dst, buffer, bytes) <= 0)
- {
- LL_WARNS() << "gzwrite failed: " << gzerror(dst, NULL) << LL_ENDL;
- goto err;
- }
- }
+ while ((bytes = (S32)fread(buffer, sizeof(U8), COMPRESS_BUFFER_SIZE, src)) > 0)
+ {
+ if (gzwrite(dst, buffer, bytes) <= 0)
+ {
+ LL_WARNS() << "gzwrite failed: " << gzerror(dst, NULL) << LL_ENDL;
+ goto err;
+ }
+ }
- if (ferror(src))
- {
- LL_WARNS() << "Error reading " << srcfile << LL_ENDL;
- goto err;
- }
+ if (ferror(src))
+ {
+ LL_WARNS() << "Error reading " << srcfile << LL_ENDL;
+ goto err;
+ }
- gzclose(dst);
- dst = NULL;
+ gzclose(dst);
+ dst = NULL;
#if LL_WINDOWS
- // Rename in windows needs the dstfile to not exist.
- LLFile::remove(dstfile);
+ // Rename in windows needs the dstfile to not exist.
+ LLFile::remove(dstfile);
#endif
- if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */
- retval = TRUE;
+ if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */
+ retval = TRUE;
err:
- if (src != NULL) fclose(src);
- if (dst != NULL) gzclose(dst);
- return retval;
+ if (src != NULL) fclose(src);
+ if (dst != NULL) gzclose(dst);
+ return retval;
}