summaryrefslogtreecommitdiff
path: root/indra/llcommon/llsys.cpp
diff options
context:
space:
mode:
authorAnsariel <ansariel.hiller@phoenixviewer.com>2024-05-22 21:25:21 +0200
committerAndrey Lihatskiy <alihatskiy@productengine.com>2024-05-22 22:40:26 +0300
commite2e37cced861b98de8c1a7c9c0d3a50d2d90e433 (patch)
tree1bb897489ce524986f6196201c10ac0d8861aa5f /indra/llcommon/llsys.cpp
parent069ea06848f766466f1a281144c82a0f2bd79f3a (diff)
Fix line endlings
Diffstat (limited to 'indra/llcommon/llsys.cpp')
-rw-r--r--indra/llcommon/llsys.cpp2828
1 files changed, 1414 insertions, 1414 deletions
diff --git a/indra/llcommon/llsys.cpp b/indra/llcommon/llsys.cpp
index 02fd0733e5..496ec0d869 100644
--- a/indra/llcommon/llsys.cpp
+++ b/indra/llcommon/llsys.cpp
@@ -1,1414 +1,1414 @@
-/**
- * @file llsys.cpp
- * @brief Implementation of the basic system query functions.
- *
- * $LicenseInfo:firstyear=2002&license=viewerlgpl$
- * Second Life Viewer Source Code
- * Copyright (C) 2010, Linden Research, Inc.
- *
- * This library is free software; you can redistribute it and/or
- * modify it under the terms of the GNU Lesser General Public
- * License as published by the Free Software Foundation;
- * version 2.1 of the License only.
- *
- * This library is distributed in the hope that it will be useful,
- * but WITHOUT ANY WARRANTY; without even the implied warranty of
- * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
- * Lesser General Public License for more details.
- *
- * You should have received a copy of the GNU Lesser General Public
- * License along with this library; if not, write to the Free Software
- * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
- *
- * Linden Research, Inc., 945 Battery Street, San Francisco, CA 94111 USA
- * $/LicenseInfo$
- */
-
-#if LL_WINDOWS
-#pragma warning (disable : 4355) // 'this' used in initializer list: yes, intentionally
-#endif
-
-#include "linden_common.h"
-
-#include "llsys.h"
-
-#include <iostream>
-#ifdef LL_USESYSTEMLIBS
-# include <zlib.h>
-#else
-# include "zlib-ng/zlib.h"
-#endif
-
-#include "llprocessor.h"
-#include "llerrorcontrol.h"
-#include "llevents.h"
-#include "llformat.h"
-#include "llregex.h"
-#include "lltimer.h"
-#include "llsdserialize.h"
-#include "llsdutil.h"
-#include <boost/bind.hpp>
-#include <boost/circular_buffer.hpp>
-#include <boost/lexical_cast.hpp>
-#include <boost/range.hpp>
-#include <boost/utility/enable_if.hpp>
-#include <boost/type_traits/is_integral.hpp>
-#include <boost/type_traits/is_float.hpp>
-#include "llfasttimer.h"
-
-using namespace llsd;
-
-#if LL_WINDOWS
-# include "llwin32headerslean.h"
-# include <psapi.h> // GetPerformanceInfo() et al.
-# include <VersionHelpers.h>
-#elif LL_DARWIN
-# include "llsys_objc.h"
-# include <errno.h>
-# include <sys/sysctl.h>
-# include <sys/utsname.h>
-# include <stdint.h>
-# include <CoreServices/CoreServices.h>
-# include <stdexcept>
-# include <mach/host_info.h>
-# include <mach/mach_host.h>
-# include <mach/task.h>
-# include <mach/task_info.h>
-#elif LL_LINUX
-# include <errno.h>
-# include <sys/utsname.h>
-# include <unistd.h>
-# include <sys/sysinfo.h>
-# include <stdexcept>
-const char MEMINFO_FILE[] = "/proc/meminfo";
-# include <gnu/libc-version.h>
-#endif
-
-LLCPUInfo gSysCPU;
-
-// Don't log memory info any more often than this. It also serves as our
-// framerate sample size.
-static const F32 MEM_INFO_THROTTLE = 20;
-// Sliding window of samples. We intentionally limit the length of time we
-// remember "the slowest" framerate because framerate is very slow at login.
-// If we only triggered FrameWatcher logging when the session framerate
-// dropped below the login framerate, we'd have very little additional data.
-static const F32 MEM_INFO_WINDOW = 10*60;
-
-LLOSInfo::LLOSInfo() :
- mMajorVer(0), mMinorVer(0), mBuild(0), mOSVersionString("")
-{
-
-#if LL_WINDOWS
-
- if (IsWindows10OrGreater())
- {
- mMajorVer = 10;
- mMinorVer = 0;
- mOSStringSimple = "Microsoft Windows 10 ";
- }
- else if (IsWindows8Point1OrGreater())
- {
- mMajorVer = 6;
- mMinorVer = 3;
- if (IsWindowsServer())
- {
- mOSStringSimple = "Windows Server 2012 R2 ";
- }
- else
- {
- mOSStringSimple = "Microsoft Windows 8.1 ";
- }
- }
- else if (IsWindows8OrGreater())
- {
- mMajorVer = 6;
- mMinorVer = 2;
- if (IsWindowsServer())
- {
- mOSStringSimple = "Windows Server 2012 ";
- }
- else
- {
- mOSStringSimple = "Microsoft Windows 8 ";
- }
- }
- else if (IsWindows7SP1OrGreater())
- {
- mMajorVer = 6;
- mMinorVer = 1;
- if (IsWindowsServer())
- {
- mOSStringSimple = "Windows Server 2008 R2 SP1 ";
- }
- else
- {
- mOSStringSimple = "Microsoft Windows 7 SP1 ";
- }
- }
- else if (IsWindows7OrGreater())
- {
- mMajorVer = 6;
- mMinorVer = 1;
- if (IsWindowsServer())
- {
- mOSStringSimple = "Windows Server 2008 R2 ";
- }
- else
- {
- mOSStringSimple = "Microsoft Windows 7 ";
- }
- }
- else if (IsWindowsVistaSP2OrGreater())
- {
- mMajorVer = 6;
- mMinorVer = 0;
- if (IsWindowsServer())
- {
- mOSStringSimple = "Windows Server 2008 SP2 ";
- }
- else
- {
- mOSStringSimple = "Microsoft Windows Vista SP2 ";
- }
- }
- else
- {
- mOSStringSimple = "Unsupported Windows version ";
- }
-
- ///get native system info if available..
- typedef void (WINAPI *PGNSI)(LPSYSTEM_INFO); ///function pointer for loading GetNativeSystemInfo
- SYSTEM_INFO si; //System Info object file contains architecture info
- PGNSI pGNSI; //pointer object
- ZeroMemory(&si, sizeof(SYSTEM_INFO)); //zero out the memory in information
- pGNSI = (PGNSI)GetProcAddress(GetModuleHandle(TEXT("kernel32.dll")), "GetNativeSystemInfo"); //load kernel32 get function
- if (NULL != pGNSI) //check if it has failed
- pGNSI(&si); //success
- else
- GetSystemInfo(&si); //if it fails get regular system info
- //(Warning: If GetSystemInfo it may result in incorrect information in a WOW64 machine, if the kernel fails to load)
-
- // Try calling GetVersionEx using the OSVERSIONINFOEX structure.
- OSVERSIONINFOEX osvi;
- ZeroMemory(&osvi, sizeof(OSVERSIONINFOEX));
- osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFOEX);
- if (GetVersionEx((OSVERSIONINFO *)&osvi))
- {
- mBuild = osvi.dwBuildNumber & 0xffff;
- }
- else
- {
- // If OSVERSIONINFOEX doesn't work, try OSVERSIONINFO.
- osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFO);
- if (GetVersionEx((OSVERSIONINFO *)&osvi))
- {
- mBuild = osvi.dwBuildNumber & 0xffff;
- }
- }
-
- S32 ubr = 0; // Windows 10 Update Build Revision, can be retrieved from a registry
- if (mMajorVer == 10)
- {
- DWORD cbData(sizeof(DWORD));
- DWORD data(0);
- HKEY key;
- LSTATUS ret_code = RegOpenKeyExW(HKEY_LOCAL_MACHINE, TEXT("SOFTWARE\\Microsoft\\Windows NT\\CurrentVersion"), 0, KEY_READ, &key);
- if (ERROR_SUCCESS == ret_code)
- {
- ret_code = RegQueryValueExW(key, L"UBR", 0, NULL, reinterpret_cast<LPBYTE>(&data), &cbData);
- if (ERROR_SUCCESS == ret_code)
- {
- ubr = data;
- }
- }
-
- if (mBuild >= 22000)
- {
- // At release Windows 11 version was 10.0.22000.194
- // Windows 10 version was 10.0.19043.1266
- // There is no warranty that Win10 build won't increase,
- // so until better solution is found or Microsoft updates
- // SDK with IsWindows11OrGreater(), indicate "10/11"
- //
- // Current alternatives:
- // Query WMI's Win32_OperatingSystem for OS string. Slow
- // and likely to return 'compatibility' string.
- // Check presence of dlls/libs or may be their version.
- mOSStringSimple = "Microsoft Windows 10/11 ";
- }
- }
-
- //msdn microsoft finds 32 bit and 64 bit flavors this way..
- //http://msdn.microsoft.com/en-us/library/ms724429(VS.85).aspx (example code that contains quite a few more flavors
- //of windows than this code does (in case it is needed for the future)
- if (si.wProcessorArchitecture == PROCESSOR_ARCHITECTURE_AMD64) //check for 64 bit
- {
- mOSStringSimple += "64-bit ";
- }
- else if (si.wProcessorArchitecture == PROCESSOR_ARCHITECTURE_INTEL)
- {
- mOSStringSimple += "32-bit ";
- }
-
- mOSString = mOSStringSimple;
- if (mBuild > 0)
- {
- mOSString += llformat("(Build %d", mBuild);
- if (ubr > 0)
- {
- mOSString += llformat(".%d", ubr);
- }
- mOSString += ")";
- }
-
- LLStringUtil::trim(mOSStringSimple);
- LLStringUtil::trim(mOSString);
-
-#elif LL_DARWIN
-
- // Initialize mOSStringSimple to something like:
- // "macOS 10.13.1"
- {
- const char * DARWIN_PRODUCT_NAME = "macOS";
-
- int64_t major_version, minor_version, bugfix_version = 0;
-
- if (LLGetDarwinOSInfo(major_version, minor_version, bugfix_version))
- {
- mMajorVer = major_version;
- mMinorVer = minor_version;
- mBuild = bugfix_version;
-
- std::stringstream os_version_string;
- os_version_string << DARWIN_PRODUCT_NAME << " " << mMajorVer << "." << mMinorVer << "." << mBuild;
-
- // Put it in the OS string we are compiling
- mOSStringSimple.append(os_version_string.str());
- }
- else
- {
- mOSStringSimple.append("Unable to collect OS info");
- }
- }
-
- // Initialize mOSString to something like:
- // "macOS 10.13.1 Darwin Kernel Version 10.7.0: Sat Jan 29 15:17:16 PST 2011; root:xnu-1504.9.37~1/RELEASE_I386 i386"
- struct utsname un;
- if(uname(&un) != -1)
- {
- mOSString = mOSStringSimple;
- mOSString.append(" ");
- mOSString.append(un.sysname);
- mOSString.append(" ");
- mOSString.append(un.release);
- mOSString.append(" ");
- mOSString.append(un.version);
- mOSString.append(" ");
- mOSString.append(un.machine);
- }
- else
- {
- mOSString = mOSStringSimple;
- }
-
-#elif LL_LINUX
-
- struct utsname un;
- if(uname(&un) != -1)
- {
- mOSStringSimple.append(un.sysname);
- mOSStringSimple.append(" ");
- mOSStringSimple.append(un.release);
-
- mOSString = mOSStringSimple;
- mOSString.append(" ");
- mOSString.append(un.version);
- mOSString.append(" ");
- mOSString.append(un.machine);
-
- // Simplify 'Simple'
- std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0));
- if (ostype == "Linux")
- {
- // Only care about major and minor Linux versions, truncate at second '.'
- std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0);
- std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos;
- std::string simple = mOSStringSimple.substr(0, idx2);
- if (simple.length() > 0)
- mOSStringSimple = simple;
- }
- }
- else
- {
- mOSStringSimple.append("Unable to collect OS info");
- mOSString = mOSStringSimple;
- }
-
- const char OS_VERSION_MATCH_EXPRESSION[] = "([0-9]+)\\.([0-9]+)(\\.([0-9]+))?";
- boost::regex os_version_parse(OS_VERSION_MATCH_EXPRESSION);
- boost::smatch matched;
-
- std::string glibc_version(gnu_get_libc_version());
- if ( ll_regex_match(glibc_version, matched, os_version_parse) )
- {
- LL_INFOS("AppInit") << "Using glibc version '" << glibc_version << "' as OS version" << LL_ENDL;
-
- std::string version_value;
-
- if ( matched[1].matched ) // Major version
- {
- version_value.assign(matched[1].first, matched[1].second);
- if (sscanf(version_value.c_str(), "%d", &mMajorVer) != 1)
- {
- LL_WARNS("AppInit") << "failed to parse major version '" << version_value << "' as a number" << LL_ENDL;
- }
- }
- else
- {
- LL_ERRS("AppInit")
- << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION
- << "' returned true, but major version [1] did not match"
- << LL_ENDL;
- }
-
- if ( matched[2].matched ) // Minor version
- {
- version_value.assign(matched[2].first, matched[2].second);
- if (sscanf(version_value.c_str(), "%d", &mMinorVer) != 1)
- {
- LL_ERRS("AppInit") << "failed to parse minor version '" << version_value << "' as a number" << LL_ENDL;
- }
- }
- else
- {
- LL_ERRS("AppInit")
- << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION
- << "' returned true, but minor version [1] did not match"
- << LL_ENDL;
- }
-
- if ( matched[4].matched ) // Build version (optional) - note that [3] includes the '.'
- {
- version_value.assign(matched[4].first, matched[4].second);
- if (sscanf(version_value.c_str(), "%d", &mBuild) != 1)
- {
- LL_ERRS("AppInit") << "failed to parse build version '" << version_value << "' as a number" << LL_ENDL;
- }
- }
- else
- {
- LL_INFOS("AppInit")
- << "OS build version not provided; using zero"
- << LL_ENDL;
- }
- }
- else
- {
- LL_WARNS("AppInit") << "glibc version '" << glibc_version << "' cannot be parsed to three numbers; using all zeros" << LL_ENDL;
- }
-
-#else
-
- struct utsname un;
- if(uname(&un) != -1)
- {
- mOSStringSimple.append(un.sysname);
- mOSStringSimple.append(" ");
- mOSStringSimple.append(un.release);
-
- mOSString = mOSStringSimple;
- mOSString.append(" ");
- mOSString.append(un.version);
- mOSString.append(" ");
- mOSString.append(un.machine);
-
- // Simplify 'Simple'
- std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0));
- if (ostype == "Linux")
- {
- // Only care about major and minor Linux versions, truncate at second '.'
- std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0);
- std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos;
- std::string simple = mOSStringSimple.substr(0, idx2);
- if (simple.length() > 0)
- mOSStringSimple = simple;
- }
- }
- else
- {
- mOSStringSimple.append("Unable to collect OS info");
- mOSString = mOSStringSimple;
- }
-
-#endif
-
- std::stringstream dotted_version_string;
- dotted_version_string << mMajorVer << "." << mMinorVer << "." << mBuild;
- mOSVersionString.append(dotted_version_string.str());
-
- mOSBitness = is64Bit() ? 64 : 32;
- LL_INFOS("LLOSInfo") << "OS bitness: " << mOSBitness << LL_ENDL;
-}
-
-#ifndef LL_WINDOWS
-// static
-long LLOSInfo::getMaxOpenFiles()
-{
- const long OPEN_MAX_GUESS = 256;
-
-#ifdef OPEN_MAX
- static long open_max = OPEN_MAX;
-#else
- static long open_max = 0;
-#endif
-
- if (0 == open_max)
- {
- // First time through.
- errno = 0;
- if ( (open_max = sysconf(_SC_OPEN_MAX)) < 0)
- {
- if (0 == errno)
- {
- // Indeterminate.
- open_max = OPEN_MAX_GUESS;
- }
- else
- {
- LL_ERRS() << "LLOSInfo::getMaxOpenFiles: sysconf error for _SC_OPEN_MAX" << LL_ENDL;
- }
- }
- }
- return open_max;
-}
-#endif
-
-void LLOSInfo::stream(std::ostream& s) const
-{
- s << mOSString;
-}
-
-const std::string& LLOSInfo::getOSString() const
-{
- return mOSString;
-}
-
-const std::string& LLOSInfo::getOSStringSimple() const
-{
- return mOSStringSimple;
-}
-
-const std::string& LLOSInfo::getOSVersionString() const
-{
- return mOSVersionString;
-}
-
-const S32 LLOSInfo::getOSBitness() const
-{
- return mOSBitness;
-}
-
-//static
-U32 LLOSInfo::getProcessVirtualSizeKB()
-{
- U32 virtual_size = 0;
-#if LL_LINUX
-# define STATUS_SIZE 2048
- LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb");
- if (status_filep)
- {
- S32 numRead = 0;
- char buff[STATUS_SIZE]; /* Flawfinder: ignore */
-
- size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep);
- buff[nbytes] = '\0';
-
- // All these guys return numbers in KB
- char *memp = strstr(buff, "VmSize:");
- if (memp)
- {
- numRead += sscanf(memp, "%*s %u", &virtual_size);
- }
- fclose(status_filep);
- }
-#endif
- return virtual_size;
-}
-
-//static
-U32 LLOSInfo::getProcessResidentSizeKB()
-{
- U32 resident_size = 0;
-#if LL_LINUX
- LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb");
- if (status_filep != NULL)
- {
- S32 numRead = 0;
- char buff[STATUS_SIZE]; /* Flawfinder: ignore */
-
- size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep);
- buff[nbytes] = '\0';
-
- // All these guys return numbers in KB
- char *memp = strstr(buff, "VmRSS:");
- if (memp)
- {
- numRead += sscanf(memp, "%*s %u", &resident_size);
- }
- fclose(status_filep);
- }
-#endif
- return resident_size;
-}
-
-//static
-bool LLOSInfo::is64Bit()
-{
-#if LL_WINDOWS
-#if defined(_WIN64)
- return true;
-#elif defined(_WIN32)
- // 32-bit viewer may be run on both 32-bit and 64-bit Windows, need to elaborate
- bool f64 = false;
- return IsWow64Process(GetCurrentProcess(), &f64) && f64;
-#else
- return false;
-#endif
-#else // ! LL_WINDOWS
- // we only build a 64-bit mac viewer and currently we don't build for linux at all
- return true;
-#endif
-}
-
-LLCPUInfo::LLCPUInfo()
-{
- std::ostringstream out;
- LLProcessorInfo proc;
- // proc.WriteInfoTextFile("procInfo.txt");
- mHasSSE = proc.hasSSE();
- mHasSSE2 = proc.hasSSE2();
- mHasSSE3 = proc.hasSSE3();
- mHasSSE3S = proc.hasSSE3S();
- mHasSSE41 = proc.hasSSE41();
- mHasSSE42 = proc.hasSSE42();
- mHasSSE4a = proc.hasSSE4a();
- mHasAltivec = proc.hasAltivec();
- mCPUMHz = (F64)proc.getCPUFrequency();
- mFamily = proc.getCPUFamilyName();
- mCPUString = "Unknown";
-
- out << proc.getCPUBrandName();
- if (200 < mCPUMHz && mCPUMHz < 10000) // *NOTE: cpu speed is often way wrong, do a sanity check
- {
- out << " (" << mCPUMHz << " MHz)";
- }
- mCPUString = out.str();
- LLStringUtil::trim(mCPUString);
-
- if (mHasSSE)
- {
- mSSEVersions.append("1");
- }
- if (mHasSSE2)
- {
- mSSEVersions.append("2");
- }
- if (mHasSSE3)
- {
- mSSEVersions.append("3");
- }
- if (mHasSSE3S)
- {
- mSSEVersions.append("3S");
- }
- if (mHasSSE41)
- {
- mSSEVersions.append("4.1");
- }
- if (mHasSSE42)
- {
- mSSEVersions.append("4.2");
- }
- if (mHasSSE4a)
- {
- mSSEVersions.append("4a");
- }
-}
-
-bool LLCPUInfo::hasAltivec() const
-{
- return mHasAltivec;
-}
-
-bool LLCPUInfo::hasSSE() const
-{
- return mHasSSE;
-}
-
-bool LLCPUInfo::hasSSE2() const
-{
- return mHasSSE2;
-}
-
-bool LLCPUInfo::hasSSE3() const
-{
- return mHasSSE3;
-}
-
-bool LLCPUInfo::hasSSE3S() const
-{
- return mHasSSE3S;
-}
-
-bool LLCPUInfo::hasSSE41() const
-{
- return mHasSSE41;
-}
-
-bool LLCPUInfo::hasSSE42() const
-{
- return mHasSSE42;
-}
-
-bool LLCPUInfo::hasSSE4a() const
-{
- return mHasSSE4a;
-}
-
-F64 LLCPUInfo::getMHz() const
-{
- return mCPUMHz;
-}
-
-std::string LLCPUInfo::getCPUString() const
-{
- return mCPUString;
-}
-
-const LLSD& LLCPUInfo::getSSEVersions() const
-{
- return mSSEVersions;
-}
-
-void LLCPUInfo::stream(std::ostream& s) const
-{
- // gather machine information.
- s << LLProcessorInfo().getCPUFeatureDescription();
-
- // These are interesting as they reflect our internal view of the
- // CPU's attributes regardless of platform
- s << "->mHasSSE: " << (U32)mHasSSE << std::endl;
- s << "->mHasSSE2: " << (U32)mHasSSE2 << std::endl;
- s << "->mHasSSE3: " << (U32)mHasSSE3 << std::endl;
- s << "->mHasSSE3S: " << (U32)mHasSSE3S << std::endl;
- s << "->mHasSSE41: " << (U32)mHasSSE41 << std::endl;
- s << "->mHasSSE42: " << (U32)mHasSSE42 << std::endl;
- s << "->mHasSSE4a: " << (U32)mHasSSE4a << std::endl;
- s << "->mHasAltivec: " << (U32)mHasAltivec << std::endl;
- s << "->mCPUMHz: " << mCPUMHz << std::endl;
- s << "->mCPUString: " << mCPUString << std::endl;
-}
-
-// Helper class for LLMemoryInfo: accumulate stats in the form we store for
-// LLMemoryInfo::getStatsMap().
-class Stats
-{
-public:
- Stats():
- mStats(LLSD::emptyMap())
- {}
-
- // Store every integer type as LLSD::Integer.
- template <class T>
- void add(const LLSD::String& name, const T& value,
- typename boost::enable_if<boost::is_integral<T> >::type* = 0)
- {
- mStats[name] = LLSD::Integer(value);
- }
-
- // Store every floating-point type as LLSD::Real.
- template <class T>
- void add(const LLSD::String& name, const T& value,
- typename boost::enable_if<boost::is_float<T> >::type* = 0)
- {
- mStats[name] = LLSD::Real(value);
- }
-
- // Hope that LLSD::Date values are sufficiently unambiguous.
- void add(const LLSD::String& name, const LLSD::Date& value)
- {
- mStats[name] = value;
- }
-
- LLSD get() const { return mStats; }
-
-private:
- LLSD mStats;
-};
-
-LLMemoryInfo::LLMemoryInfo()
-{
- refresh();
-}
-
-#if LL_WINDOWS
-static U32Kilobytes LLMemoryAdjustKBResult(U32Kilobytes inKB)
-{
- // Moved this here from llfloaterabout.cpp
-
- //! \bug
- // For some reason, the reported amount of memory is always wrong.
- // The original adjustment assumes it's always off by one meg, however
- // errors of as much as 2520 KB have been observed in the value
- // returned from the GetMemoryStatusEx function. Here we keep the
- // original adjustment from llfoaterabout.cpp until this can be
- // fixed somehow.
- inKB += U32Megabytes(1);
-
- return inKB;
-}
-#endif
-
-#if LL_DARWIN
-// static
-U32Kilobytes LLMemoryInfo::getHardwareMemSize()
-{
- // This might work on Linux as well. Someone check...
- uint64_t phys = 0;
- int mib[2] = { CTL_HW, HW_MEMSIZE };
-
- size_t len = sizeof(phys);
- sysctl(mib, 2, &phys, &len, NULL, 0);
-
- return U64Bytes(phys);
-}
-#endif
-
-U32Kilobytes LLMemoryInfo::getPhysicalMemoryKB() const
-{
-#if LL_WINDOWS
- return LLMemoryAdjustKBResult(U32Kilobytes(mStatsMap["Total Physical KB"].asInteger()));
-
-#elif LL_DARWIN
- return getHardwareMemSize();
-
-#elif LL_LINUX
- U64 phys = 0;
- phys = (U64)(getpagesize()) * (U64)(get_phys_pages());
- return U64Bytes(phys);
-
-#else
- return 0;
-
-#endif
-}
-
-//static
-void LLMemoryInfo::getAvailableMemoryKB(U32Kilobytes& avail_physical_mem_kb, U32Kilobytes& avail_virtual_mem_kb)
-{
-#if LL_WINDOWS
- // Sigh, this shouldn't be a static method, then we wouldn't have to
- // reload this data separately from refresh()
- LLSD statsMap(loadStatsMap());
-
- avail_physical_mem_kb = (U32Kilobytes)statsMap["Avail Physical KB"].asInteger();
- avail_virtual_mem_kb = (U32Kilobytes)statsMap["Avail Virtual KB"].asInteger();
-
-#elif LL_DARWIN
- // mStatsMap is derived from vm_stat, look for (e.g.) "kb free":
- // $ vm_stat
- // Mach Virtual Memory Statistics: (page size of 4096 bytes)
- // Pages free: 462078.
- // Pages active: 142010.
- // Pages inactive: 220007.
- // Pages wired down: 159552.
- // "Translation faults": 220825184.
- // Pages copy-on-write: 2104153.
- // Pages zero filled: 167034876.
- // Pages reactivated: 65153.
- // Pageins: 2097212.
- // Pageouts: 41759.
- // Object cache: 841598 hits of 7629869 lookups (11% hit rate)
- avail_physical_mem_kb = (U32Kilobytes)-1 ;
- avail_virtual_mem_kb = (U32Kilobytes)-1 ;
-
-#elif LL_LINUX
- // mStatsMap is derived from MEMINFO_FILE:
- // $ cat /proc/meminfo
- // MemTotal: 4108424 kB
- // MemFree: 1244064 kB
- // Buffers: 85164 kB
- // Cached: 1990264 kB
- // SwapCached: 0 kB
- // Active: 1176648 kB
- // Inactive: 1427532 kB
- // Active(anon): 529152 kB
- // Inactive(anon): 15924 kB
- // Active(file): 647496 kB
- // Inactive(file): 1411608 kB
- // Unevictable: 16 kB
- // Mlocked: 16 kB
- // HighTotal: 3266316 kB
- // HighFree: 721308 kB
- // LowTotal: 842108 kB
- // LowFree: 522756 kB
- // SwapTotal: 6384632 kB
- // SwapFree: 6384632 kB
- // Dirty: 28 kB
- // Writeback: 0 kB
- // AnonPages: 528820 kB
- // Mapped: 89472 kB
- // Shmem: 16324 kB
- // Slab: 159624 kB
- // SReclaimable: 145168 kB
- // SUnreclaim: 14456 kB
- // KernelStack: 2560 kB
- // PageTables: 5560 kB
- // NFS_Unstable: 0 kB
- // Bounce: 0 kB
- // WritebackTmp: 0 kB
- // CommitLimit: 8438844 kB
- // Committed_AS: 1271596 kB
- // VmallocTotal: 122880 kB
- // VmallocUsed: 65252 kB
- // VmallocChunk: 52356 kB
- // HardwareCorrupted: 0 kB
- // HugePages_Total: 0
- // HugePages_Free: 0
- // HugePages_Rsvd: 0
- // HugePages_Surp: 0
- // Hugepagesize: 2048 kB
- // DirectMap4k: 434168 kB
- // DirectMap2M: 477184 kB
- // (could also run 'free', but easier to read a file than run a program)
- avail_physical_mem_kb = (U32Kilobytes)-1 ;
- avail_virtual_mem_kb = (U32Kilobytes)-1 ;
-
-#else
- //do not know how to collect available memory info for other systems.
- //leave it blank here for now.
-
- avail_physical_mem_kb = (U32Kilobytes)-1 ;
- avail_virtual_mem_kb = (U32Kilobytes)-1 ;
-#endif
-}
-
-void LLMemoryInfo::stream(std::ostream& s) const
-{
- // We want these memory stats to be easy to grep from the log, along with
- // the timestamp. So preface each line with the timestamp and a
- // distinctive marker. Without that, we'd have to search the log for the
- // introducer line, then read subsequent lines, etc...
- std::string pfx(LLError::utcTime() + " <mem> ");
-
- // Max key length
- size_t key_width(0);
- for (const auto& [key, value] : inMap(mStatsMap))
- {
- size_t len(key.length());
- if (len > key_width)
- {
- key_width = len;
- }
- }
-
- // Now stream stats
- for (const auto& [key, value] : inMap(mStatsMap))
- {
- s << pfx << std::setw(narrow<size_t>(key_width+1)) << (key + ':') << ' ';
- if (value.isInteger())
- s << std::setw(12) << value.asInteger();
- else if (value.isReal())
- s << std::fixed << std::setprecision(1) << value.asReal();
- else if (value.isDate())
- value.asDate().toStream(s);
- else
- s << value; // just use default LLSD formatting
- s << std::endl;
- }
-}
-
-LLSD LLMemoryInfo::getStatsMap() const
-{
- return mStatsMap;
-}
-
-LLMemoryInfo& LLMemoryInfo::refresh()
-{
- LL_PROFILE_ZONE_SCOPED
- mStatsMap = loadStatsMap();
-
- LL_DEBUGS("LLMemoryInfo") << "Populated mStatsMap:\n";
- LLSDSerialize::toPrettyXML(mStatsMap, LL_CONT);
- LL_ENDL;
-
- return *this;
-}
-
-LLSD LLMemoryInfo::loadStatsMap()
-{
- LL_PROFILE_ZONE_SCOPED;
-
- // This implementation is derived from stream() code (as of 2011-06-29).
- Stats stats;
-
- // associate timestamp for analysis over time
- stats.add("timestamp", LLDate::now());
-
-#if LL_WINDOWS
- MEMORYSTATUSEX state;
- state.dwLength = sizeof(state);
- GlobalMemoryStatusEx(&state);
-
- DWORDLONG div = 1024;
-
- stats.add("Percent Memory use", state.dwMemoryLoad/div);
- stats.add("Total Physical KB", state.ullTotalPhys/div);
- stats.add("Avail Physical KB", state.ullAvailPhys/div);
- stats.add("Total page KB", state.ullTotalPageFile/div);
- stats.add("Avail page KB", state.ullAvailPageFile/div);
- stats.add("Total Virtual KB", state.ullTotalVirtual/div);
- stats.add("Avail Virtual KB", state.ullAvailVirtual/div);
-
- // SL-12122 - Call to GetPerformanceInfo() was removed here. Took
- // on order of 10 ms, causing unacceptable frame time spike every
- // second, and results were never used. If this is needed in the
- // future, must find a way to avoid frame time impact (e.g. move
- // to another thread, call much less often).
-
- PROCESS_MEMORY_COUNTERS_EX pmem;
- pmem.cb = sizeof(pmem);
- // GetProcessMemoryInfo() is documented to accept either
- // PROCESS_MEMORY_COUNTERS* or PROCESS_MEMORY_COUNTERS_EX*, presumably
- // using the redundant size info to distinguish. But its prototype
- // specifically accepts PROCESS_MEMORY_COUNTERS*, and since this is a
- // classic-C API, PROCESS_MEMORY_COUNTERS_EX isn't a subclass. Cast the
- // pointer.
- GetProcessMemoryInfo(GetCurrentProcess(), PPROCESS_MEMORY_COUNTERS(&pmem), sizeof(pmem));
-
- stats.add("Page Fault Count", pmem.PageFaultCount);
- stats.add("PeakWorkingSetSize KB", pmem.PeakWorkingSetSize/div);
- stats.add("WorkingSetSize KB", pmem.WorkingSetSize/div);
- stats.add("QutaPeakPagedPoolUsage KB", pmem.QuotaPeakPagedPoolUsage/div);
- stats.add("QuotaPagedPoolUsage KB", pmem.QuotaPagedPoolUsage/div);
- stats.add("QuotaPeakNonPagedPoolUsage KB", pmem.QuotaPeakNonPagedPoolUsage/div);
- stats.add("QuotaNonPagedPoolUsage KB", pmem.QuotaNonPagedPoolUsage/div);
- stats.add("PagefileUsage KB", pmem.PagefileUsage/div);
- stats.add("PeakPagefileUsage KB", pmem.PeakPagefileUsage/div);
- stats.add("PrivateUsage KB", pmem.PrivateUsage/div);
-
-#elif LL_DARWIN
-
- const vm_size_t pagekb(vm_page_size / 1024);
-
- //
- // Collect the vm_stat's
- //
-
- {
- vm_statistics64_data_t vmstat;
- mach_msg_type_number_t vmstatCount = HOST_VM_INFO64_COUNT;
-
- if (host_statistics64(mach_host_self(), HOST_VM_INFO64, (host_info64_t) &vmstat, &vmstatCount) != KERN_SUCCESS)
- {
- LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL;
- }
- else
- {
- stats.add("Pages free KB", pagekb * vmstat.free_count);
- stats.add("Pages active KB", pagekb * vmstat.active_count);
- stats.add("Pages inactive KB", pagekb * vmstat.inactive_count);
- stats.add("Pages wired KB", pagekb * vmstat.wire_count);
-
- stats.add("Pages zero fill", vmstat.zero_fill_count);
- stats.add("Page reactivations", vmstat.reactivations);
- stats.add("Page-ins", vmstat.pageins);
- stats.add("Page-outs", vmstat.pageouts);
-
- stats.add("Faults", vmstat.faults);
- stats.add("Faults copy-on-write", vmstat.cow_faults);
-
- stats.add("Cache lookups", vmstat.lookups);
- stats.add("Cache hits", vmstat.hits);
-
- stats.add("Page purgeable count", vmstat.purgeable_count);
- stats.add("Page purges", vmstat.purges);
-
- stats.add("Page speculative reads", vmstat.speculative_count);
- }
- }
-
- //
- // Collect the misc task info
- //
-
- {
- task_events_info_data_t taskinfo;
- unsigned taskinfoSize = sizeof(taskinfo);
-
- if (task_info(mach_task_self(), TASK_EVENTS_INFO, (task_info_t) &taskinfo, &taskinfoSize) != KERN_SUCCESS)
- {
- LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL;
- }
- else
- {
- stats.add("Task page-ins", taskinfo.pageins);
- stats.add("Task copy-on-write faults", taskinfo.cow_faults);
- stats.add("Task messages sent", taskinfo.messages_sent);
- stats.add("Task messages received", taskinfo.messages_received);
- stats.add("Task mach system call count", taskinfo.syscalls_mach);
- stats.add("Task unix system call count", taskinfo.syscalls_unix);
- stats.add("Task context switch count", taskinfo.csw);
- }
- }
-
- //
- // Collect the basic task info
- //
-
- {
- mach_task_basic_info_data_t taskinfo;
- mach_msg_type_number_t task_count = MACH_TASK_BASIC_INFO_COUNT;
- if (task_info(mach_task_self(), MACH_TASK_BASIC_INFO, (task_info_t) &taskinfo, &task_count) != KERN_SUCCESS)
- {
- LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL;
- }
- else
- {
- stats.add("Basic virtual memory KB", taskinfo.virtual_size / 1024);
- stats.add("Basic resident memory KB", taskinfo.resident_size / 1024);
- stats.add("Basic max resident memory KB", taskinfo.resident_size_max / 1024);
- stats.add("Basic new thread policy", taskinfo.policy);
- stats.add("Basic suspend count", taskinfo.suspend_count);
- }
- }
-
-#elif LL_LINUX
- std::ifstream meminfo(MEMINFO_FILE);
- if (meminfo.is_open())
- {
- // MemTotal: 4108424 kB
- // MemFree: 1244064 kB
- // Buffers: 85164 kB
- // Cached: 1990264 kB
- // SwapCached: 0 kB
- // Active: 1176648 kB
- // Inactive: 1427532 kB
- // ...
- // VmallocTotal: 122880 kB
- // VmallocUsed: 65252 kB
- // VmallocChunk: 52356 kB
- // HardwareCorrupted: 0 kB
- // HugePages_Total: 0
- // HugePages_Free: 0
- // HugePages_Rsvd: 0
- // HugePages_Surp: 0
- // Hugepagesize: 2048 kB
- // DirectMap4k: 434168 kB
- // DirectMap2M: 477184 kB
-
- // Intentionally don't pass the boost::no_except flag. This
- // boost::regex object is constructed with a string literal, so it
- // should be valid every time. If it becomes invalid, we WANT an
- // exception, hopefully even before the dev checks in.
- boost::regex stat_rx("(.+): +([0-9]+)( kB)?");
- boost::smatch matched;
-
- std::string line;
- while (std::getline(meminfo, line))
- {
- LL_DEBUGS("LLMemoryInfo") << line << LL_ENDL;
- if (ll_regex_match(line, matched, stat_rx))
- {
- // e.g. "MemTotal: 4108424 kB"
- LLSD::String key(matched[1].first, matched[1].second);
- LLSD::String value_str(matched[2].first, matched[2].second);
- LLSD::Integer value(0);
- try
- {
- value = boost::lexical_cast<LLSD::Integer>(value_str);
- }
- catch (const boost::bad_lexical_cast&)
- {
- LL_WARNS("LLMemoryInfo") << "couldn't parse '" << value_str
- << "' in " << MEMINFO_FILE << " line: "
- << line << LL_ENDL;
- continue;
- }
- // Store this statistic.
- stats.add(key, value);
- }
- else
- {
- LL_WARNS("LLMemoryInfo") << "unrecognized " << MEMINFO_FILE << " line: "
- << line << LL_ENDL;
- }
- }
- }
- else
- {
- LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL;
- }
-
-#else
- LL_WARNS("LLMemoryInfo") << "Unknown system; unable to collect memory information" << LL_ENDL;
-
-#endif
-
- return stats.get();
-}
-
-std::ostream& operator<<(std::ostream& s, const LLOSInfo& info)
-{
- info.stream(s);
- return s;
-}
-
-std::ostream& operator<<(std::ostream& s, const LLCPUInfo& info)
-{
- info.stream(s);
- return s;
-}
-
-std::ostream& operator<<(std::ostream& s, const LLMemoryInfo& info)
-{
- info.stream(s);
- return s;
-}
-
-class FrameWatcher
-{
-public:
- FrameWatcher():
- // Hooking onto the "mainloop" event pump gets us one call per frame.
- mConnection(LLEventPumps::instance()
- .obtain("mainloop")
- .listen("FrameWatcher", boost::bind(&FrameWatcher::tick, this, _1))),
- // Initializing mSampleStart to an invalid timestamp alerts us to skip
- // trying to compute framerate on the first call.
- mSampleStart(-1),
- // Initializing mSampleEnd to 0 ensures that we treat the first call
- // as the completion of a sample window.
- mSampleEnd(0),
- mFrames(0),
- // Both MEM_INFO_WINDOW and MEM_INFO_THROTTLE are in seconds. We need
- // the number of integer MEM_INFO_THROTTLE sample slots that will fit
- // in MEM_INFO_WINDOW. Round up.
- mSamples(int((MEM_INFO_WINDOW / MEM_INFO_THROTTLE) + 0.7)),
- // Initializing to F32_MAX means that the first real frame will become
- // the slowest ever, which sounds like a good idea.
- mSlowest(F32_MAX)
- {}
-
- bool tick(const LLSD&)
- {
- F32 timestamp(mTimer.getElapsedTimeF32());
-
- // Count this frame in the interval just completed.
- ++mFrames;
-
- // Have we finished a sample window yet?
- if (timestamp < mSampleEnd)
- {
- // no, just keep waiting
- return false;
- }
-
- // Set up for next sample window. Capture values for previous frame in
- // local variables and reset data members.
- U32 frames(mFrames);
- F32 sampleStart(mSampleStart);
- // No frames yet in next window
- mFrames = 0;
- // which starts right now
- mSampleStart = timestamp;
- // and ends MEM_INFO_THROTTLE seconds in the future
- mSampleEnd = mSampleStart + MEM_INFO_THROTTLE;
-
- // On the very first call, that's all we can do, no framerate
- // computation is possible.
- if (sampleStart < 0)
- {
- return false;
- }
-
- // How long did this actually take? As framerate slows, the duration
- // of the frame we just finished could push us WELL beyond our desired
- // sample window size.
- F32 elapsed(timestamp - sampleStart);
- F32 framerate(frames/elapsed);
-
- // Remember previous slowest framerate because we're just about to
- // update it.
- F32 slowest(mSlowest);
- // Remember previous number of samples.
- boost::circular_buffer<F32>::size_type prevSize(mSamples.size());
-
- // Capture new framerate in our samples buffer. Once the buffer is
- // full (after MEM_INFO_WINDOW seconds), this will displace the oldest
- // sample. ("So they all rolled over, and one fell out...")
- mSamples.push_back(framerate);
-
- // Calculate the new minimum framerate. I know of no way to update a
- // rolling minimum without ever rescanning the buffer. But since there
- // are only a few tens of items in this buffer, rescanning it is
- // probably cheaper (and certainly easier to reason about) than
- // attempting to optimize away some of the scans.
- mSlowest = framerate; // pick an arbitrary entry to start
- for (boost::circular_buffer<F32>::const_iterator si(mSamples.begin()), send(mSamples.end());
- si != send; ++si)
- {
- if (*si < mSlowest)
- {
- mSlowest = *si;
- }
- }
-
- // We're especially interested in memory as framerate drops. Only log
- // when framerate drops below the slowest framerate we remember.
- // (Should always be true for the end of the very first sample
- // window.)
- if (framerate >= slowest)
- {
- return false;
- }
- // Congratulations, we've hit a new low. :-P
-
- LL_INFOS("FrameWatcher") << ' ';
- if (! prevSize)
- {
- LL_CONT << "initial framerate ";
- }
- else
- {
- LL_CONT << "slowest framerate for last " << int(prevSize * MEM_INFO_THROTTLE)
- << " seconds ";
- }
-
- auto precision = LL_CONT.precision();
-
- LL_CONT << std::fixed << std::setprecision(1) << framerate << '\n'
- << LLMemoryInfo();
-
- LL_CONT.precision(precision);
- LL_CONT << LL_ENDL;
- return false;
- }
-
-private:
- // Storing the connection in an LLTempBoundListener ensures it will be
- // disconnected when we're destroyed.
- LLTempBoundListener mConnection;
- // Track elapsed time
- LLTimer mTimer;
- // Some of what you see here is in fact redundant with functionality you
- // can get from LLTimer. Unfortunately the LLTimer API is missing the
- // feature we need: has at least the stated interval elapsed, and if so,
- // exactly how long has passed? So we have to do it by hand, sigh.
- // Time at start, end of sample window
- F32 mSampleStart, mSampleEnd;
- // Frames this sample window
- U32 mFrames;
- // Sliding window of framerate samples
- boost::circular_buffer<F32> mSamples;
- // Slowest framerate in mSamples
- F32 mSlowest;
-};
-
-// Need an instance of FrameWatcher before it does any good
-static FrameWatcher sFrameWatcher;
-
-bool gunzip_file(const std::string& srcfile, const std::string& dstfile)
-{
- std::string tmpfile;
- const S32 UNCOMPRESS_BUFFER_SIZE = 32768;
- bool retval = false;
- gzFile src = NULL;
- U8 buffer[UNCOMPRESS_BUFFER_SIZE];
- LLFILE *dst = NULL;
- S32 bytes = 0;
- tmpfile = dstfile + ".t";
-#ifdef LL_WINDOWS
- llutf16string utf16filename = utf8str_to_utf16str(srcfile);
- src = gzopen_w(utf16filename.c_str(), "rb");
-#else
- src = gzopen(srcfile.c_str(), "rb");
-#endif
- if (! src) goto err;
- dst = LLFile::fopen(tmpfile, "wb"); /* Flawfinder: ignore */
- if (! dst) goto err;
- do
- {
- bytes = gzread(src, buffer, UNCOMPRESS_BUFFER_SIZE);
- size_t nwrit = fwrite(buffer, sizeof(U8), bytes, dst);
- if (nwrit < (size_t) bytes)
- {
- LL_WARNS() << "Short write on " << tmpfile << ": Wrote " << nwrit << " of " << bytes << " bytes." << LL_ENDL;
- goto err;
- }
- } while(gzeof(src) == 0);
- fclose(dst);
- dst = NULL;
-#if LL_WINDOWS
- // Rename in windows needs the dstfile to not exist.
- LLFile::remove(dstfile, ENOENT);
-#endif
- if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */
- retval = true;
-err:
- if (src != NULL) gzclose(src);
- if (dst != NULL) fclose(dst);
- return retval;
-}
-
-bool gzip_file(const std::string& srcfile, const std::string& dstfile)
-{
- const S32 COMPRESS_BUFFER_SIZE = 32768;
- std::string tmpfile;
- bool retval = false;
- U8 buffer[COMPRESS_BUFFER_SIZE];
- gzFile dst = NULL;
- LLFILE *src = NULL;
- S32 bytes = 0;
- tmpfile = dstfile + ".t";
-
-#ifdef LL_WINDOWS
- llutf16string utf16filename = utf8str_to_utf16str(tmpfile);
- dst = gzopen_w(utf16filename.c_str(), "wb");
-#else
- dst = gzopen(tmpfile.c_str(), "wb");
-#endif
-
- if (! dst) goto err;
- src = LLFile::fopen(srcfile, "rb"); /* Flawfinder: ignore */
- if (! src) goto err;
-
- while ((bytes = (S32)fread(buffer, sizeof(U8), COMPRESS_BUFFER_SIZE, src)) > 0)
- {
- if (gzwrite(dst, buffer, bytes) <= 0)
- {
- LL_WARNS() << "gzwrite failed: " << gzerror(dst, NULL) << LL_ENDL;
- goto err;
- }
- }
-
- if (ferror(src))
- {
- LL_WARNS() << "Error reading " << srcfile << LL_ENDL;
- goto err;
- }
-
- gzclose(dst);
- dst = NULL;
-#if LL_WINDOWS
- // Rename in windows needs the dstfile to not exist.
- LLFile::remove(dstfile);
-#endif
- if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */
- retval = true;
- err:
- if (src != NULL) fclose(src);
- if (dst != NULL) gzclose(dst);
- return retval;
-}
+/**
+ * @file llsys.cpp
+ * @brief Implementation of the basic system query functions.
+ *
+ * $LicenseInfo:firstyear=2002&license=viewerlgpl$
+ * Second Life Viewer Source Code
+ * Copyright (C) 2010, Linden Research, Inc.
+ *
+ * This library is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU Lesser General Public
+ * License as published by the Free Software Foundation;
+ * version 2.1 of the License only.
+ *
+ * This library is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the GNU
+ * Lesser General Public License for more details.
+ *
+ * You should have received a copy of the GNU Lesser General Public
+ * License along with this library; if not, write to the Free Software
+ * Foundation, Inc., 51 Franklin Street, Fifth Floor, Boston, MA 02110-1301 USA
+ *
+ * Linden Research, Inc., 945 Battery Street, San Francisco, CA 94111 USA
+ * $/LicenseInfo$
+ */
+
+#if LL_WINDOWS
+#pragma warning (disable : 4355) // 'this' used in initializer list: yes, intentionally
+#endif
+
+#include "linden_common.h"
+
+#include "llsys.h"
+
+#include <iostream>
+#ifdef LL_USESYSTEMLIBS
+# include <zlib.h>
+#else
+# include "zlib-ng/zlib.h"
+#endif
+
+#include "llprocessor.h"
+#include "llerrorcontrol.h"
+#include "llevents.h"
+#include "llformat.h"
+#include "llregex.h"
+#include "lltimer.h"
+#include "llsdserialize.h"
+#include "llsdutil.h"
+#include <boost/bind.hpp>
+#include <boost/circular_buffer.hpp>
+#include <boost/lexical_cast.hpp>
+#include <boost/range.hpp>
+#include <boost/utility/enable_if.hpp>
+#include <boost/type_traits/is_integral.hpp>
+#include <boost/type_traits/is_float.hpp>
+#include "llfasttimer.h"
+
+using namespace llsd;
+
+#if LL_WINDOWS
+# include "llwin32headerslean.h"
+# include <psapi.h> // GetPerformanceInfo() et al.
+# include <VersionHelpers.h>
+#elif LL_DARWIN
+# include "llsys_objc.h"
+# include <errno.h>
+# include <sys/sysctl.h>
+# include <sys/utsname.h>
+# include <stdint.h>
+# include <CoreServices/CoreServices.h>
+# include <stdexcept>
+# include <mach/host_info.h>
+# include <mach/mach_host.h>
+# include <mach/task.h>
+# include <mach/task_info.h>
+#elif LL_LINUX
+# include <errno.h>
+# include <sys/utsname.h>
+# include <unistd.h>
+# include <sys/sysinfo.h>
+# include <stdexcept>
+const char MEMINFO_FILE[] = "/proc/meminfo";
+# include <gnu/libc-version.h>
+#endif
+
+LLCPUInfo gSysCPU;
+
+// Don't log memory info any more often than this. It also serves as our
+// framerate sample size.
+static const F32 MEM_INFO_THROTTLE = 20;
+// Sliding window of samples. We intentionally limit the length of time we
+// remember "the slowest" framerate because framerate is very slow at login.
+// If we only triggered FrameWatcher logging when the session framerate
+// dropped below the login framerate, we'd have very little additional data.
+static const F32 MEM_INFO_WINDOW = 10*60;
+
+LLOSInfo::LLOSInfo() :
+ mMajorVer(0), mMinorVer(0), mBuild(0), mOSVersionString("")
+{
+
+#if LL_WINDOWS
+
+ if (IsWindows10OrGreater())
+ {
+ mMajorVer = 10;
+ mMinorVer = 0;
+ mOSStringSimple = "Microsoft Windows 10 ";
+ }
+ else if (IsWindows8Point1OrGreater())
+ {
+ mMajorVer = 6;
+ mMinorVer = 3;
+ if (IsWindowsServer())
+ {
+ mOSStringSimple = "Windows Server 2012 R2 ";
+ }
+ else
+ {
+ mOSStringSimple = "Microsoft Windows 8.1 ";
+ }
+ }
+ else if (IsWindows8OrGreater())
+ {
+ mMajorVer = 6;
+ mMinorVer = 2;
+ if (IsWindowsServer())
+ {
+ mOSStringSimple = "Windows Server 2012 ";
+ }
+ else
+ {
+ mOSStringSimple = "Microsoft Windows 8 ";
+ }
+ }
+ else if (IsWindows7SP1OrGreater())
+ {
+ mMajorVer = 6;
+ mMinorVer = 1;
+ if (IsWindowsServer())
+ {
+ mOSStringSimple = "Windows Server 2008 R2 SP1 ";
+ }
+ else
+ {
+ mOSStringSimple = "Microsoft Windows 7 SP1 ";
+ }
+ }
+ else if (IsWindows7OrGreater())
+ {
+ mMajorVer = 6;
+ mMinorVer = 1;
+ if (IsWindowsServer())
+ {
+ mOSStringSimple = "Windows Server 2008 R2 ";
+ }
+ else
+ {
+ mOSStringSimple = "Microsoft Windows 7 ";
+ }
+ }
+ else if (IsWindowsVistaSP2OrGreater())
+ {
+ mMajorVer = 6;
+ mMinorVer = 0;
+ if (IsWindowsServer())
+ {
+ mOSStringSimple = "Windows Server 2008 SP2 ";
+ }
+ else
+ {
+ mOSStringSimple = "Microsoft Windows Vista SP2 ";
+ }
+ }
+ else
+ {
+ mOSStringSimple = "Unsupported Windows version ";
+ }
+
+ ///get native system info if available..
+ typedef void (WINAPI *PGNSI)(LPSYSTEM_INFO); ///function pointer for loading GetNativeSystemInfo
+ SYSTEM_INFO si; //System Info object file contains architecture info
+ PGNSI pGNSI; //pointer object
+ ZeroMemory(&si, sizeof(SYSTEM_INFO)); //zero out the memory in information
+ pGNSI = (PGNSI)GetProcAddress(GetModuleHandle(TEXT("kernel32.dll")), "GetNativeSystemInfo"); //load kernel32 get function
+ if (NULL != pGNSI) //check if it has failed
+ pGNSI(&si); //success
+ else
+ GetSystemInfo(&si); //if it fails get regular system info
+ //(Warning: If GetSystemInfo it may result in incorrect information in a WOW64 machine, if the kernel fails to load)
+
+ // Try calling GetVersionEx using the OSVERSIONINFOEX structure.
+ OSVERSIONINFOEX osvi;
+ ZeroMemory(&osvi, sizeof(OSVERSIONINFOEX));
+ osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFOEX);
+ if (GetVersionEx((OSVERSIONINFO *)&osvi))
+ {
+ mBuild = osvi.dwBuildNumber & 0xffff;
+ }
+ else
+ {
+ // If OSVERSIONINFOEX doesn't work, try OSVERSIONINFO.
+ osvi.dwOSVersionInfoSize = sizeof(OSVERSIONINFO);
+ if (GetVersionEx((OSVERSIONINFO *)&osvi))
+ {
+ mBuild = osvi.dwBuildNumber & 0xffff;
+ }
+ }
+
+ S32 ubr = 0; // Windows 10 Update Build Revision, can be retrieved from a registry
+ if (mMajorVer == 10)
+ {
+ DWORD cbData(sizeof(DWORD));
+ DWORD data(0);
+ HKEY key;
+ LSTATUS ret_code = RegOpenKeyExW(HKEY_LOCAL_MACHINE, TEXT("SOFTWARE\\Microsoft\\Windows NT\\CurrentVersion"), 0, KEY_READ, &key);
+ if (ERROR_SUCCESS == ret_code)
+ {
+ ret_code = RegQueryValueExW(key, L"UBR", 0, NULL, reinterpret_cast<LPBYTE>(&data), &cbData);
+ if (ERROR_SUCCESS == ret_code)
+ {
+ ubr = data;
+ }
+ }
+
+ if (mBuild >= 22000)
+ {
+ // At release Windows 11 version was 10.0.22000.194
+ // Windows 10 version was 10.0.19043.1266
+ // There is no warranty that Win10 build won't increase,
+ // so until better solution is found or Microsoft updates
+ // SDK with IsWindows11OrGreater(), indicate "10/11"
+ //
+ // Current alternatives:
+ // Query WMI's Win32_OperatingSystem for OS string. Slow
+ // and likely to return 'compatibility' string.
+ // Check presence of dlls/libs or may be their version.
+ mOSStringSimple = "Microsoft Windows 10/11 ";
+ }
+ }
+
+ //msdn microsoft finds 32 bit and 64 bit flavors this way..
+ //http://msdn.microsoft.com/en-us/library/ms724429(VS.85).aspx (example code that contains quite a few more flavors
+ //of windows than this code does (in case it is needed for the future)
+ if (si.wProcessorArchitecture == PROCESSOR_ARCHITECTURE_AMD64) //check for 64 bit
+ {
+ mOSStringSimple += "64-bit ";
+ }
+ else if (si.wProcessorArchitecture == PROCESSOR_ARCHITECTURE_INTEL)
+ {
+ mOSStringSimple += "32-bit ";
+ }
+
+ mOSString = mOSStringSimple;
+ if (mBuild > 0)
+ {
+ mOSString += llformat("(Build %d", mBuild);
+ if (ubr > 0)
+ {
+ mOSString += llformat(".%d", ubr);
+ }
+ mOSString += ")";
+ }
+
+ LLStringUtil::trim(mOSStringSimple);
+ LLStringUtil::trim(mOSString);
+
+#elif LL_DARWIN
+
+ // Initialize mOSStringSimple to something like:
+ // "macOS 10.13.1"
+ {
+ const char * DARWIN_PRODUCT_NAME = "macOS";
+
+ int64_t major_version, minor_version, bugfix_version = 0;
+
+ if (LLGetDarwinOSInfo(major_version, minor_version, bugfix_version))
+ {
+ mMajorVer = major_version;
+ mMinorVer = minor_version;
+ mBuild = bugfix_version;
+
+ std::stringstream os_version_string;
+ os_version_string << DARWIN_PRODUCT_NAME << " " << mMajorVer << "." << mMinorVer << "." << mBuild;
+
+ // Put it in the OS string we are compiling
+ mOSStringSimple.append(os_version_string.str());
+ }
+ else
+ {
+ mOSStringSimple.append("Unable to collect OS info");
+ }
+ }
+
+ // Initialize mOSString to something like:
+ // "macOS 10.13.1 Darwin Kernel Version 10.7.0: Sat Jan 29 15:17:16 PST 2011; root:xnu-1504.9.37~1/RELEASE_I386 i386"
+ struct utsname un;
+ if(uname(&un) != -1)
+ {
+ mOSString = mOSStringSimple;
+ mOSString.append(" ");
+ mOSString.append(un.sysname);
+ mOSString.append(" ");
+ mOSString.append(un.release);
+ mOSString.append(" ");
+ mOSString.append(un.version);
+ mOSString.append(" ");
+ mOSString.append(un.machine);
+ }
+ else
+ {
+ mOSString = mOSStringSimple;
+ }
+
+#elif LL_LINUX
+
+ struct utsname un;
+ if(uname(&un) != -1)
+ {
+ mOSStringSimple.append(un.sysname);
+ mOSStringSimple.append(" ");
+ mOSStringSimple.append(un.release);
+
+ mOSString = mOSStringSimple;
+ mOSString.append(" ");
+ mOSString.append(un.version);
+ mOSString.append(" ");
+ mOSString.append(un.machine);
+
+ // Simplify 'Simple'
+ std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0));
+ if (ostype == "Linux")
+ {
+ // Only care about major and minor Linux versions, truncate at second '.'
+ std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0);
+ std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos;
+ std::string simple = mOSStringSimple.substr(0, idx2);
+ if (simple.length() > 0)
+ mOSStringSimple = simple;
+ }
+ }
+ else
+ {
+ mOSStringSimple.append("Unable to collect OS info");
+ mOSString = mOSStringSimple;
+ }
+
+ const char OS_VERSION_MATCH_EXPRESSION[] = "([0-9]+)\\.([0-9]+)(\\.([0-9]+))?";
+ boost::regex os_version_parse(OS_VERSION_MATCH_EXPRESSION);
+ boost::smatch matched;
+
+ std::string glibc_version(gnu_get_libc_version());
+ if ( ll_regex_match(glibc_version, matched, os_version_parse) )
+ {
+ LL_INFOS("AppInit") << "Using glibc version '" << glibc_version << "' as OS version" << LL_ENDL;
+
+ std::string version_value;
+
+ if ( matched[1].matched ) // Major version
+ {
+ version_value.assign(matched[1].first, matched[1].second);
+ if (sscanf(version_value.c_str(), "%d", &mMajorVer) != 1)
+ {
+ LL_WARNS("AppInit") << "failed to parse major version '" << version_value << "' as a number" << LL_ENDL;
+ }
+ }
+ else
+ {
+ LL_ERRS("AppInit")
+ << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION
+ << "' returned true, but major version [1] did not match"
+ << LL_ENDL;
+ }
+
+ if ( matched[2].matched ) // Minor version
+ {
+ version_value.assign(matched[2].first, matched[2].second);
+ if (sscanf(version_value.c_str(), "%d", &mMinorVer) != 1)
+ {
+ LL_ERRS("AppInit") << "failed to parse minor version '" << version_value << "' as a number" << LL_ENDL;
+ }
+ }
+ else
+ {
+ LL_ERRS("AppInit")
+ << "OS version regex '" << OS_VERSION_MATCH_EXPRESSION
+ << "' returned true, but minor version [1] did not match"
+ << LL_ENDL;
+ }
+
+ if ( matched[4].matched ) // Build version (optional) - note that [3] includes the '.'
+ {
+ version_value.assign(matched[4].first, matched[4].second);
+ if (sscanf(version_value.c_str(), "%d", &mBuild) != 1)
+ {
+ LL_ERRS("AppInit") << "failed to parse build version '" << version_value << "' as a number" << LL_ENDL;
+ }
+ }
+ else
+ {
+ LL_INFOS("AppInit")
+ << "OS build version not provided; using zero"
+ << LL_ENDL;
+ }
+ }
+ else
+ {
+ LL_WARNS("AppInit") << "glibc version '" << glibc_version << "' cannot be parsed to three numbers; using all zeros" << LL_ENDL;
+ }
+
+#else
+
+ struct utsname un;
+ if(uname(&un) != -1)
+ {
+ mOSStringSimple.append(un.sysname);
+ mOSStringSimple.append(" ");
+ mOSStringSimple.append(un.release);
+
+ mOSString = mOSStringSimple;
+ mOSString.append(" ");
+ mOSString.append(un.version);
+ mOSString.append(" ");
+ mOSString.append(un.machine);
+
+ // Simplify 'Simple'
+ std::string ostype = mOSStringSimple.substr(0, mOSStringSimple.find_first_of(" ", 0));
+ if (ostype == "Linux")
+ {
+ // Only care about major and minor Linux versions, truncate at second '.'
+ std::string::size_type idx1 = mOSStringSimple.find_first_of(".", 0);
+ std::string::size_type idx2 = (idx1 != std::string::npos) ? mOSStringSimple.find_first_of(".", idx1+1) : std::string::npos;
+ std::string simple = mOSStringSimple.substr(0, idx2);
+ if (simple.length() > 0)
+ mOSStringSimple = simple;
+ }
+ }
+ else
+ {
+ mOSStringSimple.append("Unable to collect OS info");
+ mOSString = mOSStringSimple;
+ }
+
+#endif
+
+ std::stringstream dotted_version_string;
+ dotted_version_string << mMajorVer << "." << mMinorVer << "." << mBuild;
+ mOSVersionString.append(dotted_version_string.str());
+
+ mOSBitness = is64Bit() ? 64 : 32;
+ LL_INFOS("LLOSInfo") << "OS bitness: " << mOSBitness << LL_ENDL;
+}
+
+#ifndef LL_WINDOWS
+// static
+long LLOSInfo::getMaxOpenFiles()
+{
+ const long OPEN_MAX_GUESS = 256;
+
+#ifdef OPEN_MAX
+ static long open_max = OPEN_MAX;
+#else
+ static long open_max = 0;
+#endif
+
+ if (0 == open_max)
+ {
+ // First time through.
+ errno = 0;
+ if ( (open_max = sysconf(_SC_OPEN_MAX)) < 0)
+ {
+ if (0 == errno)
+ {
+ // Indeterminate.
+ open_max = OPEN_MAX_GUESS;
+ }
+ else
+ {
+ LL_ERRS() << "LLOSInfo::getMaxOpenFiles: sysconf error for _SC_OPEN_MAX" << LL_ENDL;
+ }
+ }
+ }
+ return open_max;
+}
+#endif
+
+void LLOSInfo::stream(std::ostream& s) const
+{
+ s << mOSString;
+}
+
+const std::string& LLOSInfo::getOSString() const
+{
+ return mOSString;
+}
+
+const std::string& LLOSInfo::getOSStringSimple() const
+{
+ return mOSStringSimple;
+}
+
+const std::string& LLOSInfo::getOSVersionString() const
+{
+ return mOSVersionString;
+}
+
+const S32 LLOSInfo::getOSBitness() const
+{
+ return mOSBitness;
+}
+
+//static
+U32 LLOSInfo::getProcessVirtualSizeKB()
+{
+ U32 virtual_size = 0;
+#if LL_LINUX
+# define STATUS_SIZE 2048
+ LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb");
+ if (status_filep)
+ {
+ S32 numRead = 0;
+ char buff[STATUS_SIZE]; /* Flawfinder: ignore */
+
+ size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep);
+ buff[nbytes] = '\0';
+
+ // All these guys return numbers in KB
+ char *memp = strstr(buff, "VmSize:");
+ if (memp)
+ {
+ numRead += sscanf(memp, "%*s %u", &virtual_size);
+ }
+ fclose(status_filep);
+ }
+#endif
+ return virtual_size;
+}
+
+//static
+U32 LLOSInfo::getProcessResidentSizeKB()
+{
+ U32 resident_size = 0;
+#if LL_LINUX
+ LLFILE* status_filep = LLFile::fopen("/proc/self/status", "rb");
+ if (status_filep != NULL)
+ {
+ S32 numRead = 0;
+ char buff[STATUS_SIZE]; /* Flawfinder: ignore */
+
+ size_t nbytes = fread(buff, 1, STATUS_SIZE-1, status_filep);
+ buff[nbytes] = '\0';
+
+ // All these guys return numbers in KB
+ char *memp = strstr(buff, "VmRSS:");
+ if (memp)
+ {
+ numRead += sscanf(memp, "%*s %u", &resident_size);
+ }
+ fclose(status_filep);
+ }
+#endif
+ return resident_size;
+}
+
+//static
+bool LLOSInfo::is64Bit()
+{
+#if LL_WINDOWS
+#if defined(_WIN64)
+ return true;
+#elif defined(_WIN32)
+ // 32-bit viewer may be run on both 32-bit and 64-bit Windows, need to elaborate
+ bool f64 = false;
+ return IsWow64Process(GetCurrentProcess(), &f64) && f64;
+#else
+ return false;
+#endif
+#else // ! LL_WINDOWS
+ // we only build a 64-bit mac viewer and currently we don't build for linux at all
+ return true;
+#endif
+}
+
+LLCPUInfo::LLCPUInfo()
+{
+ std::ostringstream out;
+ LLProcessorInfo proc;
+ // proc.WriteInfoTextFile("procInfo.txt");
+ mHasSSE = proc.hasSSE();
+ mHasSSE2 = proc.hasSSE2();
+ mHasSSE3 = proc.hasSSE3();
+ mHasSSE3S = proc.hasSSE3S();
+ mHasSSE41 = proc.hasSSE41();
+ mHasSSE42 = proc.hasSSE42();
+ mHasSSE4a = proc.hasSSE4a();
+ mHasAltivec = proc.hasAltivec();
+ mCPUMHz = (F64)proc.getCPUFrequency();
+ mFamily = proc.getCPUFamilyName();
+ mCPUString = "Unknown";
+
+ out << proc.getCPUBrandName();
+ if (200 < mCPUMHz && mCPUMHz < 10000) // *NOTE: cpu speed is often way wrong, do a sanity check
+ {
+ out << " (" << mCPUMHz << " MHz)";
+ }
+ mCPUString = out.str();
+ LLStringUtil::trim(mCPUString);
+
+ if (mHasSSE)
+ {
+ mSSEVersions.append("1");
+ }
+ if (mHasSSE2)
+ {
+ mSSEVersions.append("2");
+ }
+ if (mHasSSE3)
+ {
+ mSSEVersions.append("3");
+ }
+ if (mHasSSE3S)
+ {
+ mSSEVersions.append("3S");
+ }
+ if (mHasSSE41)
+ {
+ mSSEVersions.append("4.1");
+ }
+ if (mHasSSE42)
+ {
+ mSSEVersions.append("4.2");
+ }
+ if (mHasSSE4a)
+ {
+ mSSEVersions.append("4a");
+ }
+}
+
+bool LLCPUInfo::hasAltivec() const
+{
+ return mHasAltivec;
+}
+
+bool LLCPUInfo::hasSSE() const
+{
+ return mHasSSE;
+}
+
+bool LLCPUInfo::hasSSE2() const
+{
+ return mHasSSE2;
+}
+
+bool LLCPUInfo::hasSSE3() const
+{
+ return mHasSSE3;
+}
+
+bool LLCPUInfo::hasSSE3S() const
+{
+ return mHasSSE3S;
+}
+
+bool LLCPUInfo::hasSSE41() const
+{
+ return mHasSSE41;
+}
+
+bool LLCPUInfo::hasSSE42() const
+{
+ return mHasSSE42;
+}
+
+bool LLCPUInfo::hasSSE4a() const
+{
+ return mHasSSE4a;
+}
+
+F64 LLCPUInfo::getMHz() const
+{
+ return mCPUMHz;
+}
+
+std::string LLCPUInfo::getCPUString() const
+{
+ return mCPUString;
+}
+
+const LLSD& LLCPUInfo::getSSEVersions() const
+{
+ return mSSEVersions;
+}
+
+void LLCPUInfo::stream(std::ostream& s) const
+{
+ // gather machine information.
+ s << LLProcessorInfo().getCPUFeatureDescription();
+
+ // These are interesting as they reflect our internal view of the
+ // CPU's attributes regardless of platform
+ s << "->mHasSSE: " << (U32)mHasSSE << std::endl;
+ s << "->mHasSSE2: " << (U32)mHasSSE2 << std::endl;
+ s << "->mHasSSE3: " << (U32)mHasSSE3 << std::endl;
+ s << "->mHasSSE3S: " << (U32)mHasSSE3S << std::endl;
+ s << "->mHasSSE41: " << (U32)mHasSSE41 << std::endl;
+ s << "->mHasSSE42: " << (U32)mHasSSE42 << std::endl;
+ s << "->mHasSSE4a: " << (U32)mHasSSE4a << std::endl;
+ s << "->mHasAltivec: " << (U32)mHasAltivec << std::endl;
+ s << "->mCPUMHz: " << mCPUMHz << std::endl;
+ s << "->mCPUString: " << mCPUString << std::endl;
+}
+
+// Helper class for LLMemoryInfo: accumulate stats in the form we store for
+// LLMemoryInfo::getStatsMap().
+class Stats
+{
+public:
+ Stats():
+ mStats(LLSD::emptyMap())
+ {}
+
+ // Store every integer type as LLSD::Integer.
+ template <class T>
+ void add(const LLSD::String& name, const T& value,
+ typename boost::enable_if<boost::is_integral<T> >::type* = 0)
+ {
+ mStats[name] = LLSD::Integer(value);
+ }
+
+ // Store every floating-point type as LLSD::Real.
+ template <class T>
+ void add(const LLSD::String& name, const T& value,
+ typename boost::enable_if<boost::is_float<T> >::type* = 0)
+ {
+ mStats[name] = LLSD::Real(value);
+ }
+
+ // Hope that LLSD::Date values are sufficiently unambiguous.
+ void add(const LLSD::String& name, const LLSD::Date& value)
+ {
+ mStats[name] = value;
+ }
+
+ LLSD get() const { return mStats; }
+
+private:
+ LLSD mStats;
+};
+
+LLMemoryInfo::LLMemoryInfo()
+{
+ refresh();
+}
+
+#if LL_WINDOWS
+static U32Kilobytes LLMemoryAdjustKBResult(U32Kilobytes inKB)
+{
+ // Moved this here from llfloaterabout.cpp
+
+ //! \bug
+ // For some reason, the reported amount of memory is always wrong.
+ // The original adjustment assumes it's always off by one meg, however
+ // errors of as much as 2520 KB have been observed in the value
+ // returned from the GetMemoryStatusEx function. Here we keep the
+ // original adjustment from llfoaterabout.cpp until this can be
+ // fixed somehow.
+ inKB += U32Megabytes(1);
+
+ return inKB;
+}
+#endif
+
+#if LL_DARWIN
+// static
+U32Kilobytes LLMemoryInfo::getHardwareMemSize()
+{
+ // This might work on Linux as well. Someone check...
+ uint64_t phys = 0;
+ int mib[2] = { CTL_HW, HW_MEMSIZE };
+
+ size_t len = sizeof(phys);
+ sysctl(mib, 2, &phys, &len, NULL, 0);
+
+ return U64Bytes(phys);
+}
+#endif
+
+U32Kilobytes LLMemoryInfo::getPhysicalMemoryKB() const
+{
+#if LL_WINDOWS
+ return LLMemoryAdjustKBResult(U32Kilobytes(mStatsMap["Total Physical KB"].asInteger()));
+
+#elif LL_DARWIN
+ return getHardwareMemSize();
+
+#elif LL_LINUX
+ U64 phys = 0;
+ phys = (U64)(getpagesize()) * (U64)(get_phys_pages());
+ return U64Bytes(phys);
+
+#else
+ return 0;
+
+#endif
+}
+
+//static
+void LLMemoryInfo::getAvailableMemoryKB(U32Kilobytes& avail_physical_mem_kb, U32Kilobytes& avail_virtual_mem_kb)
+{
+#if LL_WINDOWS
+ // Sigh, this shouldn't be a static method, then we wouldn't have to
+ // reload this data separately from refresh()
+ LLSD statsMap(loadStatsMap());
+
+ avail_physical_mem_kb = (U32Kilobytes)statsMap["Avail Physical KB"].asInteger();
+ avail_virtual_mem_kb = (U32Kilobytes)statsMap["Avail Virtual KB"].asInteger();
+
+#elif LL_DARWIN
+ // mStatsMap is derived from vm_stat, look for (e.g.) "kb free":
+ // $ vm_stat
+ // Mach Virtual Memory Statistics: (page size of 4096 bytes)
+ // Pages free: 462078.
+ // Pages active: 142010.
+ // Pages inactive: 220007.
+ // Pages wired down: 159552.
+ // "Translation faults": 220825184.
+ // Pages copy-on-write: 2104153.
+ // Pages zero filled: 167034876.
+ // Pages reactivated: 65153.
+ // Pageins: 2097212.
+ // Pageouts: 41759.
+ // Object cache: 841598 hits of 7629869 lookups (11% hit rate)
+ avail_physical_mem_kb = (U32Kilobytes)-1 ;
+ avail_virtual_mem_kb = (U32Kilobytes)-1 ;
+
+#elif LL_LINUX
+ // mStatsMap is derived from MEMINFO_FILE:
+ // $ cat /proc/meminfo
+ // MemTotal: 4108424 kB
+ // MemFree: 1244064 kB
+ // Buffers: 85164 kB
+ // Cached: 1990264 kB
+ // SwapCached: 0 kB
+ // Active: 1176648 kB
+ // Inactive: 1427532 kB
+ // Active(anon): 529152 kB
+ // Inactive(anon): 15924 kB
+ // Active(file): 647496 kB
+ // Inactive(file): 1411608 kB
+ // Unevictable: 16 kB
+ // Mlocked: 16 kB
+ // HighTotal: 3266316 kB
+ // HighFree: 721308 kB
+ // LowTotal: 842108 kB
+ // LowFree: 522756 kB
+ // SwapTotal: 6384632 kB
+ // SwapFree: 6384632 kB
+ // Dirty: 28 kB
+ // Writeback: 0 kB
+ // AnonPages: 528820 kB
+ // Mapped: 89472 kB
+ // Shmem: 16324 kB
+ // Slab: 159624 kB
+ // SReclaimable: 145168 kB
+ // SUnreclaim: 14456 kB
+ // KernelStack: 2560 kB
+ // PageTables: 5560 kB
+ // NFS_Unstable: 0 kB
+ // Bounce: 0 kB
+ // WritebackTmp: 0 kB
+ // CommitLimit: 8438844 kB
+ // Committed_AS: 1271596 kB
+ // VmallocTotal: 122880 kB
+ // VmallocUsed: 65252 kB
+ // VmallocChunk: 52356 kB
+ // HardwareCorrupted: 0 kB
+ // HugePages_Total: 0
+ // HugePages_Free: 0
+ // HugePages_Rsvd: 0
+ // HugePages_Surp: 0
+ // Hugepagesize: 2048 kB
+ // DirectMap4k: 434168 kB
+ // DirectMap2M: 477184 kB
+ // (could also run 'free', but easier to read a file than run a program)
+ avail_physical_mem_kb = (U32Kilobytes)-1 ;
+ avail_virtual_mem_kb = (U32Kilobytes)-1 ;
+
+#else
+ //do not know how to collect available memory info for other systems.
+ //leave it blank here for now.
+
+ avail_physical_mem_kb = (U32Kilobytes)-1 ;
+ avail_virtual_mem_kb = (U32Kilobytes)-1 ;
+#endif
+}
+
+void LLMemoryInfo::stream(std::ostream& s) const
+{
+ // We want these memory stats to be easy to grep from the log, along with
+ // the timestamp. So preface each line with the timestamp and a
+ // distinctive marker. Without that, we'd have to search the log for the
+ // introducer line, then read subsequent lines, etc...
+ std::string pfx(LLError::utcTime() + " <mem> ");
+
+ // Max key length
+ size_t key_width(0);
+ for (const auto& [key, value] : inMap(mStatsMap))
+ {
+ size_t len(key.length());
+ if (len > key_width)
+ {
+ key_width = len;
+ }
+ }
+
+ // Now stream stats
+ for (const auto& [key, value] : inMap(mStatsMap))
+ {
+ s << pfx << std::setw(narrow<size_t>(key_width+1)) << (key + ':') << ' ';
+ if (value.isInteger())
+ s << std::setw(12) << value.asInteger();
+ else if (value.isReal())
+ s << std::fixed << std::setprecision(1) << value.asReal();
+ else if (value.isDate())
+ value.asDate().toStream(s);
+ else
+ s << value; // just use default LLSD formatting
+ s << std::endl;
+ }
+}
+
+LLSD LLMemoryInfo::getStatsMap() const
+{
+ return mStatsMap;
+}
+
+LLMemoryInfo& LLMemoryInfo::refresh()
+{
+ LL_PROFILE_ZONE_SCOPED
+ mStatsMap = loadStatsMap();
+
+ LL_DEBUGS("LLMemoryInfo") << "Populated mStatsMap:\n";
+ LLSDSerialize::toPrettyXML(mStatsMap, LL_CONT);
+ LL_ENDL;
+
+ return *this;
+}
+
+LLSD LLMemoryInfo::loadStatsMap()
+{
+ LL_PROFILE_ZONE_SCOPED;
+
+ // This implementation is derived from stream() code (as of 2011-06-29).
+ Stats stats;
+
+ // associate timestamp for analysis over time
+ stats.add("timestamp", LLDate::now());
+
+#if LL_WINDOWS
+ MEMORYSTATUSEX state;
+ state.dwLength = sizeof(state);
+ GlobalMemoryStatusEx(&state);
+
+ DWORDLONG div = 1024;
+
+ stats.add("Percent Memory use", state.dwMemoryLoad/div);
+ stats.add("Total Physical KB", state.ullTotalPhys/div);
+ stats.add("Avail Physical KB", state.ullAvailPhys/div);
+ stats.add("Total page KB", state.ullTotalPageFile/div);
+ stats.add("Avail page KB", state.ullAvailPageFile/div);
+ stats.add("Total Virtual KB", state.ullTotalVirtual/div);
+ stats.add("Avail Virtual KB", state.ullAvailVirtual/div);
+
+ // SL-12122 - Call to GetPerformanceInfo() was removed here. Took
+ // on order of 10 ms, causing unacceptable frame time spike every
+ // second, and results were never used. If this is needed in the
+ // future, must find a way to avoid frame time impact (e.g. move
+ // to another thread, call much less often).
+
+ PROCESS_MEMORY_COUNTERS_EX pmem;
+ pmem.cb = sizeof(pmem);
+ // GetProcessMemoryInfo() is documented to accept either
+ // PROCESS_MEMORY_COUNTERS* or PROCESS_MEMORY_COUNTERS_EX*, presumably
+ // using the redundant size info to distinguish. But its prototype
+ // specifically accepts PROCESS_MEMORY_COUNTERS*, and since this is a
+ // classic-C API, PROCESS_MEMORY_COUNTERS_EX isn't a subclass. Cast the
+ // pointer.
+ GetProcessMemoryInfo(GetCurrentProcess(), PPROCESS_MEMORY_COUNTERS(&pmem), sizeof(pmem));
+
+ stats.add("Page Fault Count", pmem.PageFaultCount);
+ stats.add("PeakWorkingSetSize KB", pmem.PeakWorkingSetSize/div);
+ stats.add("WorkingSetSize KB", pmem.WorkingSetSize/div);
+ stats.add("QutaPeakPagedPoolUsage KB", pmem.QuotaPeakPagedPoolUsage/div);
+ stats.add("QuotaPagedPoolUsage KB", pmem.QuotaPagedPoolUsage/div);
+ stats.add("QuotaPeakNonPagedPoolUsage KB", pmem.QuotaPeakNonPagedPoolUsage/div);
+ stats.add("QuotaNonPagedPoolUsage KB", pmem.QuotaNonPagedPoolUsage/div);
+ stats.add("PagefileUsage KB", pmem.PagefileUsage/div);
+ stats.add("PeakPagefileUsage KB", pmem.PeakPagefileUsage/div);
+ stats.add("PrivateUsage KB", pmem.PrivateUsage/div);
+
+#elif LL_DARWIN
+
+ const vm_size_t pagekb(vm_page_size / 1024);
+
+ //
+ // Collect the vm_stat's
+ //
+
+ {
+ vm_statistics64_data_t vmstat;
+ mach_msg_type_number_t vmstatCount = HOST_VM_INFO64_COUNT;
+
+ if (host_statistics64(mach_host_self(), HOST_VM_INFO64, (host_info64_t) &vmstat, &vmstatCount) != KERN_SUCCESS)
+ {
+ LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL;
+ }
+ else
+ {
+ stats.add("Pages free KB", pagekb * vmstat.free_count);
+ stats.add("Pages active KB", pagekb * vmstat.active_count);
+ stats.add("Pages inactive KB", pagekb * vmstat.inactive_count);
+ stats.add("Pages wired KB", pagekb * vmstat.wire_count);
+
+ stats.add("Pages zero fill", vmstat.zero_fill_count);
+ stats.add("Page reactivations", vmstat.reactivations);
+ stats.add("Page-ins", vmstat.pageins);
+ stats.add("Page-outs", vmstat.pageouts);
+
+ stats.add("Faults", vmstat.faults);
+ stats.add("Faults copy-on-write", vmstat.cow_faults);
+
+ stats.add("Cache lookups", vmstat.lookups);
+ stats.add("Cache hits", vmstat.hits);
+
+ stats.add("Page purgeable count", vmstat.purgeable_count);
+ stats.add("Page purges", vmstat.purges);
+
+ stats.add("Page speculative reads", vmstat.speculative_count);
+ }
+ }
+
+ //
+ // Collect the misc task info
+ //
+
+ {
+ task_events_info_data_t taskinfo;
+ unsigned taskinfoSize = sizeof(taskinfo);
+
+ if (task_info(mach_task_self(), TASK_EVENTS_INFO, (task_info_t) &taskinfo, &taskinfoSize) != KERN_SUCCESS)
+ {
+ LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL;
+ }
+ else
+ {
+ stats.add("Task page-ins", taskinfo.pageins);
+ stats.add("Task copy-on-write faults", taskinfo.cow_faults);
+ stats.add("Task messages sent", taskinfo.messages_sent);
+ stats.add("Task messages received", taskinfo.messages_received);
+ stats.add("Task mach system call count", taskinfo.syscalls_mach);
+ stats.add("Task unix system call count", taskinfo.syscalls_unix);
+ stats.add("Task context switch count", taskinfo.csw);
+ }
+ }
+
+ //
+ // Collect the basic task info
+ //
+
+ {
+ mach_task_basic_info_data_t taskinfo;
+ mach_msg_type_number_t task_count = MACH_TASK_BASIC_INFO_COUNT;
+ if (task_info(mach_task_self(), MACH_TASK_BASIC_INFO, (task_info_t) &taskinfo, &task_count) != KERN_SUCCESS)
+ {
+ LL_WARNS("LLMemoryInfo") << "Unable to collect task information" << LL_ENDL;
+ }
+ else
+ {
+ stats.add("Basic virtual memory KB", taskinfo.virtual_size / 1024);
+ stats.add("Basic resident memory KB", taskinfo.resident_size / 1024);
+ stats.add("Basic max resident memory KB", taskinfo.resident_size_max / 1024);
+ stats.add("Basic new thread policy", taskinfo.policy);
+ stats.add("Basic suspend count", taskinfo.suspend_count);
+ }
+ }
+
+#elif LL_LINUX
+ std::ifstream meminfo(MEMINFO_FILE);
+ if (meminfo.is_open())
+ {
+ // MemTotal: 4108424 kB
+ // MemFree: 1244064 kB
+ // Buffers: 85164 kB
+ // Cached: 1990264 kB
+ // SwapCached: 0 kB
+ // Active: 1176648 kB
+ // Inactive: 1427532 kB
+ // ...
+ // VmallocTotal: 122880 kB
+ // VmallocUsed: 65252 kB
+ // VmallocChunk: 52356 kB
+ // HardwareCorrupted: 0 kB
+ // HugePages_Total: 0
+ // HugePages_Free: 0
+ // HugePages_Rsvd: 0
+ // HugePages_Surp: 0
+ // Hugepagesize: 2048 kB
+ // DirectMap4k: 434168 kB
+ // DirectMap2M: 477184 kB
+
+ // Intentionally don't pass the boost::no_except flag. This
+ // boost::regex object is constructed with a string literal, so it
+ // should be valid every time. If it becomes invalid, we WANT an
+ // exception, hopefully even before the dev checks in.
+ boost::regex stat_rx("(.+): +([0-9]+)( kB)?");
+ boost::smatch matched;
+
+ std::string line;
+ while (std::getline(meminfo, line))
+ {
+ LL_DEBUGS("LLMemoryInfo") << line << LL_ENDL;
+ if (ll_regex_match(line, matched, stat_rx))
+ {
+ // e.g. "MemTotal: 4108424 kB"
+ LLSD::String key(matched[1].first, matched[1].second);
+ LLSD::String value_str(matched[2].first, matched[2].second);
+ LLSD::Integer value(0);
+ try
+ {
+ value = boost::lexical_cast<LLSD::Integer>(value_str);
+ }
+ catch (const boost::bad_lexical_cast&)
+ {
+ LL_WARNS("LLMemoryInfo") << "couldn't parse '" << value_str
+ << "' in " << MEMINFO_FILE << " line: "
+ << line << LL_ENDL;
+ continue;
+ }
+ // Store this statistic.
+ stats.add(key, value);
+ }
+ else
+ {
+ LL_WARNS("LLMemoryInfo") << "unrecognized " << MEMINFO_FILE << " line: "
+ << line << LL_ENDL;
+ }
+ }
+ }
+ else
+ {
+ LL_WARNS("LLMemoryInfo") << "Unable to collect memory information" << LL_ENDL;
+ }
+
+#else
+ LL_WARNS("LLMemoryInfo") << "Unknown system; unable to collect memory information" << LL_ENDL;
+
+#endif
+
+ return stats.get();
+}
+
+std::ostream& operator<<(std::ostream& s, const LLOSInfo& info)
+{
+ info.stream(s);
+ return s;
+}
+
+std::ostream& operator<<(std::ostream& s, const LLCPUInfo& info)
+{
+ info.stream(s);
+ return s;
+}
+
+std::ostream& operator<<(std::ostream& s, const LLMemoryInfo& info)
+{
+ info.stream(s);
+ return s;
+}
+
+class FrameWatcher
+{
+public:
+ FrameWatcher():
+ // Hooking onto the "mainloop" event pump gets us one call per frame.
+ mConnection(LLEventPumps::instance()
+ .obtain("mainloop")
+ .listen("FrameWatcher", boost::bind(&FrameWatcher::tick, this, _1))),
+ // Initializing mSampleStart to an invalid timestamp alerts us to skip
+ // trying to compute framerate on the first call.
+ mSampleStart(-1),
+ // Initializing mSampleEnd to 0 ensures that we treat the first call
+ // as the completion of a sample window.
+ mSampleEnd(0),
+ mFrames(0),
+ // Both MEM_INFO_WINDOW and MEM_INFO_THROTTLE are in seconds. We need
+ // the number of integer MEM_INFO_THROTTLE sample slots that will fit
+ // in MEM_INFO_WINDOW. Round up.
+ mSamples(int((MEM_INFO_WINDOW / MEM_INFO_THROTTLE) + 0.7)),
+ // Initializing to F32_MAX means that the first real frame will become
+ // the slowest ever, which sounds like a good idea.
+ mSlowest(F32_MAX)
+ {}
+
+ bool tick(const LLSD&)
+ {
+ F32 timestamp(mTimer.getElapsedTimeF32());
+
+ // Count this frame in the interval just completed.
+ ++mFrames;
+
+ // Have we finished a sample window yet?
+ if (timestamp < mSampleEnd)
+ {
+ // no, just keep waiting
+ return false;
+ }
+
+ // Set up for next sample window. Capture values for previous frame in
+ // local variables and reset data members.
+ U32 frames(mFrames);
+ F32 sampleStart(mSampleStart);
+ // No frames yet in next window
+ mFrames = 0;
+ // which starts right now
+ mSampleStart = timestamp;
+ // and ends MEM_INFO_THROTTLE seconds in the future
+ mSampleEnd = mSampleStart + MEM_INFO_THROTTLE;
+
+ // On the very first call, that's all we can do, no framerate
+ // computation is possible.
+ if (sampleStart < 0)
+ {
+ return false;
+ }
+
+ // How long did this actually take? As framerate slows, the duration
+ // of the frame we just finished could push us WELL beyond our desired
+ // sample window size.
+ F32 elapsed(timestamp - sampleStart);
+ F32 framerate(frames/elapsed);
+
+ // Remember previous slowest framerate because we're just about to
+ // update it.
+ F32 slowest(mSlowest);
+ // Remember previous number of samples.
+ boost::circular_buffer<F32>::size_type prevSize(mSamples.size());
+
+ // Capture new framerate in our samples buffer. Once the buffer is
+ // full (after MEM_INFO_WINDOW seconds), this will displace the oldest
+ // sample. ("So they all rolled over, and one fell out...")
+ mSamples.push_back(framerate);
+
+ // Calculate the new minimum framerate. I know of no way to update a
+ // rolling minimum without ever rescanning the buffer. But since there
+ // are only a few tens of items in this buffer, rescanning it is
+ // probably cheaper (and certainly easier to reason about) than
+ // attempting to optimize away some of the scans.
+ mSlowest = framerate; // pick an arbitrary entry to start
+ for (boost::circular_buffer<F32>::const_iterator si(mSamples.begin()), send(mSamples.end());
+ si != send; ++si)
+ {
+ if (*si < mSlowest)
+ {
+ mSlowest = *si;
+ }
+ }
+
+ // We're especially interested in memory as framerate drops. Only log
+ // when framerate drops below the slowest framerate we remember.
+ // (Should always be true for the end of the very first sample
+ // window.)
+ if (framerate >= slowest)
+ {
+ return false;
+ }
+ // Congratulations, we've hit a new low. :-P
+
+ LL_INFOS("FrameWatcher") << ' ';
+ if (! prevSize)
+ {
+ LL_CONT << "initial framerate ";
+ }
+ else
+ {
+ LL_CONT << "slowest framerate for last " << int(prevSize * MEM_INFO_THROTTLE)
+ << " seconds ";
+ }
+
+ auto precision = LL_CONT.precision();
+
+ LL_CONT << std::fixed << std::setprecision(1) << framerate << '\n'
+ << LLMemoryInfo();
+
+ LL_CONT.precision(precision);
+ LL_CONT << LL_ENDL;
+ return false;
+ }
+
+private:
+ // Storing the connection in an LLTempBoundListener ensures it will be
+ // disconnected when we're destroyed.
+ LLTempBoundListener mConnection;
+ // Track elapsed time
+ LLTimer mTimer;
+ // Some of what you see here is in fact redundant with functionality you
+ // can get from LLTimer. Unfortunately the LLTimer API is missing the
+ // feature we need: has at least the stated interval elapsed, and if so,
+ // exactly how long has passed? So we have to do it by hand, sigh.
+ // Time at start, end of sample window
+ F32 mSampleStart, mSampleEnd;
+ // Frames this sample window
+ U32 mFrames;
+ // Sliding window of framerate samples
+ boost::circular_buffer<F32> mSamples;
+ // Slowest framerate in mSamples
+ F32 mSlowest;
+};
+
+// Need an instance of FrameWatcher before it does any good
+static FrameWatcher sFrameWatcher;
+
+bool gunzip_file(const std::string& srcfile, const std::string& dstfile)
+{
+ std::string tmpfile;
+ const S32 UNCOMPRESS_BUFFER_SIZE = 32768;
+ bool retval = false;
+ gzFile src = NULL;
+ U8 buffer[UNCOMPRESS_BUFFER_SIZE];
+ LLFILE *dst = NULL;
+ S32 bytes = 0;
+ tmpfile = dstfile + ".t";
+#ifdef LL_WINDOWS
+ llutf16string utf16filename = utf8str_to_utf16str(srcfile);
+ src = gzopen_w(utf16filename.c_str(), "rb");
+#else
+ src = gzopen(srcfile.c_str(), "rb");
+#endif
+ if (! src) goto err;
+ dst = LLFile::fopen(tmpfile, "wb"); /* Flawfinder: ignore */
+ if (! dst) goto err;
+ do
+ {
+ bytes = gzread(src, buffer, UNCOMPRESS_BUFFER_SIZE);
+ size_t nwrit = fwrite(buffer, sizeof(U8), bytes, dst);
+ if (nwrit < (size_t) bytes)
+ {
+ LL_WARNS() << "Short write on " << tmpfile << ": Wrote " << nwrit << " of " << bytes << " bytes." << LL_ENDL;
+ goto err;
+ }
+ } while(gzeof(src) == 0);
+ fclose(dst);
+ dst = NULL;
+#if LL_WINDOWS
+ // Rename in windows needs the dstfile to not exist.
+ LLFile::remove(dstfile, ENOENT);
+#endif
+ if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */
+ retval = true;
+err:
+ if (src != NULL) gzclose(src);
+ if (dst != NULL) fclose(dst);
+ return retval;
+}
+
+bool gzip_file(const std::string& srcfile, const std::string& dstfile)
+{
+ const S32 COMPRESS_BUFFER_SIZE = 32768;
+ std::string tmpfile;
+ bool retval = false;
+ U8 buffer[COMPRESS_BUFFER_SIZE];
+ gzFile dst = NULL;
+ LLFILE *src = NULL;
+ S32 bytes = 0;
+ tmpfile = dstfile + ".t";
+
+#ifdef LL_WINDOWS
+ llutf16string utf16filename = utf8str_to_utf16str(tmpfile);
+ dst = gzopen_w(utf16filename.c_str(), "wb");
+#else
+ dst = gzopen(tmpfile.c_str(), "wb");
+#endif
+
+ if (! dst) goto err;
+ src = LLFile::fopen(srcfile, "rb"); /* Flawfinder: ignore */
+ if (! src) goto err;
+
+ while ((bytes = (S32)fread(buffer, sizeof(U8), COMPRESS_BUFFER_SIZE, src)) > 0)
+ {
+ if (gzwrite(dst, buffer, bytes) <= 0)
+ {
+ LL_WARNS() << "gzwrite failed: " << gzerror(dst, NULL) << LL_ENDL;
+ goto err;
+ }
+ }
+
+ if (ferror(src))
+ {
+ LL_WARNS() << "Error reading " << srcfile << LL_ENDL;
+ goto err;
+ }
+
+ gzclose(dst);
+ dst = NULL;
+#if LL_WINDOWS
+ // Rename in windows needs the dstfile to not exist.
+ LLFile::remove(dstfile);
+#endif
+ if (LLFile::rename(tmpfile, dstfile) == -1) goto err; /* Flawfinder: ignore */
+ retval = true;
+ err:
+ if (src != NULL) fclose(src);
+ if (dst != NULL) gzclose(dst);
+ return retval;
+}
generated by cgit v1.2.3 (git 2.25.1) at 2025-04-27 04:03:09 +0000